| Revision as of 18:29, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 426680563 of page 5-Formiminotetrahydrofolate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 12:03, 11 April 2017 edit DePiep (talk | contribs)Extended confirmed users294,285 editsm →top: Protect -{ markup from preprocessor: phab:T146304, explained. using AWBTag: nowiki added |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 399333866 |
|
| verifiedrevid = 477224528 |
|
|ImageFile=5-formiminotetrahydrofolate.png |
|
| ImageFile=5-formiminotetrahydrofolate.png |
|
|ImageSize=200px |
|
| ImageSize=250px |
|
|
| ImageAlt = Skeletal formula of 5-formiminotetrahydrofolate. |
| ⚫ |
|IUPACName=(2''S'')-2-{benzoyl]amino}pentanedioic acid |
|
|
|
| ImageFile1 = 5-Formiminotetrahydrofolate-3D-spacefill.png |
| ⚫ |
|OtherNames= |
|
|
|
| ImageSize1 = 250 |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Skeletal formula of the 5-formiminotetrahydrofolate molecule |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| IUPACName=(2''S'')-2-<nowiki/>{benzoyl]amino}pentanedioic acid |
|
⚫ |
| OtherNames= |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21232465 |
|
| ChemSpiderID = 21232465 |
|
| InChI = 1/C20H24N8O6/c21-9-28-12(8-24-16-15(28)18(32)27-20(22)26-16)7-23-11-3-1-10(2-4-11)17(31)25-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,21,23H,5-8H2,(H,25,31)(H,29,30)(H,33,34)(H4,22,24,26,27,32)/p-2/t12-,13+/m1/s1 |
|
| InChI = 1/C20H24N8O6/c21-9-28-12(8-24-16-15(28)18(32)27-20(22)26-16)7-23-11-3-1-10(2-4-11)17(31)25-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,21,23H,5-8H2,(H,25,31)(H,29,30)(H,33,34)(H4,22,24,26,27,32)/p-2/t12-,13+/m1/s1 |
| Line 16: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YCWUVLPMLLBDCU-UHFFFAOYSA-L |
|
| StdInChIKey = YCWUVLPMLLBDCU-UHFFFAOYSA-L |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 2311-81-1 --> |
|
|
|
| CASNo=2311-81-1 |
|
| PubChem=530 |
|
| PubChem=530 |
|
| SMILES = c1cc(ccc1C(=O)NC(CCC(=O))C(=O))NCC2CNc3c(c(=O)c(n3)N)N2C=N |
|
| SMILES = c1cc(ccc1C(=O)NC(CCC(=O))C(=O))NCC2CNc3c(c(=O)c(n3)N)N2C=N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>24</sub>N<sub>8</sub>O<sub>6</sub> |
|
| Formula=C<sub>20</sub>H<sub>24</sub>N<sub>8</sub>O<sub>6</sub> |
|
| MolarMass=472.455 |
|
| MolarMass=472.455 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''5-Formiminotetrahydrofolate''' is an intermediate in the ] of ]. It is produced by ] and then converted into ] by ].<ref>{{cite journal |author=Fowler B |title=The folate cycle and disease in humans |journal=Kidney Int. Suppl. |volume=78 |pages=S221–9 |date=February 2001 |pmid=11169015 |doi=10.1046/j.1523-1755.2001.07851.x}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Formiminotetrahydrofolate, 5-}} |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{biochem-stub}} |