Revision as of 18:31, 28 August 2011 editPetit9621 (talk | contribs)102 edits →See also: removed 'list of cutaneous porphyrias' as heme arginate is utilized in the acute porphyrias. Added other more relevant items.← Previous edit |
Latest revision as of 11:42, 13 January 2025 edit undoGraeme Bartlett (talk | contribs)Administrators250,169 edits more ids |
(24 intermediate revisions by 17 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 406624430 |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile= |
|
|
⚫ |
| verifiedrevid = 447175740 |
⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile= |
⚫ |
|IUPACName= |
|
|
⚫ |
| ImageSize= |
⚫ |
|OtherNames= |
|
|
⚫ |
| IUPACName= |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
⚫ |
| CASNo=100438-92-4 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| PubChem=3086464 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| SMILES= |
|
|
⚫ |
| CASNo=100438-92-4 |
⚫ |
| MeSHName=Heme+arginate |
|
|
|
| DrugBank = DB17310 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = R1B526117P |
|
⚫ |
| PubChem=3086464 |
|
|
| StdInChI=1S/C34H34N4O4.C6H14N4O2.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;7-4(5(11)12)2-1-3-10-6(8)9;/h7-8,13-16,35-36H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42);4H,1-3,7H2,(H,11,12)(H4,8,9,10);/q;;+2/t;4-;/m.0./s1 |
|
|
| StdInChIKey = MGQITOFVXOEWNL-INZIHYEWSA-N |
|
|
| SMILES = CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C=C)C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C=C.C(C(C(=O)O)N)CN=C(N)N. |
|
⚫ |
| MeSHName=Heme+arginate |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>40</sub>H<sub>48</sub>FeN<sub>8</sub>O<sub>6</sub>+<sub>2</sub> |
|
| Formula=C<sub>40</sub>H<sub>48</sub>FeN<sub>8</sub>O<sub>6</sub><sup>+2</sup> |
|
| MolarMass=792.704 |
|
| MolarMass=792.704 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Heme arginate''' (or '''haem arginate''') is a compound of ] and ] used in the treatment of acute ].<ref>{{cite web|title=HAEM ARGINATE FOR THE ACUTE ATTACK OF PORPHYRIA|url=http://www.porphyria.uct.ac.za/professional/prof-haem-therapy.htm|publisher=Porphyria South Africa}}</ref><ref>{{cite web|title=Treatment of the Acute Attack|url=http://www.porphyria-europe.org/02-for-healthcare/treatment.asp|publisher=Eurpean Porphyria Network|accessdate=28 August 2011}}</ref> This heme product is only available outside the United States, where the equivalent is hematin.<ref>{{cite web|title=Panhematin for Acute Porphyria|url=http://www.porphyriafoundation.com/testing-and-treatment/medications-for-porphyria/panhematin|publisher=American Porphyria Foundation|accessdate=28 August 2011}}</ref> |
|
'''Heme arginate''' (or '''haem arginate''') is a compound of ] and ] used in the treatment of acute ].<ref>{{cite web|title=HAEM ARGINATE FOR THE ACUTE ATTACK OF PORPHYRIA |url=http://www.porphyria.uct.ac.za/professional/prof-haem-therapy.htm |publisher=Porphyria South Africa |url-status=dead |archiveurl=https://web.archive.org/web/20120305102736/http://www.porphyria.uct.ac.za/professional/prof-haem-therapy.htm |archivedate=2012-03-05 }}</ref><ref>{{cite web|title=Treatment of the Acute Attack |url=http://www.porphyria-europe.org/02-for-healthcare/treatment.asp |publisher=European Porphyria Network |accessdate=28 August 2011 |url-status=dead |archiveurl=https://web.archive.org/web/20111005002229/http://www.porphyria-europe.org/02-for-healthcare/treatment.asp |archivedate=5 October 2011 }}</ref> This heme product is only available outside the ] and is equivalent to hematin.<ref>{{cite web|title=Panhematin for Acute Porphyria|url=http://www.porphyriafoundation.com/content/panhematin-acute-porphyria|publisher=American Porphyria Foundation|access-date=8 July 2016|archive-date=12 March 2018|archive-url=https://web.archive.org/web/20180312084311/http://www.porphyriafoundation.com/content/panhematin-acute-porphyria|url-status=dead}}</ref> |
|
|
|
|
|
Heme arginate is a heme compound, whereby L-arginine is added to prevent rapid degradation. It is given intravenously, and its action of mechanism is to reduce the overproduction of δ-aminolevulinic acid, which can cause the acute symptoms in an attack of the acute porphyrias. <ref>{{cite journal|last=Volin|first=L|coauthors=V Rasi, E Vahtera and R Tenhunen|title=Heme arginate: effects on hemostasis|journal=Blood Journal|year=1988|volume=71|pages=625-628|url=http://bloodjournal.hematologylibrary.org/content/71/3/625.full.pdf|accessdate=28 August 2011}}</ref> |
|
Heme arginate is a heme compound, whereby ] is added to prevent rapid degradation. It is given intravenously, and its action of mechanism is to reduce the overproduction of ], which can cause the acute symptoms in an attack of the acute porphyrias.<ref>{{cite journal|last=Volin|first=L |author2=V Rasi |author3=E Vahtera |author4=R Tenhunen|title=Heme arginate: effects on hemostasis|journal=Blood|year=1988|volume=71|issue=3 |pages=625–628|doi=10.1182/blood.V71.3.625.625 |pmid=3345341 |url=http://bloodjournal.hematologylibrary.org/content/71/3/625.full.pdf|accessdate=28 August 2011|doi-access=free}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
Line 34: |
Line 42: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* www.drugs-porphyria.com |
|
|
* www.porphyria-europe.com |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |