Misplaced Pages

Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 11:43, 30 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit Latest revision as of 05:50, 4 October 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,758,710 editsm Moving Category:Uncoupling agents to Category:Uncouplers per Misplaced Pages:Categories for discussion/Speedy 
(41 intermediate revisions by 26 users not shown)
Line 1: Line 1:
{{DISPLAYTITLE:Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone}}
{{chembox {{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 414048120
| Name = Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone
| ImageFile = Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone.svg | ImageFile = Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone.svg
| ImageSize = 250px | ImageSize = 250px
| PIN = ''N''-carbonohydrazonoyl dicyanide
| IUPACName =
| OtherNames = | OtherNames =
| Reference = <ref>, ].</ref> | Reference = <ref>, ].</ref>
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3213 | ChemSpiderID = 3213
| InChI = 1/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H | InChI = 1/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H
| InChIKey = BMZRVOVNUMQTIN-UHFFFAOYAT | InChIKey = BMZRVOVNUMQTIN-UHFFFAOYAT
| SMILES1 = FC(F)(F)Oc1ccc(cc1)N/N=C(\C#N)C#N | SMILES1 = FC(F)(F)Oc1ccc(cc1)N/N=C(\C#N)C#N
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 457504
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H | StdInChI = 1S/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BMZRVOVNUMQTIN-UHFFFAOYSA-N | StdInChIKey = BMZRVOVNUMQTIN-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 370-86-5 | CASNo = 370-86-5
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 3330
| UNII = SQR3W2FLV5
| SMILES = C1=CC(=CC=C1NN=C(C#N)C#N)OC(F)(F)F
| ChEBI_Ref = {{ebicite|changed|EBI}}
| MeSHName = FCCP
| ChEBI = 75458
| PubChem = 3330
| SMILES = C1=CC(=CC=C1NN=C(C#N)C#N)OC(F)(F)F
| MeSHName = FCCP
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = {{chem2|C10H5F3N4O}}
| Formula = C<sub>10</sub>H<sub>5</sub>F<sub>3</sub>N<sub>4</sub>O
| MolarMass = 254.16811 g/mol | MolarMass = 254.16811 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
}} }}

'''Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone''' ('''FCCP''') is an ] that is a mobile ]. It referred to as an ] because it disrupts ] ] by transporting ] through a ] before they can be used to provide the energy for ].<ref>, ].</ref> It is a ] and ]. '''Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone''' ('''FCCP''') is an ] that is a mobile ]. It is referred to as an ] because it disrupts ] ] by transporting ] through the ] before they can be used to provide the energy for ].<ref>, ].</ref> It is a ] and ]. FCCP was first described in 1962 by Heytler.<ref>{{cite journal |author=Heytler, P G |title=A new class of uncoupling agents — Carbonyl cyanide phenylhydrazones |journal=Biochemical and Biophysical Research Communications |volume=7 |issue=4 |pages=272–275 |year=1962 | doi=10.1016/0006-291X(62)90189-4|pmid=13907155 }}</ref>

== See also ==
* ] (CCCP)


==References== ==References==
{{reflist}} {{reflist}}


== See also ==
* ] (CCCP)
] ]
] ]
]

]

]
{{biochem-stub}}

]
]
Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone: Difference between revisions Add topic