| Revision as of 04:05, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}}, {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugb← Previous edit |
Latest revision as of 12:25, 13 May 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,237 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (8 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 428762737 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 447980049 |
|
| IUPAC_name = Calcium 6-(2-dimethylamino-acetoxy)-2,3,4,5-tetrahydroxy-hexanoate |
|
| IUPAC_name = Calcium 6-(2-dimethylamino-acetoxy)-2,3,4,5-tetrahydroxy-hexanoate |
|
| image = Calcium pangamate.png |
|
| image = Calcium pangamate.png |
| Line 24: |
Line 27: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
|
| ⚫ |
| CAS_number = 11041-98-8 |
|
|
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
⚫ |
| CAS_number = 20310-61-6 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 492G10Q871 |
|
| ATC_prefix = A12 |
|
| ATC_prefix = A12 |
|
| ATC_suffix = AA11 |
|
| ATC_suffix = AA11 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 26333260 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = Ca(C<sub>10</sub>H<sub>18</sub>NO<sub>8</sub>)<sub>2</sub> |
|
| chemical_formula = Ca(C<sub>10</sub>H<sub>18</sub>NO<sub>8</sub>)<sub>2</sub> |
|
|
| smiles = CN(C)CC(=O)OC((((C(=O))O)O)O)O.CN(C)CC(=O)OC((((C(=O))O)O)O)O. |
|
|
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/2C10H19NO8.Ca/c2*1-11(2)3-6(13)19-4-5(12)7(14)8(15)9(16)10(17)18;/h2*5,7-9,12,14-16H,3-4H2,1-2H3,(H,17,18);/q;;+2/p-2/t2*5-,7-,8+,9-;/m11./s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JWLAOERSRUNGEF-JQVJEGKNSA-L |
|
| molecular_weight = |
|
| molecular_weight = |
|
}} |
|
}} |
|
|
|
|
|
|
'''Calcium pangamate''' is a ].<ref>{{cite journal | vauthors = Rastopchin IP | title = | journal = Zhurnal Nevropatologii I Psikhiatrii Imeni S.S. Korsakova | volume = 84 | issue = 7 | pages = 1020–1023 | date = 1984-01-01 | pmid = 6475410 | url = https://europepmc.org/article/med/6475410 }}</ref> It is sometimes used as a synonym for ].<ref>{{Cite journal |date=1980-06-27 |title=Vitamin B15—whatever it is, it won't help |url=http://jama.jamanetwork.com/article.aspx?doi=10.1001/jama.1980.03300500005002 |journal=JAMA: The Journal of the American Medical Association |language=en |volume=243 |issue=24 |pages=2473 |doi=10.1001/jama.1980.03300500005002 |pmid=7382025 |issn=0098-7484|last1=Check |first1=W. A. }}</ref> |
|
'''Calcium pangamate''' is a ], and is sometimes used as a synonym for "]." |
|
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
| Line 43: |
Line 58: |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |