| Revision as of 18:17, 16 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antiinfective-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 06:15, 30 November 2024 edit undo103.108.60.61 (talk)No edit summary |
| (20 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{Distinguish|Clopidogrel}} |
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443792824 |
|
| verifiedrevid = 450844569 |
|
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol |
|
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol |
|
| image = clopidol.png |
|
| image = clopidol.png |
|
|
| width = 140 |
|
|
| image2 = Clopidol molecule ball.png |
|
|
| width2 = 180 |
|
|
| alt2 = Ball-and-stick model of the clopidol molecule |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Coyden, Clobek(Animate Animal Health) |
|
| Drugs.com = {{drugs.com|international|clopidol}} |
|
| Drugs.com = {{drugs.com|international|clopidol}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 2971-90-6 |
|
| CAS_number = 2971-90-6 |
|
| ATC_prefix = none |
|
| ATCvet = yes |
|
| ATC_suffix = |
|
| ATC_prefix = P51 |
|
|
| ATC_suffix = BX05 |
|
| PubChem = 18087 |
|
| PubChem = 18087 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 446918 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8J763HFF5N |
|
| UNII = 8J763HFF5N |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03559 |
|
| KEGG = D03559 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 17084 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZDPIZLCVJAAHHR-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=7 | H=7 | Cl=2 | N=1 | O=1 |
|
| C=7 | H=7 | Cl=2 | N=1 | O=1 |
|
| molecular_weight = 192.04 g/mol |
|
|
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1 |
|
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1 |
|
}} |
|
}} |
|
|
|
|
|
|
'''Clopidol''' is an ] that is used as in ] as a ]. It is prepared industrially by a multistep process from ].<ref>{{cite book | vauthors = Miller R, Abaecherli C, Said A, Jackson B | chapter = Ketenes | title = Ullmann's Encyclopedia of Industrial Chemistry | date = June 2000 | publisher = Wiley-VCH | location = Weinheim | doi = 10.1002/14356007.a15_063 | isbn = 3527306730 }}</ref> |
|
'''Clopidol''' is a ] with the ] C<sub>7</sub>H<sub>7</sub>Cl<sub>2</sub>NO. |
|
|
|
|
|
|
|
The US ] has set a ] (REL) for clopidol at 10 mg/m<sup>3</sup> TWA (time-weighted average) for total exposure, 5 mg/m<sup>3</sup> TWA for respiratory exposure, and 20 mg/m<sup>3</sup> for short-term exposure. The ] has set a ] (PEL); the respiratory PEL is the same as the REL, but the total exposure limit is 15 mg/m<sup>3</sup>.<ref>{{Cite web|url = https://www.cdc.gov/niosh/npg/npgd0143.html|title = Clopidol|date = |accessdate = |website = Pocket Guide to Chemical Hazards|publisher = NIOSH|last = |first = }}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|