Revision as of 19:52, 10 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Latest revision as of 19:23, 7 April 2024 edit undoIsla (talk | contribs)Extended confirmed users2,451 edits added Category:Drugs developed by Pfizer using HotCat |
(31 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 455350271 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 460016047 |
|
| ImageFile = Canertinib.svg |
|
| ImageFile = Canertinib.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = ''N''-{4--7-quinazolin-6-yl}prop-2-enamide |
|
| PIN = ''N''-<nowiki/>{4-(3-Chloro-4-fluoroanilino)-7-quinazolin-6-yl}prop-2-enamide |
|
| OtherNames = CI-1033; PD-183805 |
|
| OtherNames = CI-1033; PD-183805 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 5675 |
⚫ |
| CASNo = <!-- blanked - oldvalue: 267243-28-7 --> |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
⚫ |
| CASNo = 267243-28-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = C78W1K5ASF |
|
| UNII = C78W1K5ASF |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 61399 |
|
| ChEBI = 61399 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 31965 |
|
| ChEMBL = 31965 |
|
|
| ChEMBL1_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL1 = 545315 |
|
| PubChem = 156414 |
|
| PubChem = 156414 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 137741 |
|
| ChemSpiderID = 137741 |
|
| SMILES = Fc1ccc(cc1Cl)Nc4ncnc3cc(OCCCN2CCOCC2)c(NC(=O)\C=C)cc34 |
|
| SMILES = Fc1ccc(cc1Cl)Nc4ncnc3cc(OCCCN2CCOCC2)c(NC(=O)\C=C)cc34 |
|
| InChI = 1/C24H25ClFN5O3/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29) |
|
| InChI = 1/C24H25ClFN5O3/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29) |
|
| InChIKey = OMZCMEYTWSXEPZ-UHFFFAOYAG |
|
| InChIKey = OMZCMEYTWSXEPZ-UHFFFAOYAG |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C24H25ClFN5O3/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29) |
|
| StdInChI = 1S/C24H25ClFN5O3/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OMZCMEYTWSXEPZ-UHFFFAOYSA-N |
|
| StdInChIKey = OMZCMEYTWSXEPZ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=24|H=25|Cl=1|F=1|N=5|O=3 |
|
| C=24 | H=25 | Cl=1 | F=1 | N=5 | O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Canertinib''' ('''CI-1033''') is an experimental drug candidate for the treatment of cancer. It is an ] ] with activity against ] (IC<sub>50</sub> 0.8 nM), ] (IC<sub>50</sub> 19 nM) and ] (IC<sub>50</sub> 7 nM).<ref>{{cite journal | pmid = 10753475 | year = 2000 | last1 = Smaill | first1 = JB | last2 = Rewcastle | first2 = GW | last3 = Loo | first3 = JA | last4 = Greis | first4 = KD | last5 = Chan | first5 = OH | last6 = Reyner | first6 = EL | last7 = Lipka | first7 = E | last8 = Showalter | first8 = HD | last9 = Vincent | first9 = PW | title = Tyrosine kinase inhibitors. 17. Irreversible inhibitors of the epidermal growth factor receptor: 4-(phenylamino)quinazoline- and 4-(phenylamino)pyrido3,2-dpyrimidine-6-acrylamides bearing additional solubilizing functions | volume = 43 | issue = 7 | pages = 1380–97 | journal = Journal of medicinal chemistry}}</ref><ref>, Selleck Chemicals</ref> |
|
'''Canertinib''' ('''CI-1033''') is an experimental drug candidate for the treatment of cancer. It is an ] ] with activity against ] (IC<sub>50</sub> 0.8 nM), ] (IC<sub>50</sub> 19 nM) and ] (IC<sub>50</sub> 7 nM).<ref>{{cite journal | pmid = 10753475 | year = 2000 | last1 = Smaill | first1 = JB | last2 = Rewcastle | first2 = GW | last3 = Loo | first3 = JA | last4 = Greis | first4 = KD | last5 = Chan | first5 = OH | last6 = Reyner | first6 = EL | last7 = Lipka | first7 = E | last8 = Showalter | first8 = HD | last9 = Vincent | first9 = PW | last10 = Elliott | first10 = William L | last11 = Denny | first11 = William A | title = Tyrosine kinase inhibitors. 17. Irreversible inhibitors of the epidermal growth factor receptor: 4-(phenylamino)quinazoline- and 4-(phenylamino)pyrido3,2-dpyrimidine-6-acrylamides bearing additional solubilizing functions | volume = 43 | issue = 7 | pages = 1380–97 | journal = Journal of Medicinal Chemistry | doi=10.1021/jm990482t| display-authors = 8 }}</ref><ref>, Selleck Chemicals</ref> By 2015, Pfizer had discontinued development of the drug.<ref>{{Cite web|url=http://adisinsight.springer.com/drugs/800012072|title = Canertinib - AdisInsight}}</ref> |
|
|
|
|
|
Canertinib has been reported as a substrate for the transporter protein ]. Interaction of canertinib with OATP1B3 may alter its hepatic disposition and can lead to transporter mediated drug-drug interactions.<ref name="pmid24643910">{{cite journal |vauthors=Khurana V, Minocha M, Pal D, Mitra AK | title = Role of OATP-1B1 and/or OATP-1B3 in hepatic disposition of tyrosine kinase inhibitors. | journal = Drug Metabol Drug Interact. | volume = 29| issue = 3 | pages = 179–90 |date=March 2014 | pmid = 24643910 | doi = 10.1515/dmdi-2013-0062 | pmc=4407685}}</ref> Canertinib is not an inhibitor of the ] or OATP1B3 transporters.<ref name="Khurana V_2014">{{cite journal |vauthors=Khurana V, Minocha M, Pal D, Mitra AK | title = Inhibition of OATP-1B1 and OATP-1B3 by tyrosine kinase inhibitors. | journal = Drug Metabol Drug Interact. | volume = 29| issue = 4 | pages = 249–59 |date=May 2014 | pmid = 24807167 | doi = 10.1515/dmdi-2014-0014 | pmc=4407688}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Growth factor receptor modulators}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{pharma-stub}} |
|
{{antineoplastic-drug-stub}} |