Revision as of 13:50, 28 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Latest revision as of 16:18, 12 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
(174 intermediate revisions by 79 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 399532235 |
|
| verifiedrevid = 457818137 |
|
| IUPAC_name = |
|
|
|
| drug_name = |
⚫ |
| image = artemether.svg |
|
|
|
| IUPAC_name = (3''R'',5a''S'',6''R'',8a''S'',9''R'',10''S'',12''R'',12a''R'')-10-methoxy-3,6,9-trimethyldecahydro-12''H''-3,12-epoxydioxepino-2-benzopyran |
|
|
|
|
⚫ |
| image = artemether.svg |
|
|
| image_class = skin-invert-image |
|
|
| width = 150 |
|
|
| image2 = Artemether 3D balls.png |
|
|
| width2 = 150 |
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
|
| tradename = Many<ref name="drugs">{{cite web|title=Artemether and Lumefantrine (Monograph)|url=https://www.drugs.com/monograph/artemether-and-lumefantrine.html|publisher=Drugs.com|date=22 February 2023|accessdate=17 February 2024}}</ref> |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|artemether}} |
|
| Drugs.com = {{drugs.com|international|artemether}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = C |
|
| pregnancy_US = C |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = POM |
|
| legal_UK = POM |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = Rx only |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Intramuscular<ref name=Esu2019 /> Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 71963-77-4 --> |
|
| CAS_number = 71963-77-4 |
|
| ATC_prefix = P01 |
|
| ATC_prefix = P01 |
|
| ATC_suffix = BE02 |
|
| ATC_suffix = BE02 |
|
| ATC_supplemental = |
|
| ATC_supplemental= |
|
| PubChem = 68911 |
|
| PubChem = 68911 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB06697 |
|
| DrugBank = DB06697 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref= {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 62138 |
|
| ChemSpiderID = 62138 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = C7D6T3H22J |
|
| UNII = C7D6T3H22J |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02483 |
|
| KEGG = D02483 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 195280 |
|
| ChEBI = 195280 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1237051 --> |
|
| ChEMBL = |
|
|
| PDB_ligand = D8Z |
⚫ |
| chemical_formula = |
|
|
|
|
⚫ |
| C=16 | H=26 | O=5 |
|
|
⚫ |
<!--Chemical data--> |
|
| molecular_weight = 298.374 g/mol |
|
|
⚫ |
| chemical_formula = |
⚫ |
| smiles = C1CC3C42OO(C)(CC12)O4O(OC)3C |
|
|
⚫ |
| C=16 | H=26 | O=5 |
|
| InChI = 1/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16?/m1/s1 |
|
|
⚫ |
| smiles = C1CC3C42OO(C)(CC12)O4O(OC)3C |
|
| InChIKey = SXYIRMFQILZOAM-LJXHFVHTBB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
|
| StdInChI = 1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SXYIRMFQILZOAM-HVNFFKDJSA-N |
|
| StdInChIKey = SXYIRMFQILZOAM-HVNFFKDJSA-N |
|
|
| melting_point = 86 |
|
|
| melting_high = 88 |
|
}} |
|
}} |
|
|
<!-- Definition and medical uses --> |
|
|
'''Artemether''' is a medication used for the treatment of ].<ref name=drugs/><ref name=Esu2019>{{cite journal | vauthors = Esu EB, Effa EE, Opie ON, Meremikwu MM | title = Artemether for severe malaria | journal = The Cochrane Database of Systematic Reviews | volume = 6 | issue = 6 | pages = CD010678 | date = June 2019 | pmid = 31210357 | pmc = 6580442 | doi = 10.1002/14651858.CD010678.pub3 }}</ref> The injectable form is specifically used for severe malaria rather than ].<ref name=Esu2019 /> In adults, it may not be as effective as ].<ref name=Esu2019 /> It is given by ].<ref name=Esu2019 /> It is also available by mouth in combination with ], known as ].<ref name=drugs/><ref name="Coartem FDA label" /> |
|
|
|
|
|
|
<!-- Side effects and mechanism --> |
|
'''Artemether''' (]) is an antimalarial for the treatment of multi-drug resistant strains of '']'' ]. It is combined with ] and sold by ] under the brand names Riamet and Co-Artem. |
|
|
|
Artemether causes relatively few side effects.<ref name=Kov2015/> An ] may rarely occur.<ref name=Kov2015/> While there is evidence that use during ] may be harmful in animals, there is no evidence of concern in humans.<ref name=Kov2015/> The ] (WHO) therefore recommends its use during pregnancy.<ref name=Kov2015/> It is in the ] class of medication.<ref name=Kov2015>{{cite journal | vauthors = Kovacs SD, Rijken MJ, Stergachis A | title = Treating severe malaria in pregnancy: a review of the evidence | journal = Drug Safety | volume = 38 | issue = 2 | pages = 165–181 | date = February 2015 | pmid = 25556421 | pmc = 4328128 | doi = 10.1007/s40264-014-0261-9 }}</ref> |
|
|
|
|
|
|
<!-- History, society and culture --> |
⚫ |
==Chemical nature== |
|
|
|
Artemether has been studied since at least 1981, and has been in medical use since 1987.<ref>{{cite book| vauthors = Rao Y, Zhang D, Li R |title=Tu Youyou and the Discovery of Artemisinin: 2015 Nobel Laureate in Physiology or Medicine|date=2016|publisher=World Scientific|isbn=9789813109919|page=162|url=https://books.google.com/books?id=nmZtDQAAQBAJ&pg=PA162|url-status=live|archive-url=https://web.archive.org/web/20170910151644/https://books.google.com/books?id=nmZtDQAAQBAJ&pg=PA162|archive-date=2017-09-10}}</ref> It is on the ].<ref name="WHO21st">{{cite book | title = World Health Organization model list of essential medicines: 21st list 2019 | year = 2019 | hdl = 10665/325771 | publisher = World Health Organization | location = Geneva | id = WHO/MVP/EMP/IAU/2019.06. License: CC BY-NC-SA 3.0 IGO | hdl-access=free }}</ref> |
⚫ |
It is a ] derivative of ], which is a peroxide ] isolated from the ] antimalarial plant, '']''. It is also known as dihydroartemisinin methyl ether, but its ] is (+)-(3-alpha,5a-beta,6-beta,8a-beta, 9-alpha,12-beta,12aR)-decahydro-10-methoxy-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin. |
|
|
|
|
|
|
==Uses== |
|
==Medical uses== |
|
|
Artemether is an antimalarial drug for uncomplicated malaria caused by '']'' (and chloroquine-resistant '']'') or chloroquine-resistant '']'' parasites.<ref name=drugs/><ref>{{cite journal | vauthors = Makanga M, Krudsood S | title = The clinical efficacy of artemether/lumefantrine (Coartem) | journal = Malaria Journal | volume = 8 | issue = Suppl 1 | pages = S5 | date = October 2009 | pmid = 19818172 | pmc = 2760240 | doi = 10.1186/1475-2875-8-S1-S5 | doi-access = free }}</ref> Artemether can also be used to treat severe malaria.<ref name=Esu2019 /> |
|
===Antimalarial=== |
|
|
Artemether is highly effective against the blood ]s of both ] '']'' and '']''. It is applied in combination with ] in clinical treatments of ]. ] guidelines for the treatment of uncomplicated ] recommend the use of this ]-based combination therapy, and approved by ] in December 2008 and recently approved by the ] ]. ] was the first African country to adopt artemether/] (commonly called Coartem) as first-line therapy in national malaria treatment guidelines in 2002. Clinical records show that by 2008, the rates of in-patient ] cases and deaths decreased by 61% and 66%, respectively, compared with the 2001-2002 reference period. In ] also the number of ]-related outpatient cases and hospital admissions to each fall by 99% from 2001 to 2003, and ]-related deaths decreased by 97% over the same period.<ref>{{cite journal |doi=10.1186/1475-2875-8-S1-S8 |author=Barnes KI, Chanda P, Ab Barnabas G |year=2009 |title=Impact of the large-scale deployment of artemether/lumefantrine on the malaria disease burden in Africa: case studies of South Africa, Zambia and Ethiopia |journal=Malar J. |volume=8 |issue=1 |pages=S8 |pmid=119818175 |url=http://www.malariajournal.com/content/8%20Suppl%201//S8}}</ref> The efficacy of the six-dose regimen of Coartem has been confirmed in many different patient populations around the world, consistently achieving 28-day ]-corrected cure rates of >95% in the evaluable population, rapidly clearing parasitaemia and fever, and demonstrating a significant gametocidal effect, even in areas of widespread ] resistance to other ].<ref>{{cite journal |author=Makanga M, Krudsood S |year=2009 |title=The clinical efficacy of artemether/lumefantrine (Coartem®) |journal=Malar J. |volume=8 |issue=1 |pages=S5 |pmid=19818172 |pmc=2760240 |doi=10.1186/1475-2875-8-S1-S5 |url=http://www.malariajournal.com/content/8%20Suppl%201//S5}}</ref> Coartem is much more effective than ], the classical ]. Randomised clinical trial in ] shows cure rate of ] as high as 96% in the Coartem-treated group compared with 64% for the ] group.<ref>{{cite journal |author=Achan J, Tibenderana JK, Kyabayinze D, Wabwire Mangen F, Kamya MR, Dorsey G, D'Alessandro U, Rosenthal PJ, Talisuna AO |year=2009 |title=Effectiveness of quinine versus artemether-lumefantrine for treating uncomplicated falciparum malaria in Ugandan children: randomised trial |journal=BMJ |volume=339 |issue= |pages=b2763 |pmid=19622553 |pmc=2714631 |doi=10.1136/bmj.b2763 |url=http://ukpmc.ac.uk/articlerender.cgi?artid=1785774}}</ref> For '']'' infection, combination with ] is more effective than Coartem.<ref>{{cite journal |author=Sinclair D, Zani B, Donegan S, Olliaro P, Garner P |year=2009 |title=Artemisinin-based combination therapy for treating uncomplicated malaria |journal=Cochrane Database Syst Rev. |volume=8 |issue=3 |pages=CD007483 |pmid=19588433 |doi=10.1002/14651858.CD007483.pub2 |editor1-last=Sinclair |editor1-first=David}}</ref> |
|
|
|
|
|
|
|
The ] (WHO) recommends the treatment of uncomplicated '']'' with ].<ref>{{Cite book|url=https://www.ncbi.nlm.nih.gov/books/NBK294441/|title=Treatment of Uncomplicated Plasmodium falciparum Malaria|date=2015-01-01|publisher=World Health Organization|url-status=live|archive-url=https://web.archive.org/web/20170910151644/https://www.ncbi.nlm.nih.gov/books/NBK294441/|archive-date=2017-09-10}}</ref> Given in combination with ], it may be followed by a 14-day regimen of ] to prevent relapse of ''P. vivax'' or ''P. ovale'' malarial parasites and provide a complete cure.<ref>{{Cite book|url=https://www.ncbi.nlm.nih.gov/books/NBK294428/|title=Treatment Of Uncomplicated Malaria Caused By P. vivax, P. ovale, P. malariae or P. knowlesi|date=2015-01-01|publisher=World Health Organization|url-status=live|archive-url=https://web.archive.org/web/20170910151644/https://www.ncbi.nlm.nih.gov/books/NBK294428/|archive-date=2017-09-10}}</ref> |
⚫ |
Artemether has been assigned to category C by the FDA on the basis of animal data which shows an association with fetal-loss and deformity. However, clinical data appears to show that artemether is safe in pregnancy. A meta-analysis of 14 clinical trials that looked at artemether use in a total of 945 pregnant women did not find evidence of harm,<ref>{{cite journal|author=Dellicour S, Hall S, Chandramohan D, Greenwood B|title=The safety of artemisinins during pregnancy: a pressing question|journal=Malaria J|year= 2007|volume=6|pages=15|doi=10.1186/1475-2875-6-15}}</ref> and a clinical trial of artemether-lumefantrine designed to look at this question found fewer adverse events in the 138 pregnant women treated with artemther-lumefantrine than women treated with quinine.<ref>{{cite journal|author=Piola P, Nabasumba C, Turyakira E, ''et al.''|title=Efficacy and safety of artemether—lumefantrine compared with quinine in pregnant women with uncomplicated Plasmodium falciparum malaria: an open-label, randomised, non-inferiority trial|journal=Lancet Infect Dis|volume=10|issue=11|pages=762–769|year=2010|doi=10.1016/S1473-3099(10)70202-4}}</ref> |
|
|
|
|
|
|
|
Artemether can also be used in treating and preventing trematode infections of ] when used in combination with ].<ref>{{cite journal | vauthors = Pérez del Villar L, Burguillo FJ, López-Abán J, Muro A | title = Systematic review and meta-analysis of artemisinin based therapies for the treatment and prevention of schistosomiasis | journal = PLOS ONE | volume = 7 | issue = 9 | pages = e45867 | date = 2012-01-01 | pmid = 23029285 | pmc = 3448694 | doi = 10.1371/journal.pone.0045867 | doi-access = free | bibcode = 2012PLoSO...745867P }}</ref> |
|
===Anthelmintic=== |
|
|
During early 1980s ] scientists, by serendipity, discovered that artemether was not only an ], but also effective against the ]. Eventually, laboratory experiments have confirmed the broad spectrum of activity against different ], including all ], '']'', '']'' and '']''.<ref>{{cite journal |doi=10.1097/QCO.0b013e3282f19ec4 |author=Keiser J, Utzinger J |year=2007 |title=Artemisinins and synthetic trioxolanes in the treatment of helminth infections |journal=Curr Opin Infect Dis |volume=20 |issue=6 |pages=605–612 |pmid=17975411}}</ref> These studies revealed that artemether exhibits the highest activity against juvenile stages of the ], while adult worms are significantly less susceptible. In addition, there are no indication of ] following repeated high doses. ] confirmed that artemether, orally administered at a dose of 6 mg/kg once every 2–3 weeks, results in no drug-related adverse effects, and significantly reduces the incidence and intensity of ] infections, including those of '']'', '']'' and '']''.<ref>{{cite journal |doi=10.1016/S0001-706X(02)00009-8 |author=Xiao S, Tanner M, N'Goran EK, Utzinger J, Chollet J, Bergquist R, Chen M, Zheng J |year=2002 |title=Recent investigations of artemether, a novel agent for the prevention of schistosomiasis japonica, mansoni and haematobia |journal=Acta Trop |volume=82 |issue=2 |pages=175–181 |pmid=12020890}}</ref><ref>{{cite journal |doi=10.2471/BLT.08.053041 |author=Hou XY, McManus DP, Gray DJ, Balen J, Luo XS, He YK, Ellis M, Williams GM, Li YS |year=2008 |title=A randomized, double-blind, placebo-controlled trial of safety and efficacy of combined praziquantel and artemether treatment for acute schistosomiasis japonica in China |journal=Bull World Health Organ |volume=86 |issue=10 |pages=788–795 |pmid=18949216 |pmc=2649525 |url=http://www.scielosp.org/scielo.php?script=sci_arttext&pid=S0042-96862008001000015&lng=en&nrm=iso&tlng=en}}</ref> |
|
|
|
|
|
|
⚫ |
Artemether is rated category C by the FDA based on animal studies where artemisinin derivatives have shown an association with fetal loss and deformity. Some studies, however, do not show evidence of harm.<ref>{{cite journal | vauthors = Dellicour S, Hall S, Chandramohan D, Greenwood B | title = The safety of artemisinins during pregnancy: a pressing question | journal = Malaria Journal | volume = 6 | pages = 15 | date = February 2007 | pmid = 17300719 | pmc = 1802871 | doi = 10.1186/1475-2875-6-15 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Piola P, Nabasumba C, Turyakira E, Dhorda M, Lindegardh N, Nyehangane D, Snounou G, Ashley EA, McGready R, Nosten F, Guerin PJ | display-authors = 6 | title = Efficacy and safety of artemether-lumefantrine compared with quinine in pregnant women with uncomplicated Plasmodium falciparum malaria: an open-label, randomised, non-inferiority trial | journal = The Lancet. Infectious Diseases | volume = 10 | issue = 11 | pages = 762–769 | date = November 2010 | pmid = 20932805 | doi = 10.1016/S1473-3099(10)70202-4 | hdl-access = free | hdl = 10144/116337 }}</ref> |
|
===Anticancer=== |
|
|
Artemether has been shown to have significant anticancer and ] activities. It is demonstrated that artemether caused strong inhibitory effects on ] growth and ] in ]s.<ref>{{cite journal |doi=10.1177/1534735408330714 |author=Wu ZP, Gao CW, Wu YG, Zhu QS, Yan Chen, Xin Liu, Chuen Liu |year=2009 |title=Inhibitive effect of artemether on tumor growth and angiogenesis in the rat C6 orthotopic brain gliomas model |journal=Integr Cancer Ther |volume=8 |issue=1 |pages=88–92 |pmid=19174507 |url=http://ict.sagepub.com/cgi/pmidlookup?view=long&pmid=19174507}}</ref> It exhibits a dose- and time-dependent ], and induced ] and ] arrest in ovarian cancer cell lines,<ref>{{cite journal |author=Jiao Y, Ge CM, Meng QH, Cao JP, Tong J, Fan SJ |year=2007 |title=Dihydroartemisinin is an inhibitor of ovarian cancer cell growth |journal=Acta Pharmacol Sin |volume=8 |issue=7 |pages=1045–1056 |pmid=17588342 |doi=10.1111/j.1745-7254.2007.00612.x |url=http://www.chinaphar.com/1671-4083/28/1045.htm}}</ref> ],<ref>{{cite journal |doi=10.1097/CAD.0b013e3282f3f152 |author=Zhou HJ, Wang Z, Li A |year=2008 |title=Dihydroartemisinin induces apoptosis in human leukemia cells HL60 via downregulation of transferrin receptor expression |journal=Anticancer Drugs |volume=19 |issue=3 |pages=247–255 |pmid=18510170}}</ref> and human pancreatic cancer BxPC-3 and AsPC-1 cells.<ref>{{cite journal |author=Chen H, Sun B, Pan S, Jiang H, Sun X |year=2009 |title=Dihydroartemisinin induces apoptosis in human leukemia cells HL60 via downregulation of transferrin receptor expression |journal=Anticancer Drugs |volume=20 |issue=2 |pages=131–140 |pmid=19209030 |doi=10.1097/CAD.0b013e3283212ade}}</ref> |
|
|
|
|
|
|
==Reference== |
|
== Side effects == |
|
|
Possible side effects include cardiac effects such as bradycardia and ] prolongation.<ref name=drugs/><ref name="Artemether">{{Cite web|url=http://www.antimicrobe.org/drugpopup/artemether.htm|title=Artemether|website=www.antimicrobe.org|access-date=2016-11-09|url-status=live|archive-url=https://web.archive.org/web/20170223123545/http://www.antimicrobe.org/drugpopup/artemether.htm|archive-date=2017-02-23}}</ref> Also, possible central nervous system toxicity has been shown in animal studies.<ref>{{Cite web|url=http://apps.who.int/medicinedocs/en/d/Jh2922e/2.5.10.html#Jh2922e.2.5.10|title=WHO Model Prescribing Information: Drugs Used in Parasitic Diseases - Second Edition: Protozoa: Malaria: Artemether|website=apps.who.int|access-date=2016-11-09|url-status=dead|archive-url=https://web.archive.org/web/20161110043655/http://apps.who.int/medicinedocs/en/d/Jh2922e/2.5.10.html#Jh2922e.2.5.10|archive-date=2016-11-10}}</ref><ref name=Askling2012>{{cite journal | vauthors = Askling HH, Bruneel F, Burchard G, Castelli F, Chiodini PL, Grobusch MP, Lopez-Vélez R, Paul M, Petersen E, Popescu C, Ramharter M, Schlagenhauf P | display-authors = 6 | title = Management of imported malaria in Europe | journal = Malaria Journal | volume = 11 | pages = 328 | date = September 2012 | pmid = 22985344 | pmc = 3489857 | doi = 10.1186/1475-2875-11-328 | doi-access = free }}</ref> |
⚫ |
{{Reflist}} |
|
|
|
|
|
|
== Drug interactions == |
|
|
Plasma artemether level was found to be lower when the combination product was used with lopinavir/ritonavir.<ref name=Askling2012/> There is also decreased drug exposure associated with concurrent use with efavirenz or nevirapine.<ref>{{cite journal | vauthors = Van Geertruyden JP | title = Interactions between malaria and human immunodeficiency virus anno 2014 | journal = Clinical Microbiology and Infection | volume = 20 | issue = 4 | pages = 278–285 | date = April 2014 | pmid = 24528518 | pmc = 4368411 | doi = 10.1111/1469-0691.12597 }}</ref><ref>{{cite journal | vauthors = Kiang TK, Wilby KJ, Ensom MH | title = Clinical pharmacokinetic drug interactions associated with artemisinin derivatives and HIV-antivirals | journal = Clinical Pharmacokinetics | volume = 53 | issue = 2 | pages = 141–153 | date = February 2014 | pmid = 24158666 | doi = 10.1007/s40262-013-0110-5 | s2cid = 1281113 }}</ref> |
|
|
|
|
|
Artemether/lumefantrine should not be used with drugs that inhibit ].<ref name=drugs/><ref name=Stover2012>{{cite journal | vauthors = Stover KR, King ST, Robinson J | title = Artemether-lumefantrine: an option for malaria | journal = The Annals of Pharmacotherapy | volume = 46 | issue = 4 | pages = 567–577 | date = April 2012 | pmid = 22496476 | doi = 10.1345/aph.1Q539 | s2cid = 7678606 }}</ref> |
|
|
|
|
|
Hormonal contraceptives may not be as efficacious when used with artemether/lumefantrine.<ref name=Stover2012/> |
|
|
|
|
|
==Pharmacology== |
|
|
=== Mechanism of action === |
|
|
A possible mechanism of action is that artemisinin drugs exert their cidal action by inhibiting ]. Since PfATP6 is an enzyme regulating cellular calcium concentration, its malfunctioning will lead to intracellular calcium accumulation, which in turns causes cell death.<ref name=Guo2016>{{cite journal | vauthors = Guo Z | title = Artemisinin anti-malarial drugs in China | journal = Acta Pharmaceutica Sinica. B | volume = 6 | issue = 2 | pages = 115–124 | date = March 2016 | pmid = 27006895 | pmc = 4788711 | doi = 10.1016/j.apsb.2016.01.008 }}</ref> |
|
|
|
|
|
===Pharmacokinetics=== |
|
|
Absorption of artemether is improved 2- to 3-fold with food. It is highly bound to protein (95.4%). Peak concentrations of artemether are seen 2 hours after administration.<ref name="Coartem FDA label">{{cite web | title=Coartem- artemether and lumefantrine tablet | website=DailyMed | date=5 August 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=7866ec19-dfac-47d4-a53f-511a12643cbf | access-date=26 April 2020}}</ref> |
|
|
|
|
|
Artemether is metabolized in the human body to the active metabolite, dihydroartemisinin, primarily by hepatic enzymes CYP3A4/5.<ref name="Coartem FDA label"/> Both the parent drug and active metabolite are eliminated with a half-life of about 2 hours.<ref name="Coartem FDA label"/> |
|
|
|
|
|
==Chemistry== |
|
⚫ |
Artemether is a ] ] derivative of ], which is a peroxide-containing ] isolated from the antimalarial plant '']''. It is also known as dihydroartemisinin methyl ether, but its ] is (+)-(3-alpha,5a-beta,6-beta,8a-beta, 9-alpha,12-beta,12aR)-decahydro-10-methoxy-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin. |
|
|
It is a relatively lipophilic and unstable drug,<ref>{{cite journal | vauthors = De Spiegeleer BM, D'Hondt M, Vangheluwe E, Vandercruyssen K, De Spiegeleer BV, Jansen H, Koijen I, Van Gompel J | display-authors = 6 | title = Relative response factor determination of β-artemether degradants by a dry heat stress approach | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 70 | pages = 111–116 | date = November 2012 | pmid = 22770733 | doi = 10.1016/j.jpba.2012.06.002 | hdl-access = free | hdl = 1854/LU-2938963 | url = https://biblio.ugent.be/publication/2938963 }}</ref> which acts by creating reactive free radicals in addition to affecting the membrane transport system of the plasmodium organism.<ref name="Artemether"/> |
|
|
|
|
|
== References == |
|
⚫ |
{{Reflist|32em}} |
|
|
|
|
|
{{Antimalarials}} |
|
{{Antimalarials}} |
|
|
|
|
|
{{portal bar|Medicine}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
|
] |
|
] |
|
|
|
] |
|
] |
|
|
|
] |
|
] |
|
|
|
] |