| Revision as of 19:45, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 449151955 of page Acedapsone for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 13:59, 6 August 2024 edit Headbomb (talk | contribs)Edit filter managers, Autopatrolled, Extended confirmed users, Page movers, File movers, New page reviewers, Pending changes reviewers, Rollbackers, Template editors454,938 edits ce |
| Line 1: |
Line 1: |
|
|
{{Short description|Antimicrobial drug}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 441552828 |
|
| verifiedrevid = 477237907 |
|
| IUPAC_name = N-acetamide |
|
| IUPAC_name = N-acetamide |
|
| image = Acedapsone.png |
|
| image = Acedapsone.svg |
|
|
| alt = Skeletal formula of acedapsone |
|
|
| width = 250 |
|
|
| image2 = Acedapsone-3D-spacefill.png |
|
|
| alt2 = Space-filling model of the acedapsone molecule |
|
|
| width2 = 250 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Rodilone<br/>Hansolar |
|
| tradename = Rodilone<br />Hansolar |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 77-46-3 --> |
|
| CAS_number = 77-46-3 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 6477 |
|
| PubChem = 6477 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6232 |
|
| ChemSpiderID = 6232 |
| Line 42: |
Line 49: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=16 | H=16 | N=2 | O=4 | S=1 |
|
| C=16 | H=16 | N=2 | O=4 | S=1 |
|
| molecular_weight = 332.374 g/mol |
|
|
| smiles = CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C |
|
| smiles = CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 52: |
Line 58: |
|
| melting_point = 290 |
|
| melting_point = 290 |
|
}} |
|
}} |
|
|
|
|
|
'''Acedapsone''' (]) is an ] drug, which also has ] activity. |
|
|
|
|
|
Acedapsone is the INN for diacetyl]. It was synthesized and developed in 1937 by ] and his team in the pharmaceutical chemistry laboratory of ],<ref>{{cite journal | vauthors = Fourneau E, Tréfouël J, Nitti F, Bovet D | author-link2 = Jacques Tréfouël | author-link4 = Daniel Bovet | title = Chimiothérapie de l'infection pneumococcique par la di-(p-acétylaminophényl)-sulfone (1399 F) | language = fr | journal = Compt. Rend. Acad. Sci. | date = July 1937 | volume = 205 | pages = 299 }}</ref> and it was marketed as '''Rodilone''' by the ] company.<ref>{{cite journal | vauthors = Fourneau JP | title = Ernest Fourneau, fondateur de la chimie thérapeutique française: feuillets d'album. | language = fr | journal = Revue d'Histoire de la Pharmacie | date = 1987 | volume = 75 | issue = 275 | pages = 335–55 | doi = 10.3406/pharm.1987.2904 }}</ref> |
|
|
|
|
|
It is a long-acting ] of dapsone. It is used for treating ].<ref name="pmid12862255">{{cite journal | vauthors = Shaw IN, Christian M, Jesudasan K, Kurian N, Rao GS | title = Effectiveness of multidrug therapy in multibacillary leprosy: a long-term follow-up of 34 multibacillary leprosy patients treated with multidrug regimens till skin smear negativity | journal = Leprosy Review | volume = 74 | issue = 2 | pages = 141–7 | date = June 2003 | doi = 10.47276/lr.74.2.141 | pmid = 12862255 | doi-access = free }}</ref> |
|
|
|
|
|
It crystallises as pale yellow needles from ], and as leaflets from dilute ]. It is slightly soluble in water.{{cn|date=January 2023}} |
|
|
== Synthesis == |
|
|
] |
|
|
Acedapsone is conveniently prepared by acetylation of dapsone. |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Antimycobacterials}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antimicrobial-stub}} |