Revision as of 23:06, 29 October 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (Std)InChI & (Std)InChIKey← Previous edit |
Latest revision as of 07:07, 24 December 2024 edit undoNyxion303 (talk | contribs)Extended confirmed users8,383 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5Tag: IABotManagementConsole [1.3] |
(42 intermediate revisions by 24 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 444158861 |
|
|
|
| Watchedfields = changed |
⚫ |
| IUPAC_name = 2-chloro-5-(2H-tetrazol-5-yl)-4-benzenesulfonamide |
|
|
⚫ |
| verifiedrevid = 458285216 |
⚫ |
| image = Azosemide.png |
|
|
⚫ |
| IUPAC_name = 2-chloro-5-(2H-tetrazol-5-yl)-4-benzenesulfonamide |
|
⚫ |
| image = Azosemide.svg |
|
|
| alt = Structural formula of azosemide |
|
|
| width = 140 |
|
|
| image2 = Azosemide molecule spacefill.png |
|
|
| alt2 = Space-filling model of the azosemide molecule |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|azosemide}} |
|
| Drugs.com = {{drugs.com|international|azosemide}} |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2186 |
|
| ChemSpiderID = 2186 |
⚫ |
| SMILES = O=S(=O)(N)c2c(Cl)cc(c(c1nnnn1)c2)NCc3sccc3 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C12H11ClN6O2S2/c13-9-5-10(15-6-7-2-1-3-22-7)8(12-16-18-19-17-12)4-11(9)23(14,20)21/h1-5,15H,6H2,(H2,14,20,21)(H,16,17,18,19) |
|
| StdInChI = 1S/C12H11ClN6O2S2/c13-9-5-10(15-6-7-2-1-3-22-7)8(12-16-18-19-17-12)4-11(9)23(14,20)21/h1-5,15H,6H2,(H2,14,20,21)(H,16,17,18,19) |
|
| InChIKey = HMEDEBAJARCKCT-UHFFFAOYAX |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H11ClN6O2S2/c13-9-5-10(15-6-7-2-1-3-22-7)8(12-16-18-19-17-12)4-11(9)23(14,20)21/h1-5,15H,6H2,(H2,14,20,21)(H,16,17,18,19) |
|
|
| StdInChIKey = HMEDEBAJARCKCT-UHFFFAOYSA-N |
|
| StdInChIKey = HMEDEBAJARCKCT-UHFFFAOYSA-N |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = 27589-33-9 |
|
| CAS_number = 27589-33-9 |
|
| ATC_prefix = |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
⚫ |
| PubChem = 2273 |
|
|
|
| ChEMBL = 1097235 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 31248 |
|
⚫ |
| PubChem = 2273 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB08961 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = MR40VT1L8Z |
|
| UNII = MR40VT1L8Z |
Line 34: |
Line 48: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=11 | Cl=1 | N=6 | O=2 | S=2 |
|
| C=12 | H=11 | Cl=1 | N=6 | O=2 | S=2 |
|
⚫ |
| smiles = O=S(=O)(N)c2c(Cl)cc(c(c1nnn1)c2)NCc3sccc3 |
|
| molecular_weight = 370.84 g/mol |
|
|
| smiles = O=S(=O)(N)c2c(Cl)cc(c(c1nnnn1)c2)NCc3sccc3 |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Azosemide''' is a high-ceiling ] agent that was brought to market in 1981 by ].<ref>{{ cite book| vauthors = Sittig M |title=Pharmaceutical Manufacturing Encyclopedia |volume=1 |publisher=Noyes Publications |year=1988 |page=122 |isbn= 978-0-8155-1144-1 |url=http://files.rushim.ru/books/lekarstva/pharmaceutical-encyclopedia.pdf |url-status=dead |archive-url= https://web.archive.org/web/20071023210611/http://files.rushim.ru/books/lekarstva/pharmaceutical-encyclopedia.pdf |archivedate=2007-10-23 }}</ref><ref>{{cite book | vauthors = Bormann D | chapter = Diuretics | veditors = Hess HJ | title = Annual Reports in Medicinal Chemistry | date = January 1980 | volume = 15 | pages = 100–105 (101) | publisher = Academic Press | isbn = 978-0-08-058359-4 }}</ref> As of 2015 it was available as a generic in some Asian countries.<ref>{{cite web | work = Drugs.com | url = https://www.drugs.com/international/azosemide.html | title = International listings for azosemide | access-date = 23 July 2015 }}</ref> |
|
'''Azosemide''' is a high ceiling ] agent. |
|
|
|
|
|
|
==Synthesis== |
|
|
|
|
|
] |
|
|
|
|
|
|
|
Azosemide has been found as an adulterant in ].<ref>{{cite web |title=Drug Checking Report 2011 |url=https://energycontrol.org/files/analisis/Annual_Drug_Checking_Report_Energy_Control_2011.pdf |website=Energy Control |access-date=20 January 2022 |archive-date=20 January 2022 |archive-url=https://web.archive.org/web/20220120232735/https://energycontrol.org/files/analisis/Annual_Drug_Checking_Report_Energy_Control_2011.pdf |url-status=live }}</ref> |
|
==References== |
|
==References== |
|
|
{{reflist}} |
|
Popelak, A.; Lerch, A.; Stach, K.; Roesch, E.; Hardebeck, K.; German Offen., 1970, 815922; Chem. Abstr. 1970, 73, 45519. |
|
|
|
|
|
|
] |
|
] |
Line 51: |
Line 62: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{Diuretics}} |
|
|
{{cardiovascular-drug-stub}} |