| Revision as of 20:27, 6 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 18:31, 27 December 2023 edit undoSmokefoot (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers75,013 edits rm oversimplified image |
| (18 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443398860 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Arsenamide.png |
|
|
⚫ |
| verifiedrevid = 443400454 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Arsenamide.png |
|
|IUPACName=2,2'‑{bis(sulfanyl)}<br>diacetic acid |
|
|
⚫ |
| ImageSize=210px |
| ⚫ |
|OtherNames=Thiacetarsamide |
|
|
|
| ImageFile1 = |
|
|
| ImageSize1 = 230 |
|
|
| ImageAlt1 = Space-filling model of arsenamide |
|
|
| PIN=2,2′-<nowiki/>{bis(sulfanediyl)}diacetic acid |
|
⚫ |
| OtherNames=Thiacetarsamide |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=531-72-6 |
|
| CASNo=531-72-6 |
|
| PubChem=10749 |
|
| PubChem=10749 |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = VMF4ELY9TZ |
|
| UNII = VMF4ELY9TZ |
|
| SMILES=O=C(N)c1ccc(cc1)(SCC(=O)O)SCC(=O)O |
|
| SMILES=O=C(N)c1ccc(cc1)(SCC(=O)O)SCC(=O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 10296 |
|
|
| InChI = 1/C11H12AsNO5S2/c13-11(18)7-1-3-8(4-2-7)12(19-5-9(14)15)20-6-10(16)17/h1-4H,5-6H2,(H2,13,18)(H,14,15)(H,16,17) |
|
|
| InChIKey = YBQWEUNEYYXYOI-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C11H12AsNO5S2/c13-11(18)7-1-3-8(4-2-7)12(19-5-9(14)15)20-6-10(16)17/h1-4H,5-6H2,(H2,13,18)(H,14,15)(H,16,17) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YBQWEUNEYYXYOI-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=11|H=12|As=1|N=1|O=5|S=2 |
|
| C=11 | H=12 | As=1 | N=1 | O=5 | S=2 |
|
| MolarMass=377.27 g/mol |
|
| MolarMass=377.27 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Arsenamide''' is an ]. It is a proposed chemotherapeutic agent against ] and ].<ref>at ]</ref> |
|
'''Arsenamide''' or '''thiacetarsamide''' (trade name '''Caparsolate''') is an ].<ref> at ]</ref> It is a proposed chemotherapeutic agent against canine ] and ].<ref>{{Cite journal|last=Nagata|first=M.|last2=Yamada|first2=K.|date=1962-03-20|title=Caparsolate Sodium in the Treatment of Canine Filariasis|url=https://www.jstage.jst.go.jp/article/jvma1951/15/3/15_3_94/_article|journal=Journal of the Japan Veterinary Medical Association|language=ja|volume=15|issue=3|pages=94–98|doi=10.12935/jvma1951.15.94|issn=0446-6454|doi-access=free}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
{{pharma-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
{{antiinfective-drug-stub}} |