Revision as of 05:37, 12 July 2011 edit84.248.114.220 (talk)No edit summary← Previous edit |
Latest revision as of 17:46, 11 September 2024 edit undoCitation bot (talk | contribs)Bots5,458,832 edits Altered title. | Use this bot. Report bugs. | Suggested by Abductive | Category:E-number additives | #UCB_Category 281/313 |
(61 intermediate revisions by 46 users not shown) |
Line 1: |
Line 1: |
|
{{Refimprove|date=February 2010}} |
|
{{Refimprove|date=February 2010}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 408696936 |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile=disodium guanylate.png |
|
|
⚫ |
| verifiedrevid = 439036940 |
⚫ |
|ImageSize=180px |
|
|
⚫ |
| ImageFile=disodium guanylate.png |
⚫ |
|IUPACName=disodium methyl phosphate {{Citation needed|date=April 2010}} |
|
|
⚫ |
| ImageSize=220px |
⚫ |
|OtherNames=sodium 5'-guanylate<br>disodium 5'-guanylate |
|
|
|
| ImageAlt=Skeletal formula of disodium guanylate |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1=Disodium guanylate 3D ball.png |
⚫ |
| CASNo=5550-12-9 |
|
|
|
| ImageSize1=240 |
|
| CASNo_Comment = {{Citation needed|date=April 2010}} |
|
|
|
| ImageAlt1 = Ball-and-stick model of the component ions of disodium guanylate |
⚫ |
| PubChem=21712 |
|
|
|
| IUPACName = Disodium 5′-guanylate |
⚫ |
| SMILES=C1=NC2=C(N1C3C(C(C(O3)COP(=O)())O)O)NC(=NC2=O)N.. |
|
|
⚫ |
| SystematicName = Disodium methyl phosphate |
|
⚫ |
| OtherNames = {{Unbulleted list|Sodium 5'-guanylate}} |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}}<ref>{{cite web |url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?sid=164216535&loc=es_rss |title=SID 164216535 - PubChem |website=pubchem.ncbi.nlm.nih.gov}}</ref> |
|
⚫ |
| CASNo=5550-12-9 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 20407 |
|
⚫ |
| PubChem=21712 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 132932 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = B768T44Q8V |
|
⚫ |
| SMILES=C1=NC2=C(N1C3C(C(C(O3)COP(=O)())O)O)NC(=NC2=O)N.. |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=10|H=12|N=5|Na=2|O=8|P=1 |
|
| C=10 | H=12 | N=5 | Na=2 | O=8 | P=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Disodium guanylate''', also known as '''sodium 5'-guanylate''' and '''disodium 5'-guanylate''', is a natural di] ] of the ] ] (GMP). Disodium guanylate is a ] with the ] E627.<ref name=fin></ref> It is commonly used in conjunction with ] (], MSG). |
|
'''Disodium guanylate''', also known as '''sodium 5'-guanylate''' and '''disodium 5'-guanylate''', is a natural ] ] of the ] nucleotide ] (GMP). Disodium guanylate is a ] with the ] E627.<ref name=fin></ref> It is commonly used in conjunction with ]. |
|
|
|
|
|
As it is a fairly expensive additive, it is not used independently of glutamic acid; if disodium guanylate is present in a list of ingredients but MSG does not appear to be, it is likely that glutamic acid is provided as part of another ingredient such as a processed ] ]. It is often added to foods in conjunction with ]; the combination is known as ]. |
|
As it is a fairly expensive additive, it is usually not used independently of ]; if disodium guanylate is present in a list of ingredients but MSG does not appear to be, it is likely that glutamic acid is provided as part of another ingredient such as a processed ] ]. It is often added to foods in conjunction with ]; the combination is known as ]. |
|
|
|
|
|
Disodium guanylate is produced from dried fish or dried seaweed and is often added to ], ] and other ]s, savoury ], tinned ], cured ]s, and packaged ]. |
|
Disodium guanylate is produced by fermentation.<ref>{{cite journal |last1=Conn |first1=Helen |title="Umami": The Fifth Basic Taste |journal=Nutrition & Food Science |date=1 February 1992 |volume=92 |issue=2 |pages=21–23 |doi=10.1108/EUM0000000000953}}</ref><ref>{{cite journal |last1=Kinoshita |first1=Kazumoto |last2=Shiro |first2=Teruo |last3=Yamazaki |first3=Akihiro |last4=Kumashiro |first4=Izumi |last5=Takenishi |first5=Tadao |last6=Tsunoda |first6=Toshinao |title=Industrial production of disodium 5?-guanylate |journal=Biotechnology and Bioengineering |date=July 1967 |volume=9 |issue=3 |pages=329–342 |doi=10.1002/bit.260090306|s2cid=84216811 }}</ref> It is often added to ], ]s and other ]s, savory ], tinned ], cured ]s, and packaged ]. |
|
|
|
|
==Nutritional Information== |
|
|
|
|
|
Disodium guanylate is not safe for babies under twelve weeks, and should generally be avoided by asthmatics and people with gout, as guanylates are metabolized to ]. However, the typical amounts found in food are generally too low to produce significant side effects.<ref name=fin/> Since it is often produced from fish,<ref name=fin/> ]s and ]s may wish to avoid it unless the product is specifically labeled as vegan or vegetarian. Such labels require the use of non-animal derived sources, such as seaweed or yeast. |
|
|
|
|
|
|
==See also== |
|
==See also== |
|
|
{{Columns-list|colwidth=16em| |
|
* ] |
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
}} |
|
|
|
|
|
==References== |
|
==References== |
Line 46: |
Line 69: |
|
|
|
|
|
{{DEFAULTSORT:Disodium Guanylate}} |
|
{{DEFAULTSORT:Disodium Guanylate}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|