Revision as of 16:36, 22 September 2011 editCitation bot 1 (talk | contribs)Bots130,044 editsm Add: author-separator, author2, author3, display-authors, last4, first4, last5, first5, last6, first6, last7, first7, last8, first8, last9, first9. Tweak: author, title. You can use this bot yourself. Report bugs here.← Previous edit |
Latest revision as of 05:39, 14 September 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,925 edits consistent citation formatting |
(53 intermediate revisions by 34 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
|
|
{{Infobox drug |
|
| Watchedfields = changed |
|
|
| verifiedrevid = 443950043 |
|
| verifiedrevid = 451871816 |
|
| IUPAC_name = 4-(4-{-2,5-dioxo- 1,4,9-triazaspiroundecan-9-yl]methyl}phenoxy)benzoic acid |
|
| IUPAC_name = 4-(4-<nowiki/>{-2,5-dioxo- 1,4,9-triazaspiroundecan-9-yl]methyl}phenoxy)benzoic acid |
|
| image = Aplaviroc.svg |
|
| image = Aplaviroc structure.svg |
|
| width = 300 |
|
| width = 300 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
⚫ |
| pregnancy_category = |
|
| tradename = |
|
|
⚫ |
| legal_status = Development terminated |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| routes_of_administration = Oral |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
|
⚫ |
| CAS_number = 461023-63-2 |
|
|
|
| index2_label = HCl |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 461023-63-2 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = 04D148Z3VR |
|
|
| IUPHAR_ligand = 805 |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 461443-59-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 3001322 |
|
| PubChem = 3001322 |
|
|
| ChEMBL = 1255794 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2272720 |
|
| ChemSpiderID = 2272720 |
Line 40: |
Line 42: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=33 | H=43 | N=3 | O=6 |
|
| C=33 | H=43 | N=3 | O=6 |
|
| molecular_weight = 577.711 g/mol |
|
|
| smiles = CCCCN1C(=O)(NC(=O)C12CCN(CC2)CC3=CC=C(C=C3)OC4=CC=C(C=C4)C(=O)O)(C5CCCCC5)O |
|
| smiles = CCCCN1C(=O)(NC(=O)C12CCN(CC2)CC3=CC=C(C=C3)OC4=CC=C(C=C4)C(=O)O)(C5CCCCC5)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
Line 48: |
Line 49: |
|
| StdInChIKey = GWNOTCOIYUNTQP-FQLXRVMXSA-N |
|
| StdInChIKey = GWNOTCOIYUNTQP-FQLXRVMXSA-N |
|
}} |
|
}} |
|
'''Aplaviroc''' (], codenamed '''AK602''' and '''GSK-873140''') is a ] ] developed for the treatment of ] infection.<ref>http://www.retroconference.org/2004/cd/PDFs/540.pdf</ref><ref></ref> It is developed by ] |
|
|
|
|
|
|
|
'''Aplaviroc''' (], codenamed '''AK602''' and '''GSK-873140''') is a ] ] that belongs to a class of ]<ref>{{cite journal | vauthors = Borthwick AD | title = 2,5-Diketopiperazines: synthesis, reactions, medicinal chemistry, and bioactive natural products | journal = Chemical Reviews | volume = 112 | issue = 7 | pages = 3641–3716 | date = July 2012 | pmid = 22575049 | doi = 10.1021/cr200398y }}</ref> developed for the treatment of ] infection.<ref>{{cite conference | vauthors = Maeda K, Ogata H, Harada S, Tojo Y, Miyakawa T, Nakata H, Takaoka Y, Shibayama S, Sagawa K, Daikichi F, Moravek J | display-authors = 6 | title = Determination of binding sites of a unique CCR5 inhibitor AK602 on human CCR5 | conference = 11th conference on retroviruses and opportunistic infections | location = San Francisco, CA | date = 2004 |url= http://www.retroconference.org/2004/cd/PDFs/540.pdf |archive-url=https://web.archive.org/web/20051103110511/http://www.retroconference.org/2004/cd/PDFs/540.pdf |archive-date=November 3, 2005 }}</ref><ref>{{cite journal | vauthors = Nakata H, Maeda K, Miyakawa T, Shibayama S, Matsuo M, Takaoka Y, Ito M, Koyanagi Y, Mitsuya H | display-authors = 6 | title = Potent anti-R5 human immunodeficiency virus type 1 effects of a CCR5 antagonist, AK602/ONO4128/GW873140, in a novel human peripheral blood mononuclear cell nonobese diabetic-SCID, interleukin-2 receptor gamma-chain-knocked-out AIDS mouse model | journal = Journal of Virology | volume = 79 | issue = 4 | pages = 2087–2096 | date = February 2005 | pmid = 15681411 | pmc = 546550 | doi = 10.1128/jvi.79.4.2087-2096.2005 }}</ref> It was developed by ]. |
⚫ |
In October 2005, all studies of aplaviroc were discontinued due to ] concerns.<ref>{{cite web |url=http://www.aidsmeds.com/drugs/aplaviroc.htm |title=Aplaviroc (GSK-873,140) |date=October 25, 2005 |publisher=AIDSmeds.com |accessdate=2008-09-05}} {{Dead link|date=October 2010|bot=H3llBot}}</ref><ref>{{cite journal |author=Nichols WG |title=Hepatotoxicity Observed in Clinical Trials of Aplaviroc (GW873140) |journal=Antimicrob Agents Chemother |volume=52 |issue=3 |pages=858–65 |year=2008 |month=March |pmid=18070967 |pmc=2258506 |doi=10.1128/AAC.00821-07 |url= |author-separator=, |author2=Steel HM |author3=Bonny T |display-authors=3 |last4=Adkison |first4=K. |last5=Curtis |first5=L. |last6=Millard |first6=J. |last7=Kabeya |first7=K. |last8=Clumeck |first8=N.}}</ref> Some authors have claimed that evidence of poor efficacy may have contributed to termination of the drug's development;<ref>{{cite web |url=http://www.thebody.com/content/treat/art39205.html |title=The Last Word on Aplaviroc: A CCR5 Antagonist With Poor Efficacy |date=December 19, 2006 |author=Moyle, Graeme |publisher=The Body |accessdate=2008-09-05}}</ref> the ASCENT study, one of the discontinued trials, showed aplaviroc to be inferior to ] as the third component of a three-drug regimen.<ref>{{cite journal |author=Currier J |title=Antiviral activity and safety of aplaviroc with lamivudine/zidovudine in HIV-infected, therapy-naive patients: the ASCENT (CCR102881) study |journal=Antivir Ther (Lond.) |volume=13 |issue=2 |pages=297–306 |year=2008 |pmid=18505181 |doi= |url= |author-separator=, |author2=Lazzarin A |author3=Sloan L |display-authors=3 |last4=Clumeck |first4=N |last5=Slims |first5=J |last6=McCarty |first6=D |last7=Steel |first7=H |last8=Kleim |first8=JP |last9=Bonny |first9=T}}</ref> |
|
|
|
|
|
|
⚫ |
In October 2005, all studies of aplaviroc were discontinued due to ] concerns.<ref>{{cite web|url=http://www.aidsmeds.com/drugs/aplaviroc.htm |title=Aplaviroc (GSK-873,140) |date=October 25, 2005 |publisher=AIDSmeds.com |access-date=September 5, 2008 |url-status=dead |archive-url=https://web.archive.org/web/20070113173331/http://www.aidsmeds.com/drugs/aplaviroc.htm |archive-date=January 13, 2007 }}</ref><ref>{{cite journal | vauthors = Nichols WG, Steel HM, Bonny T, Adkison K, Curtis L, Millard J, Kabeya K, Clumeck N | display-authors = 6 | title = Hepatotoxicity observed in clinical trials of aplaviroc (GW873140) | journal = Antimicrobial Agents and Chemotherapy | volume = 52 | issue = 3 | pages = 858–865 | date = March 2008 | pmid = 18070967 | pmc = 2258506 | doi = 10.1128/aac.00821-07 }}</ref> Some authors have claimed that evidence of poor efficacy may have contributed to termination of the drug's development;<ref>{{cite web |url=http://www.thebody.com/content/treat/art39205.html |title=The Last Word on Aplaviroc: A CCR5 Antagonist With Poor Efficacy |date=December 19, 2006 | vauthors = Moyle G |publisher=The Body |access-date=September 5, 2008 |archive-url=https://web.archive.org/web/20081006093337/http://www.thebody.com/content/treat/art39205.html |archive-date=6 October 2008 |url-status=dead }}</ref> the ASCENT study, one of the discontinued trials, showed aplaviroc to be under-effective in many patients even at high concentrations.<ref>{{cite journal | vauthors = Currier J, Lazzarin A, Sloan L, Clumeck N, Slims J, McCarty D, Steel H, Kleim JP, Bonny T, Millard J | display-authors = 6 | title = Antiviral activity and safety of aplaviroc with lamivudine/zidovudine in HIV-infected, therapy-naive patients: the ASCENT (CCR102881) study | journal = Antiviral Therapy | volume = 13 | issue = 2 | pages = 297–306 | year = 2008 | pmid = 18505181 | doi = 10.1177/135965350801300204 | s2cid = 21839689 | doi-access = free }}</ref> |
|
==See also== |
|
|
* ] |
|
|
|
|
|
|
==References== |
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
==Further reading== |
|
== Further reading == |
|
|
{{refbegin}} |
|
*{{cite journal |author=Horster S, Goebel FD |title=Serious doubts on safety and efficacy of CCR5 antagonists : CCR5 antagonists teeter on a knife-edge |journal=Infection |volume=34 |issue=2 |pages=110–3 |year=2006 |month=April |pmid=16703305 |doi=10.1007/s15010-006-6206-1 |url=}} |
|
* {{cite journal | vauthors = Horster S, Goebel FD | title = Serious doubts on safety and efficacy of CCR5 antagonists : CCR5 antagonists teeter on a knife-edge | journal = Infection | volume = 34 | issue = 2 | pages = 110–113 | date = April 2006 | pmid = 16703305 | doi = 10.1007/s15010-006-6206-1 | s2cid = 38463200 }} |
|
|
{{refend}} |
|
|
|
|
|
|
{{Antiretroviral drug}} |
|
{{HIVpharm}} |
|
|
|
{{Chemokine receptor modulators}} |
|
|
|
|
|
] |
|
] |
⚫ |
] |
|
|
] |
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |