| Revision as of 10:42, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 460445418 of page A-366,833 for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
Latest revision as of 06:10, 9 February 2024 edit DMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,985 edits MOS |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 460444346 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 5-hept-6-yl]pyridine-3-carbonitrile |
|
|
⚫ |
| verifiedrevid = 477346296 |
| ⚫ |
| image = A-366833_structure.png |
|
|
⚫ |
| IUPAC_name = 5-hept-6-yl]pyridine-3-carbonitrile |
| ⚫ |
| width = 240 |
|
|
⚫ |
| image = A-366,833.svg |
|
⚫ |
| width = 175 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| CAS_number = |
|
|
|
| UNII = 6XRK9HTJ6M |
| ⚫ |
| ATC_suffix = |
|
|
⚫ |
| CAS_number = 370882-41-0 |
|
⚫ |
| ATC_suffix = None |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 239931 |
|
| ChEMBL = 239931 |
|
| PubChem = 9834234 |
|
| PubChem = 9834234 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8009955 |
|
| ChemSpiderID = 8009955 |
|
| SMILES = N#Cc1cc(cnc1)N32CNC2C3 |
|
| smiles = N#CC1=CN=CC(N23()CNC3()C2)=C1 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| InChI = 1/C11H12N4/c12-2-8-1-10(5-13-3-8)15-7-9-4-14-6-11(9)15/h1,3,5,9,11,14H,4,6-7H2/t9-,11-/m0/s1 |
|
| StdInChI = 1S/C11H12N4/c12-2-8-1-10(5-13-3-8)15-7-9-4-14-6-11(9)15/h1,3,5,9,11,14H,4,6-7H2/t9-,11-/m1/s1 |
| ⚫ |
| InChIKey = GPXAWLDGWSBLKM-ONGXEEELBH |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| StdInChIKey = GPXAWLDGWSBLKM-MWLCHTKSSA-N |
|
| StdInChI = 1S/C11H12N4/c12-2-8-1-10(5-13-3-8)15-7-9-4-14-6-11(9)15/h1,3,5,9,11,14H,4,6-7H2/t9-,11-/m0/s1 |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = GPXAWLDGWSBLKM-ONGXEEELSA-N |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=12 | N=4 |
|
| C=11 | H=12 | N=4 |
|
|
| melting_point = 101.4-102.9 |
|
| molecular_weight = 200.239 |
|
|
|
| melting_notes =<ref>{{cite journal | vauthors = Ji J, Schrimpf MR, Sippy KB, Bunnelle WH, Li T, Anderson DJ, Faltynek C, Surowy CS, Dyhring T, Ahring PK, Meyer MD | display-authors = 6 | title = Synthesis and structure-activity relationship studies of 3,6-diazabicycloheptanes as novel alpha4beta2 nicotinic acetylcholine receptor selective agonists | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 22 | pages = 5493–508 | date = November 2007 | pmid = 17929796 | doi = 10.1021/jm070755h }}</ref> |
|
}} |
|
}} |
|
|
|
|
|
'''A-366,833''' is a drug developed by ], which acts as an agonist at neural ]s selective for the ] subtype, and has been researched for use as an ], although it has not passed ].<ref>{{cite journal | vauthors = Romanelli MN, Gratteri P, Guandalini L, Martini E, Bonaccini C, Gualtieri F | title = Central nicotinic receptors: structure, function, ligands, and therapeutic potential | journal = ChemMedChem | volume = 2 | issue = 6 | pages = 746–67 | date = June 2007 | pmid = 17295372 | doi = 10.1002/cmdc.200600207 | s2cid = 34763474 }}</ref> Its structure has a nicotinonitrile (]) core bound through C5 to the N6 of (1''R'',5''S'')-3,6-diazabicycloheptane.<ref>{{cite journal | vauthors = Ji J, Bunnelle WH, Anderson DJ, Faltynek C, Dyhring T, Ahring PK, Rueter LE, Curzon P, Buckley MJ, Marsh KC, Kempf-Grote A, Meyer MD | display-authors = 6 | title = A-366833: a novel nicotinonitrile-substituted 3,6-diazabicyclo-heptane alpha4beta2 nicotinic acetylcholine receptor selective agonist: Synthesis, analgesic efficacy and tolerability profile in animal models | journal = Biochemical Pharmacology | volume = 74 | issue = 8 | pages = 1253–62 | date = October 2007 | pmid = 17854775 | doi = 10.1016/j.bcp.2007.08.010 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Stimulants}} |
|
|
{{Analgesics}} |
|
|
{{Nicotinic acetylcholine receptor modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |