| Revision as of 18:18, 2 August 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits chembox data← Previous edit |
Latest revision as of 22:11, 3 February 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Chlorobenzenes to Chlorobenzene derivatives |
| (30 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 442713318 |
|
| ImageFile = Gamendazole.svg |
|
| ImageFile = Gamendazole.svg |
|
|
| ImageFile2 = Gamendazole ball-and-stick model.png |
|
| ImageSize = 200px |
|
|
| ImageAlt = |
|
| ImageSize = 200px |
|
|
| ImageAlt = |
|
| IUPACName = (''E'')-3--6-(trifluoromethyl)indazol-3-yl]prop-2-enoic acid<ref name=NextBio>{{cite web|title=Gamendazole|url=http://www.nextbio.com/b/search/ov/trans-3-(1-benzyl-6-(trifluoromethyl)-1H-indazol-3-yl)acrylic%20acid|work=NextBio|publisher=www.nextbio.com|accessdate=31 July 2011}}</ref> |
|
|
|
| PIN = (2''E'')-3-<nowiki/>{1--6-(trifluoromethyl)-1''H''-indazol-3-yl}prop-2-enoic acid |
|
| OtherNames = ''trans''-3-(1-Benzyl-6-(trifluoromethyl)-1''H''-indazol-3-yl)acrylic acid) |
|
| OtherNames = ''trans''-3-(1-Benzyl-6-(trifluoromethyl)-1''H''-indazol-3-yl)acrylic acid) |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| CASNo = 877773-32-5 |
|
|
|
| CASNo = 877766-45-5 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| PubChem = 11212172 |
|
|
⚫ |
| CASNo1 = 877773-32-5 |
|
| SMILES = ClC(C=C(Cl)C=C1)=C1CN2C3=CC(C(F)(F)F)=CC=C3C(/C=C/C(O)=O)=N2}} |
|
|
|
| CASNo1_Comment = (non-specific) |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| C=18|H=11|Cl=2|F=3|N=2|O=2 |
|
|
|
| UNII = X75Z3RSN5M |
| ⚫ |
| Appearance = |
|
|
⚫ |
| PubChem = 11212172 |
| ⚫ |
| Density = |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| MeltingPt = |
|
|
|
| ChEBI = 90703 |
| ⚫ |
| BoilingPt = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| Solubility = }} |
|
|
|
| ChemSpiderID = 9387234 |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| SMILES = FC(F)(F)c1ccc2c(c1)n(nc2\C=C\C(=O)O)Cc3ccc(Cl)cc3Cl |
| ⚫ |
| MainHazards = |
|
|
|
| InChI = 1/C18H11Cl2F3N2O2/c19-12-3-1-10(14(20)8-12)9-25-16-7-11(18(21,22)23)2-4-13(16)15(24-25)5-6-17(26)27/h1-8H,9H2,(H,26,27)/b6-5+ |
| ⚫ |
| FlashPt = |
|
|
|
| InChIKey = KYYQMVUKYQCSQY-AATRIKPKBM |
|
| Autoignition = }} |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H11Cl2F3N2O2/c19-12-3-1-10(14(20)8-12)9-25-16-7-11(18(21,22)23)2-4-13(16)15(24-25)5-6-17(26)27/h1-8H,9H2,(H,26,27)/b6-5+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KYYQMVUKYQCSQY-AATRIKPKSA-N}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=18 | H=11 | Cl=2 | F=3 | N=2 | O=2 |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = }} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Gamendazole''' is a drug candidate for ]. It is an ] ] derived from ] (LND). It has been shown to reduce fertility in male rats without affecting testosterone levels, but human clinical trials have not been started.<ref>{{cite web | url = https://pipeline.ctiexchange.org/products/h2-gamendazole | title = H2-Gamendazole | work = Calliope: The Contraceptive Pipeline Database | quote = Project Phase: Early Development, Project Stage: Pre-clinical }}</ref> |
| ⚫ |
'''Gamendazole''' is a novel drug candidate for ]. It is a ] ] derived from ] (LND). Gamendazole produced 100% antispermatogenic effects at 25 mg/kg ] in rats, whereas 200 mg/kg was fatal for 60% of rats tested. Since gamendazole produced 100% efficacy, it was tested orally. At a dose of 6 mg/kg, 100% of rats were ] 4 weeks after a single administration. Complete infertility was maintained for 2 weeks, followed by complete recovery in 4 of 7 rats. The other 3 never recovered fertility. Upon dosing 6 mg/kg orally for 7 days, it produced similar infertility results, but only 2 of 7 rats recovered fertility. There were no abnormalities in rates of ] or abnormal conception in rats who recovered fertility.<ref name=Tash>{{cite journal|last=Tash|first=Joseph|title=A Novel Potent Indazole Carboxylic Acid Derivative Blocks Spermatogenesis and Is Contraceptive in Rats after a Single Oral Dose|journal=Biology of Reproduction|year=2008|month=July|volume=78|issue=6|pages=1127-1138|doi=10.1095/biolreprod.106.057810|pmid=18218612|accessdate=31 July 2011}}</ref> |
|
|
|
|
|
|
|
==Rat studies== |
| ⚫ |
] reports were conducted on gamendazole treated rats. At 25 mg/kg i.p., 6 mg/kg oral, and in animals that survived 200 mg/kg i.p., there were no remarkable findings, with no evidence of ], ], ], or ]. There was also a lack of observable behavioral effects at 25 mg/kg i.p., 6 mg/kg oral, and in animals that survived 200 mg/kg i.p. Gamendazole treatment had no effect on ] levels, and was reported to affect ] function, leading to decreased levels of ]. Low levels of inhibin B were correlated to the infertility of the rat. <ref name=Tash></ref> |
|
|
⚫ |
Gamendazole produced 100% antispermatogenic effects at 25 mg/kg ] in rats, whereas 200 mg/kg was fatal for 60% of rats tested. Since gamendazole produced 100% efficacy, it was tested orally. At a dose of 6 mg/kg, 100% of rats were ] 4 weeks after a single administration. Complete infertility was maintained for 2 weeks, followed by complete recovery in 4 of 7 rats. The other 3 never recovered fertility. Upon dosing 6 mg/kg orally for 7 days, it produced similar infertility results, but only 2 of 7 rats recovered fertility. There were no abnormalities in rates of ] or abnormal conception in rats who recovered fertility.<ref name=Tash>{{cite journal|last=Tash|first=Joseph|title=A Novel Potent Indazole Carboxylic Acid Derivative Blocks Spermatogenesis and Is Contraceptive in Rats after a Single Oral Dose|journal=Biology of Reproduction|date=July 2008|volume=78|issue=6|pages=1127–1138|doi=10.1095/biolreprod.106.057810|pmid=18218612|doi-access=}}<!--|accessdate=31 July 2011--></ref> |
|
|
|
|
⚫ |
] reports were conducted on gamendazole treated rats. At 25 mg/kg i.p., 6 mg/kg oral, and in animals that survived 200 mg/kg i.p., there were no remarkable findings, with no evidence of ], ], ]s, or ]. There was also a lack of observable behavioral effects at 25 mg/kg i.p., 6 mg/kg oral, and in animals that survived 200 mg/kg i.p. Gamendazole treatment had no effect on ] levels, and was reported to affect ] function, leading to decreased levels of ]. Low levels of inhibin B were correlated to the infertility of the rat.<ref name=Tash /> |
|
|
|
|
|
==References== |
|
==References== |
| Line 34: |
Line 56: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |