Misplaced Pages

Difemerine: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 02:53, 1 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Ph← Previous edit Latest revision as of 06:02, 26 October 2024 edit undo76.174.0.57 (talk) Cats. 
(23 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}} | Watchedfields = changed
| verifiedrevid = 444200308
| IUPAC_name = 2-(Dimethylamino)-2-methylpropyl 2-hydroxy-2,2-diphenylacetate
| image = Difemerine.png

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|difemerine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 80387-96-8
| ATC_prefix = A03
| ATC_suffix = AA09
| PubChem = 165124
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL = 2106534
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 843C4UPZ2F | UNII = 843C4UPZ2F
| verifiedrevid = 405834473
| IUPAC_name = 2-(Dimethylamino)-2-methylpropyl 2-hydroxy-2,2-diphenylacetate
| image = Difemerine.png
| CAS_number = 3477-97-2
| ATC_prefix = A03
| ATC_suffix = AA09
| PubChem = 165124
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07079 | KEGG = D07079
| ChemSpiderID = 10662416
| C=20|H=25|N=1|O=3
| smiles = OC(C(=O)OC(C)(C)CN(C)C)(c1ccccc1)c2ccccc2
| molecular_weight = 327.42 g/mol
| StdInChI = 1S/C20H25NO3/c1-19(2,15-21(3)4)24-18(22)20(23,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,23H,15H2,1-4H3
| bioavailability =
| StdInChIKey = WJIZVQNUJVMJAZ-UHFFFAOYSA-N
| protein_bound =

| metabolism =
<!--Chemical data-->
| elimination_half-life =
| excretion = | C=20 | H=25 | N=1 | O=3
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}


'''Difemerine''' is a little known ]<ref>{{Cite web|url=http://drugcentral.org/drugcard/877|title=difemerine|website=drugcentral.org|access-date=2019-04-21}}</ref> drug sold under the name Luostyl. <ref>{{Cite web|url=https://www.drugs.com/international/luostyl.html|title=Luostyl|website=Drugs.com|language=en|access-date=2019-04-21|archive-date=2019-04-21|archive-url=https://web.archive.org/web/20190421092824/https://www.drugs.com/international/luostyl.html|url-status=dead}}</ref>
'''Difemerine''' is an ].


==References==
{{Reflist|2}}




{{Drugs for functional gastrointestinal disorders}} {{Drugs for functional gastrointestinal disorders}}
{{Muscarinic acetylcholine receptor modulators}}


]
]
] ]
]
]
]
]
]
]
]




Difemerine: Difference between revisions Add topic