Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 05:17, 16 December 2010 editPashihiko (talk | contribs)Extended confirmed users3,563 editsNo edit summary← Previous edit		Latest revision as of 16:13, 21 November 2023 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,388,432 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5
(31 intermediate revisions by 24 users not shown)
Line 1:		Line 1:
			{{Short description|Chemical compound}}
	{{Unreferenced stub|auto=yes|date=December 2009}}
	{{Drugbox | verifiedrevid = 401946388		{{Drugbox
			| Watchedfields = changed
	|
			| verifiedrevid = 447440132
	| IUPAC_name = (6''R'',7''R'')-3-(acetyloxymethyl)-7--<br>8-oxo-5-thia-1-azabicyclooct-2-ene-2-<br>carboxylic acid		| IUPAC_name = (6''R'',7''R'')-3-(acetyloxymethyl)-7--<br>8-oxo-5-thia-1-azabicyclooct-2-ene-2-<br>carboxylic acid
	| image = Cefacetrile.svg		| image = Cefacetrile.svg
			<!--Clinical data-->
			| tradename = Celospor, Celtol, Cristacef
			| Drugs.com = {{drugs.com|international|cefacetrile}}
		⚫	| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
		⚫	| pregnancy_US = <!-- A / B / C / D / X -->
		⚫	| pregnancy_category =
		⚫	| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
		⚫	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
		⚫	| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
		⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
		⚫	| legal_status = Rx-only
		⚫	| routes_of_administration = ], ], intra]
			<!--Pharmacokinetic data-->
		⚫	| bioavailability =
		⚫	| protein_bound = 23 to 38%
		⚫	| metabolism =
		⚫	| elimination_half-life = 1.2 hours
		⚫	| excretion = ] (72%)
			<!--Identifiers-->
		⚫	| CAS_number_Ref = {{cascite|correct|??}}
		⚫	| CAS_number = 10206-21-0
		⚫	| ATC_prefix = J01
		⚫	| ATC_suffix = DB10
		⚫	| ATC_supplemental = {{ATCvet|J51|DB10}}
		⚫	| PubChem = 91562
			| ChEMBL = 2104099
			| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
		⚫	| DrugBank = DB01414
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
	| ChemSpiderID = 82675		| ChemSpiderID = 82675
	| UNII_Ref = {{fdacite|correct|FDA}}		| UNII_Ref = {{fdacite|correct|FDA}}
	| UNII = FDM21QQ344		| UNII = FDM21QQ344
			| KEGG_Ref = {{keggcite|correct|kegg}}
	| InChI = 1/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1
		⚫	| KEGG = D07629
			<!--Chemical data-->
		⚫	| C=13 | H=13 | N=3 | O=6 | S=1
	| smiles = O=C2N1/C(=C(\CS12NC(=O)CC#N)COC(=O)C)C(=O)O		| smiles = O=C2N1/C(=C(\CS12NC(=O)CC#N)COC(=O)C)C(=O)O
	| InChIKey = RRYMAQUWDLIUPV-BXKDBHETBM
⚫	| CASNo_Ref = {{cascite|correct|CAS}}
	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}		| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChI = 1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1		| StdInChI = 1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = RRYMAQUWDLIUPV-BXKDBHETSA-N		| StdInChIKey = RRYMAQUWDLIUPV-BXKDBHETSA-N
⚫	| CAS_number = 10206-21-0
⚫	| ATC_prefix = J01
⚫	| ATC_suffix = DB10
⚫	| ATC_supplemental = {{ATCvet|J51|DA34}}
⚫	| PubChem = 91562
⚫	| DrugBank =
⚫	| KEGG = D07629
⚫	| C = 13 | H = 13 | N = 3 | O = 6 | S = 1
	| molecular_weight = 339.325 g/mol
⚫	| bioavailability =
⚫	| protein_bound = 23 to 38%
⚫	| metabolism =
⚫	| elimination_half-life = 1.2 hours
⚫	| excretion = ] (72%)
⚫	| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫	| pregnancy_US = <!-- A / B / C / D / X -->
⚫	| pregnancy_category =
⚫	| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
⚫	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫	| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	| legal_status =
⚫	| routes_of_administration = ], ]
	}}		}}
	'''Cefacetrile''' (], also spelled cephacetrile) is a ] first generation ] ] effective in ] and ] bacterial infections. It is a ] antibiotic. Cefacetrile is marketed under the trade names '''Celospor''', '''Celtol''', and '''Cristacef'''.		'''Cefacetrile''' (], also spelled cephacetrile) is a ] first generation ] ] effective in ] and ] bacterial infections. It is a ] antibiotic.<ref>{{cite web|url=http://www.emea.europa.eu/docs/en_GB/document_library/Maximum_Residue_Limits_-_Report/2009/11/WC500011465.pdf|publisher=], Committee for Veterinary Medicinal Products|title=Cefacetrile Summary Report|year=1998|access-date=2012-01-25|archive-date=2020-05-26|archive-url=https://web.archive.org/web/20200526024746/https://www.ema.europa.eu/en/documents/mrl-report/cefacetrile-summary-report-1-committee-veterinary-medicinal-products_en.pdf|url-status=dead}}</ref><ref name="AC">{{cite book |title= Austria-Codex | veditors = Haberfeld H |publisher=Österreichischer Apothekerverlag |location=Vienna |year=2007 |edition=2007/2008 |isbn=978-3-85200-183-8 |language=German}}</ref> Cefacetrile is marketed under the trade names '''Celospor''', '''Celtol''', and '''Cristacef''',<ref>{{cite journal | vauthors = Horiuchi N, Oyakawa Y, Oka R, Fujiwara T | title = | journal = The Japanese Journal of Antibiotics | volume = 33 | issue = 10 | pages = 1145–55 | date = October 1980 | pmid = 7206219 }}</ref> and as '''Vetimast''' for the treatment of ] infections in lactating cows.<ref name="AC" />
			==Synthesis==
			]).]]
			It was made by reacting ] (7-aminocephalosporanic acid) with cyanoacetyl chloride in the presence of ].{{cn|date=March 2023}}
			== References ==
			{{Reflist}}
	{{CephalosporinAntiBiotics}}		{{CephalosporinAntiBiotics}}
	]		]
			]
			]
	]		]
			]
	{{Antibiotic-stub}}		{{Antibiotic-stub}}
	]