Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 02:45, 26 May 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:Divinylbenzène← Previous edit		Latest revision as of 02:27, 10 January 2025 edit undoKappa winter 9 (talk | contribs)4 edits UN number according to CINS report and M.V. "MSC Flaminia " accident.Tag: Visual edit
(44 intermediate revisions by 30 users not shown)
Line 1:		Line 1:
			{{short description|1=Organic compound, C₆H₄(CH=CH₂)₂}}
	{{chembox		{{chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 299525301
			| Watchedfields = changed
⚫	| Name = Divinylbenzene
		⚫	| verifiedrevid = 430950526
	| ImageFile = DVB.png
		⚫	| Name = Divinylbenzene
	| ImageSize = 200px
			| ImageFile = Divinylbenzene (structural diagram).png
	| ImageName = Skeletal formulae of both isomers		| ImageName = Skeletal formulae of both isomers
⚫	| ImageFileL1 = M-Divinylbenzene-3D-balls.png
			| ImageSize = 220px
	| ImageSizeL1 = 105
		⚫	| ImageFileL1 = M-Divinylbenzene-3D-balls.png
	| ImageNameL1 = Ball-and-stick model of m-Divinylbenzene		| ImageNameL1 = Ball-and-stick model of m-Divinylbenzene
	| ImageFileR1 = P-Divinylbenzene-3D-balls.png		| ImageFileR1 = P-Divinylbenzene-3D-balls.png
	| ImageSizeR1 = 120
	| ImageNameR1 = Ball-and-stick model of p-Divinylbenzene		| ImageNameR1 = Ball-and-stick model of p-Divinylbenzene
			| OtherNames = Diethylene benzene, DVB, Vinylstyrene
	| Section1 = {{Chembox Identifiers		| Section1 = {{Chembox Identifiers
			| index2_label = ''m''-
			| index3_label = ''p''-
			| CASNo_Ref = {{cascite|correct|CAS}}
	| CASNo = 1321-74-0		| CASNo = 1321-74-0
			| CASNo2_Ref = {{cascite|correct|CAS}}
⚫	| EINECS = 215-325-5
			| CASNo2 = 108-57-6
			| CASNo3_Ref = {{cascite|correct|CAS}}
			| CASNo3 = 105-06-6
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID = 60033
			| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID2 = 7653
			| ChemSpiderID3_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID3 = 59432
			| PubChem = 66666
			| PubChem2 = 7941
			| PubChem3 = 66041
			| EC_number2 = 203-595-7
			| RTECS2 = CZ9450000
			| UNII2 = 4S46QL2WFU
			| UNII2_Ref = {{fdacite|correct|FDA}}
		⚫	| EC_number = 215-325-5
			| RTECS = CZ9370000
			| UNNumber = 3532 3534
			| UNII = IZ715T4SBU
			| UNII_Ref = {{fdacite|correct|FDA}}
			| EC_number3 = 203-266-8
			| UNII3 = QN8RGZ4ML2
			| UNII3_Ref = {{fdacite|correct|FDA}}
			| SMILES = C=CC1=CC=CC=C1C=C
			| SMILES2 = C=CC1=CC(=CC=C1)C=C
			| InChI3=1S/C10H10/c1-3-9-5-7-10(4-2)8-6-9/h3-8H,1-2H2
			| InChIKey3 = WEERVPDNCOGWJF-UHFFFAOYSA-N
			| SMILES3 = C=CC1=CC=C(C=C1)C=C
	}}		}}
	| Section2 = {{Chembox Properties		| Section2 = {{Chembox Properties
	| C=10 | H=10		| C =10 | H=10
	| MeltingPt = -66.9 to -52°C		| MeltingPtC = -66.9 to -52
	| BoilingPt = 195°C		| BoilingPtC = 195
	| Solvent = other solvents		| Solvent = other solvents
	| Solubility = Insoluble		| Solubility = 0.005% (20°C)<ref name=PGCH/>
	| SolubleOther = Insoluble in ]<br /> Soluble in ] and ]		| SolubleOther = Soluble in ] and ]
			| Appearance = pale, straw-colored liquid<ref name=PGCH/>
			| VaporPressure = 0.7 mmHg (20°C)<ref name=PGCH/>
		⚫	| Density = 0.914 g/mL
	}}		}}
	| Section7 = {{Chembox Hazards		| Section7 = {{Chembox Hazards
	| FlashPt = 76°C		| FlashPtC = 76
			| PEL = none<ref name=PGCH>{{PGCH|0248}}</ref>
			| ExploLimits = 1.1%-6.2%<ref name=PGCH/>
			| REL = TWA 10 ppm (50 mg/m<sup>3</sup>)<ref name=PGCH/>
			| IDLH = N.D.<ref name=PGCH/>
	}}		}}
	}}		}}
	'''Divinylbenzene (DVB)''' consists of a ] ring ] to two ] groups. It is related to ] (vinylbenzene) by the addition of a second vinyl group.<ref name=crc>] 65Th Ed.</ref> Divinylbenzene, as it is usually encountered, is a 2:1 mixture of m- and p-divinylbenzene, containing also the corresponding ethylvinylbenzene isomers. It is manufactured by the thermal ] of isomeric diethylbenzenes. Under synthesis conditions, o-divinylbenzene converts to ] and thus is not a component of the usual mixtures of DVB.<ref name=Ullmann>Denis H. James William M. Castor, “Styrene” in Ullmann’s Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2005.</ref>		'''Divinylbenzene''' ('''DVB''') is an ] with the ] {{chem2|C6H4(CH\dCH2)2}} and ] {{chem2|H2C\dCH\sC6H4\sHC\dCH2}} (a ] ring with two ]s as ]). It is related to ] (vinylbenzene, {{chem2|C6H5\sCH\dCH2}}) by the addition of a second vinyl group.<ref name=crc>] 65Th Ed.</ref> It is a colorless liquid manufactured by the thermal ] of isomeric diethylbenzenes. Under synthesis conditions, ''o''-divinylbenzene converts to ] and thus is not a component of the usual mixtures of DVB.<ref name=Ullmann>{{Cite book|title=Denis H. James William M. Castor, "Styrene" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2005.|doi=10.1002/14356007.a25_329.pub2}}</ref>
			==Production and use==
	==Applications==
			It is produced by dehydrogenation of ]:
⚫	When reacted together with styrene, divinylbenzene can be used as a reactive ] in ]s. Styrene and divinylbenzene react together to form the ] styrene-divinylbenzene, S-DVB or Sty-DVB. The resulting ]ed polymer is mainly used for the production of ].<ref name=Ullmann/>
			: C<sub>6</sub>H<sub>4</sub>(C<sub>2</sub>H<sub>5</sub>)<sub>2</sub> → C<sub>6</sub>H<sub>4</sub>(C<sub>2</sub>H<sub>3</sub>)<sub>2</sub> + 2 H<sub>2</sub>
			Divinylbenzene is usually encountered as a 2:1 mixture of ''m''- and ''p''-divinylbenzene, containing also the corresponding isomers of ethylvinylbenzene.
		⚫	Styrene and divinylbenzene react to form the ] styrene-divinylbenzene, S-DVB or Sty-DVB. The resulting ]ed polymer is mainly used for the production of ] and ]s for peptide synthesis.<ref name=Ullmann/>
⚫	Density is 0.914 g/mL
	==Nomenclature==		==Nomenclature==
		⚫	* ]: variously known as 1,2-diethenylbenzene, 1,2-divinylbenzene, ''o''-vinylstyrene, ''o''-divinylbenzene
	''See also'': ]''
		⚫	* ]: known as 1,3-diethenylbenzene, 1,3-divinylbenzene, ''m''-vinylstyrene, ''m''-divinylbenzene
	Divinylbenzene can exist in the form of 3 structural ]s that differ with respect to the positioning of the vinyl groups.
	* ''Ortho'': variously known as 1,2-diethenylbenzene, 1,2-divinylbenzene, ''o''-vinylstyrene, ''o''-divinylbenzene		* ]: known as 1,4-diethenylbenzene, 1,4-divinylbenzene, ''p''-vinylstyrene, ''p''-divinylbenzene.
		⚫	These compounds are ] called diethenylbenzene, although this nomenclature is rarely encountered.
⚫	* ''Meta'': known as 1,3-diethenylbenzene, 1,3-divinylbenzene, ''m''-vinylstyrene, ''m''-divinylbenzene
⚫	* ''Para'': known as 1,4-diethenylbenzene, 1,4-divinylbenzene, ''p''-vinylstyrene, ''p''-divinylbenzene.
⚫	These compounds are ] called as diethenylbenzene, although this nomenclature is rarely encountered.
	==References==		==References==
	<references/>		<references/>
			{{Hydrocarbons}}
⚫	]
			]
	]		]
			]
		⚫	]
	]
	]
	]