| Revision as of 08:36, 15 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user← Previous edit |
Latest revision as of 04:57, 16 January 2025 edit undo184.145.158.231 (talk) bad commaTags: Mobile edit Mobile app edit iOS app edit App section source |
| (18 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Pharmaceutical drug}} |
|
{{Orphan|date=October 2010}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414030311 |
|
| verifiedrevid = 414031157 |
|
| IUPAC_name = 1,7-di(pyridin-3-yl)heptan-4-yl (2''S'')-1-piperidine-2-carboxylate |
|
| IUPAC_name = 1,7-di(pyridin-3-yl)heptan-4-yl (2''S'')-1-piperidine-2-carboxylate |
|
| image = Biricodar.svg |
|
| image = Biricodar.svg |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 174254-13-8 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 3037617 |
|
⚫ |
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 2301309 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 9WQP0L619L |
|
| UNII = 9WQP0L619L |
|
| InChI = 1/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1 |
|
|
| InChIKey = CGVWPQOFHSAKRR-NDEPHWFRBE |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 350775 |
|
| ChEMBL = 350775 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=34 | H=41 |
|
|
| N=3 | O=7 |
|
⚫ |
| smiles = O=C(C(=O)c1cc(OC)c(OC)c(OC)c1)N4(C(=O)OC(CCCc2cccnc2)CCCc3cccnc3)CCCC4 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1 |
|
| StdInChI = 1S/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CGVWPQOFHSAKRR-NDEPHWFRSA-N |
|
| StdInChIKey = CGVWPQOFHSAKRR-NDEPHWFRSA-N |
| ⚫ |
| CAS_number = 174254-13-8 |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 3037617 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID=2301309 |
|
| ⚫ |
| C=34|H=41|N=3|O=7 |
|
|
| molecular_weight = 603.705 g/mol |
|
| ⚫ |
| smiles = O=C(C(=O)c1cc(OC)c(OC)c(OC)c1)N4(C(=O)OC(CCCc2cccnc2)CCCc3cccnc3)CCCC4 |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
'''Biricodar''' (], codename '''VX-170''', marketed as the ] salt under the trade name '''Incel''') is a ] released by ] in 1999 to help treat ] patients. |
|
'''Biricodar''' or '''incel''' (], codename '''VX-710''') was a ] under development by ] to help treat ] patients that never reached the market. |
|
|
|
|
|
==External links== |
|
==External links== |
|
|
* |
|
|
|
|
|
* |
|
* |
|
* |
|
* |
|
* |
|
] |
|
|
|
|
|
|
|
] |
|
{{Med-stub}} |
|
|
|
|
|
|
|
|
|
|
{{Antineoplastic-drug-stub}} |
|
] |
|