| Revision as of 19:22, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_← Previous edit |
Latest revision as of 20:01, 16 December 2023 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,985 edits auto mw |
| (29 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Stimulant appetite suppressant drug}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443959267 |
|
| verifiedrevid = 449582436 |
|
| IUPAC_name = (''RS'')-2-methoxy-''N''-methyl-2-ethanamine |
|
| IUPAC_name = (''RS'')-2-methoxy-''N''-methyl-2-ethanamine |
|
| image = Fludorex.png |
|
| image = Fludorex Structure.svg |
|
| width = 200 |
|
| width = |
|
|
| alt = Skeletal formula of fludorex |
|
|
| image2 = Fludorex 3D spacefill.png |
|
|
| alt2 = Space-filling model of the fludorex molecule |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 15221-81-5 |
|
| CAS_number = 15221-81-5 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 18: |
Line 24: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D04205 |
|
| KEGG = D04205 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 25259 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=14 | F=3 | N=1 | O=1 |
|
| C=11 | H=14 | F=3 | N=1 | O=1 |
|
| molecular_weight = 233.230 |
|
|
| smiles = CNCC(C1=CC(=CC=C1)C(F)(F)F)OC |
|
| smiles = CNCC(C1=CC(=CC=C1)C(F)(F)F)OC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C11H14F3NO/c1-15-7-10(16-2)8-4-3-5-9(6-8)11(12,13)14/h3-6,10,15H,7H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CXLOIJUDIPVKOU-UHFFFAOYSA-N |
|
| synonyms = |
|
| synonyms = |
|
}} |
|
}} |
|
|
|
|
|
'''Fludorex''' is a ] ] of the ] ]. |
|
'''Fludorex''' is a ] anorexic agent of the ] ].<ref name="pmid576809">{{cite journal | vauthors = Beregi SL, Duhault J | title = Structure-anorectic activity relationships in substituted phenethylamines | journal = Arzneimittel-Forschung | volume = 27 | issue = 1 | pages = 116–8 | date = 1977 | pmid = 576809 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
{{Unreferenced|date=November 2009}} |
|
|
|
|
|
|
|
|
|
{{Stimulants}} |
|
{{Stimulants}} |
|
|
{{Monoamine releasing agents}} |
|
{{Adrenergics}} |
|
|
{{Dopaminergics}} |
|
|
{{Phenethylamines}} |
|
{{Phenethylamines}} |
|
|
|
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|