Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 6-Phosphogluconic acid: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 18:39, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 455001791 of page 6-Phosphogluconic_acid for the Chem/Drugbox validation project (updated: 'CASNo').  Latest revision as of 07:01, 11 May 2024 edit Spacemarine10 (talk | contribs)Extended confirmed users865 editsNo edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 443664395 | verifiedrevid = 477226209
| ImageFile = 6-phosphogluconate.svg | ImageFile = 6-phosphogluconate.svg
| ImageSize = | ImageSize = 230
| ImageAlt = Skeletal formula of 6-phosphogluconic acid
| IUPACName =
| ImageFile1 = 6-Phosphogluconic-acid-anion-3D-spacefill.png
| ImageSize1 = 220
| ImageAlt1 = Space-filling model of the 6-phosphogluconic acid anion
| IUPACName = 6-''O''-Phosphono-<small>D</small>-gluconic acid
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5-Tetrahydroxy-6-(phosphonooxy)hexanoic acid
| OtherNames = 6-Phosphogluconate | OtherNames = 6-Phosphogluconate
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| InChI = 1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1 | InChI = 1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1
| InChIKey = BIRSGZKFKXLSJQ-SQOUGZDYBT | InChIKey = BIRSGZKFKXLSJQ-SQOUGZDYBT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 13: Line 18:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BIRSGZKFKXLSJQ-SQOUGZDYSA-N | StdInChIKey = BIRSGZKFKXLSJQ-SQOUGZDYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 921-62-0 -->
| PubChem = 422 | CASNo = 921-62-0
| ChEBI_Ref = {{ebicite|correct|EBI}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W31WK7B8U0
| PubChem = 422
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 48928 | ChEBI = 48928
| SMILES = O=P(O)(O)OC(O)(O)(O)(O)C(=O)O | SMILES = O=P(O)(O)OC(O)(O)(O)(O)C(=O)O
| MeSHName = 6-phosphogluconate | MeSHName = 6-phosphogluconate
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 82615 | ChemSpiderID = 82615
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>6</sub>H<sub>13</sub>O<sub>10</sub>P | Formula = C<sub>6</sub>H<sub>13</sub>O<sub>10</sub>P
| MolarMass = 276.135 g/mol | MolarMass = 276.135 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
}} }}

'''6-Phosphogluconic acid''' (with conjugate base '''6-phosphogluconate''') is a ] ] which appears in the ] and the ].

During the oxidative phase of the pentose phosphate pathway, it is formed from ] by ], and in turn, it is converted to ] by ], in an oxidative ] which also produces ].

In those microorganisms which host the Entner-Doudoroff pathway, 6-phosphogluconic acid may also be acted upon by 6-] to produce 2-keto-3-deoxy-6-phosphogluconate.

{{Pentose phosphate pathway intermediates}}

{{DEFAULTSORT:Phosphogluconic acid, 6-}}
]

{{biochem-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 6-Phosphogluconic acid: Difference between pages Add topic