Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 17:12, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 456499890 of page 2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').  Latest revision as of 18:17, 18 August 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,998 editsm Added UNII 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456498911 | verifiedrevid = 477212414
| ImageFile = Pteridine diphosphate.svg | ImageFile = Pteridine diphosphate.svg
| ImageFile_Ref = {{chemboximage|correct|??}} | ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 244 | ImageSize = 244
| ImageName = Skeletal formula of 2-amino-4-hydroxy-6-pyrophosphoryl-methylpteridine | ImageName = Skeletal formula of 2-amino-4-hydroxy-6-pyrophosphoryl-methylpteridine
| IUPACName = (2-Amino-4-oxo-7,8-dihydro-1''H''-pteridin-6-yl)methyl phosphono hydrogen phosphate | PIN = (2-Amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl trihydrogen diphosphate
| OtherNames = Pteridine diphosphate | OtherNames = Pteridine diphosphate
| Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 3545-84-4 --> | CASNo = 3545-84-4
| CASNo_Ref = {{cascite|changed|??}} | CASNo_Ref = {{cascite|changed|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 666
| UNII = CFG9B839S3
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| ChemSpiderID = 646 | PubChem = 666
| ChemSpiderID = 646
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| KEGG = C04807
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C04807
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = 2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine | MeSHName = 2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15998 | ChEBI = 15998
| ChEMBL = <!-- blanked - oldvalue: 1229984 --> | ChEMBL = 1229984
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 8397629 | Beilstein = 8397629
| 3DMet = B01792 | 3DMet = B01816
| SMILES = NC1=NC(=O)C2=C(NCC(COP(O)(=O)OP(O)(O)=O)=N2)N1 | SMILES = NC1=NC(=O)C2=C(NCC(COP(O)(=O)OP(O)(O)=O)=N2)N1
| SMILES1 = C1C(=NC2=C(N1)NC(=NC2=O)N)COP(=O)(O)OP(=O)(O)O | SMILES1 = C1C(=NC2=C(N1)NC(=NC2=O)N)COP(=O)(O)OP(=O)(O)O
| SMILES2 = O=P(O)(O)OP(=O)(O)OCC/1=N/C=2C(=O)\N=C(/NC=2NC\1)N | SMILES2 = O=P(O)(O)OP(=O)(O)OCC/1=N/C=2C(=O)\N=C(/NC=2NC\1)N
| StdInChI = 1S/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13) | StdInChI = 1S/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13) | InChI = 1/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13)
| StdInChIKey = FCQGJGLSOWZZON-UHFFFAOYSA-N | StdInChIKey = FCQGJGLSOWZZON-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = FCQGJGLSOWZZON-UHFFFAOYAR | InChIKey = FCQGJGLSOWZZON-UHFFFAOYAR
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=7 | H=11 | N=5 | O=8 | P=2
| C = 7
| H = 11 | LogP = -2.915
| N = 5 | pKa = 1.252
| O = 8 | pKb = 12.745
| P = 2
| ExactMass = 355.008285377 g mol<sup>-1</sup>
| LogP = -2.915
| pKa = 1.252
| pKb = 12.745
}} }}
}} }}
'''2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine''' ('''7,8-Dihydropterin pyrophosphate''', '''dihydropterin-CH2OH-diphosphate''') is a ]; a precursor to ].<ref>{{cite book|doi=10.1016/S0083-6729(08)00415-9|pmid=18804704|year = 2008|last1 = Derrick|first1 = J. P|title=The structure and mechanism of 6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase|volume=79|pages=411–33|series=Vitamins & Hormones|isbn=9780123742322}}</ref>

==References==
{{Reflist}}

{{DEFAULTSORT:Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine, 2-}}
]


{{Organic-compound-stub}}
{{Biochem-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2-Amino-4-hydroxy-6-pyrophosphoryl-methylpteridine: Difference between pages Add topic