Misplaced Pages

Apigetrin: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 12:10, 24 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Latest revision as of 13:18, 2 December 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,615 edits just a catalog listing - no info not already here 
(21 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{one source|date=September 2014}}
{{chembox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396292528 | verifiedrevid = 457135003
| Name = Apigetrin | Name = Apigetrin
| Reference=
| ImageFile = Apigetrin.png | Reference=
| ImageFile = Apigetrin.svg
| ImageSize = 200px | ImageName =
| IUPACName = 7-(β-<small>D</small>-Glucopyranosyloxy)-4′,5-dihydroxyflavone
| ImageName =
| IUPACName = 5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4, | SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-7-{oxy}-4''H''-1-benzopyran-4-one
| OtherNames= Apigetrin; Cosmosiine; Cosmetin; Cosmosiin; Cosmosioside; Thalictiin; Cosmosin; Apigenin 7-glucoside; Apigenin 7-''O''-glucoside
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
|Section1={{Chembox Identifiers
| OtherNames= Apigetrin; Cosmosiine; Cosmetin; Cosmosiin; Cosmosioside; Thalictiin; Cosmosin; ] 7-]; Apigenin 7-O-glucoside
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444290 | ChemSpiderID = 4444290
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 487017 | ChEMBL = 1159512
| InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 | InChI = 1/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1
| InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM | InChIKey = KMOUJOKENFFTPU-QNDFHXLGBM
Line 23: Line 24:
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 578-74-5 | CASNo = 578-74-5
| ChEBI_Ref = {{ebicite|changed|EBI}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7OF2S66PCH
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C04608
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16778 | ChEBI = 16778
| SMILES = O=C\3c4c(O)cc(O1O((O)(O)1O)CO)cc4O/C(c2ccc(O)cc2)=C/3 | SMILES = O=C\3c4c(O)cc(O1O((O)(O)1O)CO)cc4O/C(c2ccc(O)cc2)=C/3
| PubChem = 5280704 | PubChem = 5280704
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=21 | H=20 | O=10
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>10</sub>
| MeltingPt =
| MolarMass = 432.3775 g/mol
| ExactMass = 432.105647
| MeltingPt = °C
}} }}
}} }}
'''Apigetrin''' is a chemical compound that can be found in ].


'''Apigetrin''' is a chemical compound that can be found in ] and in '']''.<ref>{{cite journal | doi = 10.1021/np50041a040| title = Flavonoid Aglycones and Glycosides from Teucrium gnaphalodes| journal = Journal of Natural Products| volume = 48| issue = 5| pages = 859| year = 1985| last1 = Barberán| first1 = F. A. T.| last2 = Gil| first2 = M. I.| last3 = Tomás| first3 = F.| last4 = Ferreres| first4 = F.| last5 = Arques| first5 = A.}}</ref>
==References==

== References ==
{{reflist}} {{reflist}}

==External links==
*


{{flavone}} {{flavone}}
Line 47: Line 48:
] ]


{{Natural-phenol-stub}} {{organic-compound-stub}}

]
Apigetrin: Difference between revisions Add topic