Revision as of 12:31, 1 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 16:51, 11 September 2024 edit undoCitation bot (talk | contribs)Bots5,460,005 edits Added title. Changed bare reference to CS1/2. | Use this bot. Report bugs. | Suggested by Abductive | Category:E-number additives | #UCB_Category 207/313 |
(55 intermediate revisions by 35 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| ImageFile = Disodium citrate.png |
|
|
|
| Watchedfields = changed |
|
| IUPACName = disodium hydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
|
⚫ |
| ImageFile = Disodium citrate.png |
⚫ |
| OtherNames = Citrato ácido de sódio |
|
|
|
| ImageSize = 220px |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| verifiedrevid = 445304286 |
⚫ |
| ChemSpiderID = 10701794 |
|
|
|
| IUPACName = Disodium 3-carboxy-3-hydroxypentanedioate<ref>{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/8950#section=IUPAC-Name&fullscreen=true | title=Disodium citrate }}</ref> |
⚫ |
| InChI = 1/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-3 |
|
|
⚫ |
| OtherNames = |
⚫ |
| InChIKey = CEYULKASIQJZGP-DFZHHIFOAJ |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
⚫ |
| SMILES = ..O=C()CC(O)(CC(=O))C()=O |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| StdInChI = 1S/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-3 |
|
|
|
| PubChem = 8950 |
|
| StdInChIKey = CEYULKASIQJZGP-UHFFFAOYSA-K |
|
|
⚫ |
| ChemSpiderID = 8606 |
|
|
| EINECS = 205-623-3 |
|
|
| RTECS = GE7580000 |
|
⚫ |
| InChI = 1S/C6H8O7.2Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2 |
|
⚫ |
| InChIKey = CEYULKASIQJZGP-UHFFFAOYSA-L |
|
⚫ |
| SMILES = C(C(=O))C(CC(=O))(C(=O)O)O.. |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 144-33-2 |
|
| CASNo = 144-33-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 6FO62KCQ7A |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C = 6 | H = 6 | O = 7 | Na = 2 |
|
| C = 6 | H = 6 | O = 7 | Na = 2 |
|
|
| Appearance = white crystalline powder |
|
|
| MeltingPtC = 149 |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| NFPA-H = 0 |
|
|
| NFPA-F = 1 |
|
|
| NFPA-R = 0 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Disodium citrate''', also known as disodium hydrogen citrate, (Neo-Alkacitron) and sesquihydrate, is an ] of ] with the chemical formula {{chem2|Na2C6H6O7}}.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> It is used as an ] in food and to improve the effects of other antioxidants. It is also used as an ] and ]. Typical products include ], jam, sweets, ], ], ], ], and ]s. |
|
'''Disodium citrate''', or disodium hydrogen citrate, is a ] ] of ] (]) with the chemical formula Na<sub>2</sub>HC<sub>6</sub>H<sub>5</sub>O<sub>7</sub>, or |
|
|
Na<sub>2</sub>H(C<sub>3</sub>H<sub>5</sub>O(COO)<sub>3</sub>). It is used as an ] in food as well as to improve the effects of other antioxidants. It is also used as an ] and ]. |
|
|
|
|
|
|
|
== Uses == |
|
Typical products include ], jam, sweets, ], ], ], ], and ]s. |
|
|
|
|
|
|
==References== |
|
=== Food === |
|
|
It is used as an ] in food and to improve the effects of other antioxidants.<ref name="drugsupdate">{{cite web | url = http://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | title = Alkarate from Macleods: Disodium Hydrogen Citrate | publisher = drugsupdate.com | access-date = 2013-04-20 | archive-date = 2020-07-25 | archive-url = https://web.archive.org/web/20200725080700/https://www.drugsupdate.com/brand/generic/Disodium%20Hydrogen%20Citrate/36902 | url-status = dead }}</ref> It is also used as an ] and ].<ref name="drugsupdate" /> Typical products include ], jam, sweets, ], ], ], ], and ]s. Disodium citrate can also be used as a thickening agent or stabilizer.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-08-30 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
{{Unreferenced|date=November 2006}} |
|
|
|
|
|
|
|
=== Manufacturing === |
⚫ |
{{DEFAULTSORT:Disodium Citrate}} |
|
|
|
Disodium citrate can also be used as an ingredient in household products that remove stains.<ref>{{Cite web |last=PubChem |title=Disodium citrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/8950 |access-date=2022-09-19 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
⚫ |
] |
|
|
|
|
|
|
|
=== Health === |
|
|
Disodium citrate may be used in patients to alleviate discomfort from urinary-tract infections.<ref>{{cite web | url = https://glowpink.com/blog/cital-syrup/ | title = OTC Treatment | access-date = 2016-04-19 | archive-date = 2018-07-28 | archive-url = https://web.archive.org/web/20180728002859/https://glowpink.com/blog/cital-syrup/ | url-status = dead }}</ref><ref>{{Cite web |title=Disodium Hydrogen Citrate Syrup |url=https://labeling.pfizer.com/ShowLabeling.aspx?id=14817 |access-date=2022-09-26 |website=labeling.pfizer.com}}</ref> |
|
|
|
|
|
|
==References== |
|
] |
|
|
⚫ |
{{reflist}}{{DEFAULTSORT:Disodium Citrate}} |
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |