| Revision as of 11:35, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 460463335 of page Azapropazone for the Chem/Drugbox validation project (updated: 'ChEBI', 'ChEMBL', 'CAS_number'). |
Latest revision as of 22:37, 10 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| Line 1: |
Line 1: |
|
|
{{Short description|Nonsteroidal anti-inflammatory drug (NSAID)}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 460326752 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (''RS'')-5-dimethylamino-9-methyl-2-prop-2-enylpyrazolobenzotriazine-1,3-dione |
|
|
⚫ |
| verifiedrevid = 477351400 |
| ⚫ |
| image = azapropazone.png |
|
|
⚫ |
| IUPAC_name = (''RS'')-5-(Dimethylamino)-9-methyl-2-propyl-1H-pyrazolobenzotriazine-1,3(2H)-dione |
|
⚫ |
| image = azapropazone.svg |
|
|
| image_class = skin-invert-image |
|
| width = 200px |
|
| width = 200px |
|
| imagename = 1 : 1 mixture (racemate) |
|
| chirality = ] |
|
| drug_name = Azapropazone |
|
| image2 = Azapropazone 3D spacefill.png |
|
|
| image_class2 = bg-transparent |
|
|
| alt2 = Azapropazone molecule |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Rheumox |
|
| Drugs.com = {{drugs.com|international|azapropazone}} |
|
| Drugs.com = {{drugs.com|international|azapropazone}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| Line 18: |
Line 23: |
|
| legal_UK = POM |
|
| legal_UK = POM |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 20 hours |
|
| elimination_half-life = 20 hours |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 13539-59-8 --> |
|
| CAS_number = 13539-59-8 |
|
| ATC_prefix = M01 |
|
| ATC_prefix = M01 |
|
| ATC_suffix = AX04 |
|
| ATC_suffix = AX04 |
| Line 39: |
Line 44: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02966 |
|
| KEGG = D02966 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1231131 --> |
|
| ChEMBL = 1231131 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 38010 |
|
| ChEBI = 38010 |
|
| PubChem = 26098 |
|
| PubChem = 26098 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24310 |
|
| ChemSpiderID = 24310 |
|
| smiles = O=C3N/1N(c2c(\N=C\1N(C)C)ccc(c2)C)C(=O)C3CCC |
|
| smiles = O=C3N/1N(c2c(\N=C\1N(C)C)ccc(c2)C)C(=O)C3CCC |
|
| InChI = 1/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3 |
|
|
| InChIKey = MPHPHYZQRGLTBO-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3 |
|
| StdInChI = 1S/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3 |
| Line 54: |
Line 58: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=18 | N=4 | O=2 |
|
| C=16 | H=20 | N=4 | O=2 |
|
| molecular_weight = 298.33972 g/mol |
|
|
}} |
|
}} |
|
|
|
|
|
'''Azapropazone''' is a ] (NSAID). It is manufactured by ] under the tradename '''Rheumox'''.<ref>{{cite web | title = Rheumox Capsules | url = http://home.intekom.com/pharm/cont_eth/rheumox.html | work = South Africa Electronic Package Inserts | access-date = 2008-08-18 | archive-date = 2008-05-15 | archive-url = https://web.archive.org/web/20080515193315/http://home.intekom.com/pharm/cont_eth/rheumox.html | url-status = dead }}</ref> |
|
|
|
|
|
It was available in the UK as a ]-only drug, with restrictions due to certain contra-indications and side-effects.<ref>{{cite web | title = Azapropazone | url = http://www.patient.co.uk/showdoc/30002267/ | archive-url = https://web.archive.org/web/20090412081934/http://www.patient.co.uk/showdoc/30002267/ | archive-date = 12 April 2009 | work = Patient UK }}</ref> Azopropazone has now been discontinued in the ]. |
|
|
|
|
|
Azapropazone has a half-life of approximately 20 hours in humans and is not extensively metabolized.<ref name="pmid770078">{{cite journal | vauthors = Jones CJ | title = The pharmacology and pharmacokinetics of azapropazone - a review | journal = Current Medical Research and Opinion | volume = 4 | issue = 1 | pages = 3–16 | year = 1976 | pmid = 770078 | doi = 10.1185/03007997609109277 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Analgesics}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |