Revision as of 05:41, 2 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 01:53, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
(29 intermediate revisions by 23 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447992218 |
|
| Verifiedfields = changed |
|
|
⚫ |
| IUPAC_name = Ethyl 1--4-phenylpiperidine-4-carboxylate |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 399926227 |
|
⚫ |
| IUPAC_name = ethyl 1--4-phenylpiperidine-4-carboxylate |
|
|
| image = Etoxeridine.svg |
|
| image = Etoxeridine.svg |
|
|
| image_class = skin-invert-image |
|
| width = 160 |
|
| width = 160 |
|
|
|
|
Line 12: |
Line 12: |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = S9 |
|
|
| legal_BR = A1 |
⚫ |
| legal_CA = <!-- Schedule I --> |
|
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|
⚫ |
| legal_CA = Schedule I |
|
| legal_UK = Class A |
|
| legal_UK = Class A |
|
| legal_US = Schedule I |
|
| legal_US = Schedule I |
|
| legal_status = |
|
| legal_DE = Anlage I |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
Line 23: |
Line 25: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 469-82-9 |
|
| CAS_number = 469-82-9 |
|
|
| ChEMBL = 2104254 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 61122 |
|
| PubChem = 61122 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01505 |
|
| DrugBank = DB01505 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 55070 |
|
| ChemSpiderID = 55070 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = RHW35E1G7E |
|
| UNII = RHW35E1G7E |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D12680 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=18 | H=27 | N=1 | O=4 |
|
| C=18 | H=27 | N=1 | O=4 |
|
| molecular_weight = 321.41 g/mol |
|
|
| smiles = C1(CCN(CC1)CCOCCO)(C(=O)OCC)C2=CC=CC=C2 |
|
| smiles = C1(CCN(CC1)CCOCCO)(C(=O)OCC)C2=CC=CC=C2 |
|
| InChI = 1/C18H27NO4/c1-2-23-17(21)18(16-6-4-3-5-7-16)8-10-19(11-9-18)12-14-22-15-13-20/h3-7,20H,2,8-15H2,1H3 |
|
|
| InChIKey = KJTKYGFGPQSRRA-UHFFFAOYAV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H27NO4/c1-2-23-17(21)18(16-6-4-3-5-7-16)8-10-19(11-9-18)12-14-22-15-13-20/h3-7,20H,2,8-15H2,1H3 |
|
| StdInChI = 1S/C18H27NO4/c1-2-23-17(21)18(16-6-4-3-5-7-16)8-10-19(11-9-18)12-14-22-15-13-20/h3-7,20H,2,8-15H2,1H3 |
Line 50: |
Line 53: |
|
}} |
|
}} |
|
|
|
|
|
'''Etoxeridine''' ('''Carbetidine''', '''Atenos''') is a 4-]] derivative that is related to the ] ] drug ] (meperidine). |
|
'''Etoxeridine''' ('''Carbetidine''', '''Atenos''') is a 4-]] derivative that is related to the clinically used ] ] drug ] (meperidine). |
|
|
|
⚫ |
Etoxeridine was developed in the 1950s and investigated for use in surgical ], however it was never commercialised and is not currently used in medicine.<ref>Merlevede E, Levis S. Pharmacological study of carbetidine, a new synthetic analgesic. (French). ''Archives Internationales de Pharmacodynamie et de Therapie''. 1958 May 1;115(1-2):213-32.</ref><ref>Sironi PG. Brief note on a new synthetic analgesic: carbetidine hydrochloride. (Italian). ''Minerva Anestesiologica''. 1959 Jun;25(6):251-4.</ref><ref>Crawford JS, Foldes FF. Studies on the respiratory and circulatory effects of carbetidine HCI used for supplementation of thiopentone sodium-nitrous oxide-oxygen anaesthesia. ''British Journal of Anaesthesia''. 1959 Aug;31:348-51.</ref> |
|
|
|
|
|
|
⚫ |
Etoxeridine was developed in the 1950s<ref>{{cite patent | country = BE | number = 558883}}</ref> and investigated for use in surgical ], however it was never commercialized and is not currently used in medicine.<ref>{{Cite journal | vauthors = Merlevede E, Levis S | title = Pharmacological study of carbetidine, a new synthetic analgesic | language = French | journal = Archives Internationales de Pharmacodynamie et de Thérapie | date = 1958 | volume = 115 | issue = 1–2 | pages = 213–232| pmid = 13545901 }}</ref><ref>{{Cite journal | author = Sironi PG | title = Brief note on a new synthetic analgesic: carbetidine hydrochloride | language = Italian | journal = Minerva Anestesiologica | date = 1959 | volume = 25 | issue = 6 | pages = 251–254 | pmid = 13674097 }}</ref><ref>{{cite journal | vauthors = Crawford JS, Foldes FF | title = Studies on the respiratory and circulatory effects of carbetidine HCI used for supplementation of thiopentone sodium-nitrous oxide-oxygen anaesthesia | journal = British Journal of Anaesthesia | volume = 31 | issue = 8 | pages = 348–51 | date = August 1959 | pmid = 13812715 | doi = 10.1093/bja/31.8.348 | doi-access = free }}</ref> As with other opioids which were not in clinical use during the drafting of the ], it is categorized as a Schedule I narcotic. |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{Reflist|2}} |
|
<references/> |
|
|
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |
|
{{analgesic-stub}} |
|
|
|
|
] |
|