Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Gyrophoric acid: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:51, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 449554015 of page Gyrophoric_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').  Latest revision as of 07:57, 20 January 2025 edit Graeme Bartlett (talk | contribs)Administrators250,168 edits removed Category:Polyphenols; added Category:Depsides using HotCat 
Line 1: Line 1:
{{Chembox
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
| Verifiedfields = changed
{{chembox
| Watchedfields = changed
| verifiedrevid = 439364730 | verifiedrevid = 461765717
| Name = Gyrophoric acid | Name = Gyrophoric acid
| ImageFile = Gyrophoric acid.PNG | ImageFile = Gyrophoric acid h.svg
| ImageSize = 200px | ImageSize = 250px
| ImageName = Chemical structure of gyrophoric acid | ImageName = Chemical structure of gyrophoric acid
| ImageAlt = Chemical structure of gyrophoric acid | ImageAlt = Chemical structure of gyrophoric acid
| IUPACName = 4-oxy-2-hydroxy-6-methylbenzoic acid | PIN = 4-({4--2-hydroxy-6-methylbenzoyl}oxy)-2-hydroxy-6-methylbenzoic acid
| OtherNames = <!-- <br> --> | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 548-89-0 --> | CASNo = 548-89-0
| CASNo_Ref = | CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BAQ44A6C6H
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 470648 | ChEMBL = 470648
| PubChem = 135728 | PubChem = 135728
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL = 470648
| PubChem = 135728
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 119550 | ChemSpiderID = 119550
| SMILES = O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C | SMILES = O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30) | StdInChI = 1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ATQPZSQVWCPVGV-UHFFFAOYSA-N | StdInChIKey = ATQPZSQVWCPVGV-UHFFFAOYSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>24</sub>H<sub>20</sub>O<sub>10</sub> | C=24|H=20|O=10
| MolarMass = 468.40 g/mol
| ExactMass = 468.105647 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
⚫ }}
}} }}

⚫ }}
'''Gyrophoric acid''' is a ] that can be found in the lichen '']'' and in '']''.<ref>{{Cite journal | title = Antimicrobial activity of extracts of the lichen Xanthoparmelia pokomyi and its gyrophoric and stenosporic acid constituents | author = Candan Mehmet, Yilmaz Meral, Tay Thrgay, Kivanc Merih and Türk Hayrettin | journal = Zeitschrift für Naturforschung C | date = 2006 | volume = 61 | issue = 5–6 | pages = 319–323 | doi = 10.1515/znc-2006-5-603 | pmid = 16869486 | s2cid = 22255609 | doi-access = free }} {{INIST|17912298}}</ref> It is a double ester of the ]. It can also be found in most of the species of the '']'', '']'', and '']'' ].<ref>{{Cite journal|last=Casselman|first=Karen Leigh|date=1994|title=Lichen Dyes: Preparation and Dyeing|url=https://www.jstor.org/stable/3858253|journal=Maine Naturalist|volume=2|issue=2|pages=105–110|doi=10.2307/3858253|jstor=3858253 |issn=1063-3626}}</ref>

== See also ==
* ]

== References ==
{{reflist}}

]
]
]
]

{{phenol-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Gyrophoric acid: Difference between pages Add topic