| Revision as of 17:01, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 427097723 of page 2,4,6-Trichlorophenol for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 00:14, 29 October 2024 edit YBG (talk | contribs)Extended confirmed users15,573 editsNo edit summaryTags: Mobile edit Mobile web edit Advanced mobile edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 385182782 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = '''2,4,6-Trichlorophenol''' |
|
|
⚫ |
| verifiedrevid = 477210819 |
| ⚫ |
| ImageFile = 2,4,6-Trichlorophenol.svg |
|
|
⚫ |
| Name = 2,4,6-Trichlorophenol |
| ⚫ |
| ImageSize = 120px |
|
|
⚫ |
| ImageFile = 2,4,6-Trichlorophenol.svg |
| ⚫ |
| ImageName = Chemical structure of 2,4,6-trichlorophenol |
|
|
⚫ |
| ImageSize = 120px |
| ⚫ |
| IUPACName = 2,4,6-Trichlorophenol |
|
|
|
| ImageFile2 = 2,4,6-Trichlorophenol.jpg |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageSize2 = 250px |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| ImageName = Chemical structure of 2,4,6-trichlorophenol |
|
| ChemSpiderID = 6648 |
|
|
|
| ImageFileL1 = 2,4,6-Trichlorophenol Ball and Stick.png |
| ⚫ |
| CASNo_Ref = {{cascite}} |
|
|
|
| ImageSizeL1 = 120px |
|
|
| ImageFileR1 = 2,4,6-Trichlorophenol Space Fill.png |
|
|
| ImageSizeR1 = 135px |
|
⚫ |
| PIN = 2,4,6-Trichlorophenol |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 88-06-2 |
|
| CASNo = 88-06-2 |
|
|
| Beilstein = 776729 |
| ⚫ |
| SMILES = OC1=C(C=C(C=C1Cl)Cl)Cl |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| RTECS = SN1575000 |
|
|
| UNNumber = 2020 |
|
| ChemSpiderID = 6648 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| EINECS = 604-018-00-5 |
|
|
|
| ChEBI = 28755 |
|
|
| ChEMBL = 309917 |
|
⚫ |
| EINECS = 201-795-9 |
|
|
| Gmelin = 3766 |
|
|
| KEGG = C07098 |
|
|
| PubChem = 6914 |
|
⚫ |
| RTECS = SN1575000 |
|
|
| UNNumber = 2020 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = MHS8C5BAUZ |
|
|
| StdInChI=1S/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
|
|
| StdInChIKey = LINPIYWFGCPVIE-UHFFFAOYSA-N |
|
⚫ |
| SMILES = OC1=C(C=C(C=C1Cl)Cl)Cl |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| Appearance = yellow-whitish lumps or powder |
|
| Formula = C<sub>6</sub>H<sub>2</sub>Cl<sub>3</sub>OH/C<sub>6</sub>H<sub>3</sub>Cl<sub>3</sub>O |
|
| Formula = C<sub>6</sub>H<sub>2</sub>Cl<sub>3</sub>OH/C<sub>6</sub>H<sub>3</sub>Cl<sub>3</sub>O |
|
| MolarMass = 197.45 g/mol |
|
|
| Density = 1.675 g/cm<sup>3</sup> |
|
| MolarMass = 197.45 g/mol |
|
|
| Density = 1.4901 g/cm<sup>3</sup> at 75 °C<ref name=crc/> |
|
| MeltingPt = 69 °C |
|
|
|
| MeltingPtC = 69.5 |
|
| BoilingPt = 246 °C at 28 torr |
|
|
|
| MeltingPt_ref=<ref name=crc>Haynes, p. 3.522</ref> |
|
|
| BoilingPtC = 249 |
|
|
| BoilingPt_ref=<ref name=crc/> |
|
|
| Solubility = 0.069 g/100 g H<sub>2</sub>O<ref name="CRC97">{{Cite book |title=CRC handbook of chemistry and physics : a ready-reference book of chemical and physical data. |date=2016 |editor=William M. Haynes |isbn=978-1-4987-5428-6 |edition=97th |location=Boca Raton, Florida |publisher=CRC Press |oclc=930681942}}</ref> |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| RPhrases = {{R22}}, {{R36}}, {{R38}}, {{R40}}, {{R50}}, {{R53}} |
|
| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
| SPhrases = {{S2}}, {{S36}}, {{S37}}, {{S60}}, {{S61}} |
|
|
|
| HPhrases = {{H-phrases|302|315|319|351|410}} |
|
|
| PPhrases = {{P-phrases|201|202|264|270|273|280|281|301+312|302+352|305+351+338|308+313|321|330|332+313|337+313|362|391|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2,4,6-Trichlorophenol''', also known as '''TCP''', '''phenaclor''', '''Dowicide 2S''', '''Dowcide 2S''', '''omal''', is a chlorinated phenol that has been used as a ], ], ], ],<ref>{{cite journal |vauthors=Ogunniyi TA, Oni PO, Juba A, Asaolu SO, Kolawole DO | title=Disinfectants/antiseptics in the management of guinea worm ulcers in the rural areas | journal=Acta Tropica | volume=74 | issue=1 | pages=33–38(6) | date=2000-01-05 | doi=10.1016/S0001-706X(99)00057-1| pmid=10643905 }}</ref> ], and glue ].<ref name="msds">{{cite web | title=Safety data for 2,4,6-trichlorophenol | publisher=] | date=2005-09-05 | url=http://physchem.ox.ac.uk/MSDS/TR/2,4,6-trichlorophenol.html | archive-url=https://archive.today/20071014083328/http://physchem.ox.ac.uk/MSDS/TR/2,4,6-trichlorophenol.html | url-status=dead | archive-date=2007-10-14 | access-date=2007-11-16 }}</ref> It is a clear to yellowish crystalline solid with a strong, phenolic odor. It decomposes on heating to produce toxic and corrosive fumes including ] and ]. |
|
|
|
|
|
== Preparation == |
|
|
2,4,6-Trichlorophenol is produced industrially by the ] of ]:<ref name="ullmannchlorophenols">{{Citation |last1=Muller |first1=François |title=Chlorophenols |date=2011-10-15 |url=https://onlinelibrary.wiley.com/doi/10.1002/14356007.a07_001.pub2 |encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry |pages=a07_001.pub2 |editor-last=Wiley-VCH Verlag GmbH & Co. KGaA |place=Weinheim, Germany |publisher=Wiley-VCH Verlag GmbH & Co. KGaA |language=en |doi=10.1002/14356007.a07_001.pub2 |isbn=978-3-527-30673-2 |access-date=2022-03-13 |last2=Caillard |first2=Liliane}}</ref> |
|
|
|
|
|
:] |
|
|
|
|
|
== Health effects == |
|
|
In animal models, consumption of 2,4,6-trichlorophenol leads to an increased incidence of ]s, ], and ].<ref name="berkeley">{{cite web | title=2,4,6-Trichlorophenol | publisher=The Carcinogenic Potency Database Project, University of Berkeley | date=2007-10-03 | url=http://potency.berkeley.edu/chempages/2,4,6-TRICHLOROPHENOL.html | access-date=2007-11-16| archive-url= https://web.archive.org/web/20071204004358/http://potency.berkeley.edu/chempages/2%2C4%2C6-TRICHLOROPHENOL.html| archive-date= 4 December 2007 <!--DASHBot-->| url-status=live}}</ref><ref name="epa"/> It is classified as ''Group B2'' (probable human carcinogen) by the ].<ref name="epa">{{cite web | title=2,4,6 Trichlorophenol | publisher=] |date=Jan 2000 | url=http://www.epa.gov/ttn/atw/hlthef/tri-phen.html | access-date =2007-11-16}}</ref> The technical grade of this substance may contain ] (PCDDs), ] (PCDFs), and other contaminants.<ref>{{cite web| title=2,4,6-Trichlorophenol | volume=ICSC 1122 | publisher=IPCS | date=Nov 1998 | url=http://www.oit.org/public/english/protection/safework/cis/products/icsc/dtasht/_icsc11/icsc1122.htm | access-date=2007-11-16 | archive-url=https://web.archive.org/web/20130627222341/http://www.ilo.org/safework/lang--en/index.htm | archive-date=2013-06-27 | url-status=dead }}{{not in source|date=February 2020}}</ref> |
|
|
|
|
|
==Environmental effects== |
|
|
2,4,6-Trichlorophenol is an environmental pollutant that has been found in fresh water lakes such as the ].<ref name="halappagowdal">{{cite journal |author1=TP Halappa Gowdal |author2=John D Lock |author3=Ruth G Kurtz | title=A comprehensive study of risk assessment for a hazardous compound of public health concern | volume=24 | issue=2 |pages=189 |date=Feb 1985 | doi=10.1007/BF00285444 | journal=Water, Air, & Soil Pollution|bibcode=1985WASP...24..189H |s2cid=96067556 }}</ref> |
|
|
|
|
|
==See also== |
|
|
*] (for other isomers). |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
==Cited sources== |
|
|
*{{cite book |ref=Haynes| editor= Haynes, William M. | date = 2016| title = ] | edition = 97th | publisher = ] | isbn = 9781498754293}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
* |
|
|
|
|
|
{{DEFAULTSORT:Trichlorophenol, 2,4,6-}} |
|
|
] |
|
|
] |
|
|
] |