Revision as of 14:37, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Latest revision as of 19:31, 8 June 2020 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,931 editsm Added FDA UNII |
(11 intermediate revisions by 8 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414424045 |
|
| verifiedrevid = 443686289 |
|
|ImageFile=Dihydrolipoic-acid-2D-skeletal.png |
|
| ImageFile=Dihydrolipoic-acid-2D-skeletal.png |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName=6,8-dimercaptooctanoic acid |
|
|
|
| PIN = 6,8-Bis(sulfanyl)octanoic acid<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = ] | date = 2014 | location = Cambridge | page = 697 | doi = 10.1039/9781849733069-FP001 | isbn = 978-0-85404-182-4 | quote = The prefixes ‘mercapto’ (–SH), and ‘hydroseleno’ or selenyl (–SeH), etc. are no longer recommended.}}</ref> |
|
|OtherNames= reduced lipoic acid |
|
|
|
| OtherNames= 6,8-Dimercaptooctanoic acid<br />Reduced lipoic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
| IUPHAR_ligand = 6738 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C02147 |
|
| KEGG = C02147 |
|
| InChI = 1/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
|
| InChI = 1/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
Line 16: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IZFHEQBZOYJLPK-UHFFFAOYSA-N |
|
| StdInChIKey = IZFHEQBZOYJLPK-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=462-20-4 |
|
| CASNo=462-20-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem=421 |
|
|
|
| UNII = 7NV2KHU5JA |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem=421 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 408 |
|
| ChemSpiderID = 408 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 18047 |
|
| ChEBI = 18047 |
|
| SMILES=C(CCC(=O)O)CC(CCS)S |
|
| SMILES=C(CCC(=O)O)CC(CCS)S |
|
| MeSHName=Dihydrolipoic+acid |
|
| MeSHName=Dihydrolipoic+acid |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=16 | O=2 | S=2 |
|
| Formula=C<sub>8</sub>H<sub>16</sub>O<sub>2</sub>S<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=208.343 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Dihydrolipoic acid''' is an ] that is the reduced form of ]. This carboxylic acid features a pair of ] groups. It is ] but only the R-enantiomer is biochemically significant. The lipoic acid/dihydrolipoic acid pair participate in a variety of biochemical transformations. |
|
'''Dihydrolipoic acid''' is an ] that is the reduced form of ]. This carboxylic acid features a pair of ] groups, and therefore is a ]. It is ], but only the R-enantiomer is biochemically significant. The lipoic acid/dihydrolipoic acid pair participate in a variety of biochemical transformations. |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|