Revision as of 11:10, 6 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|er← Previous edit |
Latest revision as of 14:02, 12 October 2024 edit undoJonRichfield (talk | contribs)Extended confirmed users8,040 edits Replaced citation demands with refsTag: 2017 wikitext editor |
(37 intermediate revisions by 25 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Unreferenced|date=August 2009}} |
|
|
|
{{Refimprove|date=November 2011}} |
|
|
|
|
|
{{drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 447812653 |
⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| IUPAC_name = 4-(dimethylamino)-2-isopropyl-2-phenylpentanenitrile |
⚫ |
| UNII = R4823W2PQL |
|
|
⚫ |
| image = isoaminile.png |
⚫ |
| verifiedrevid = 407441219 |
|
|
|
|
⚫ |
| IUPAC_name = 4-(dimethylamino)-2-isopropyl-2-phenylpentanenitrile |
|
|
|
<!--Clinical data--> |
⚫ |
| image = isoaminile.png |
|
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|isoaminile}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 77-51-0 |
|
⚫ |
| ATC_prefix = R05 |
|
⚫ |
| ATC_suffix = DB04 |
|
⚫ |
| PubChem = 6481 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB08944 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6236 |
|
| ChemSpiderID = 6236 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C16H24N2/c1-13(2)16(12-17,11-14(3)18(4)5)15-9-7-6-8-10-15/h6-10,13-14H,11H2,1-5H3 |
|
|
⚫ |
| UNII = R4823W2PQL |
|
| InChIKey = WFLSCFISQHLEED-UHFFFAOYAP |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D08088 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=24 | N=2 |
|
| smiles = N#CC(c1ccccc1)(C(C)C)CC(N(C)C)C |
|
| smiles = N#CC(c1ccccc1)(C(C)C)CC(N(C)C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
Line 17: |
Line 50: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WFLSCFISQHLEED-UHFFFAOYSA-N |
|
| StdInChIKey = WFLSCFISQHLEED-UHFFFAOYSA-N |
⚫ |
| CAS_number = 77-51-0 |
|
⚫ |
| ATC_prefix = R05 |
|
⚫ |
| ATC_suffix = DB04 |
|
⚫ |
| PubChem = 6481 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D08088 |
|
⚫ |
| C=16 | H=24 | N=2 |
|
|
| molecular_weight = 244.375 g/mol |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Isoaminile''' is an ] (cough suppressant) used under the trade-name '''Peracon'''.<ref name=R1>{{cite book | vauthors = Chappel CI, von Seeman C | veditors = Ellis GP, West GB | chapter = Antitussive Drugs | title = Progress in Medicinal Chemistry | year = 1963 | volume = 3 | publisher = Butterworth | isbn = 978-0-444-53322-7 | pages = 114–115 | doi = 10.1016/S0079-6468(08)70117-6 | pmid = 14146305 | chapter-url = https://books.google.com/books?id=PcyoOmjvGzkC&pg=PA114 | access-date = 2013-09-12 }}</ref> |
⚫ |
'''Isoaminile''' ('''Peracon''') is an ] structurally related to ]. ] effects have been noted from doses approximately 300 mg and above. The normal therapeutic dose is 40-80 mg of the cyclamate salt not to exceed five doses in a 24-hour period. In addition to central antitussive effects it is also an ], exhibiting both ] and ] actions. |
|
|
|
|
|
|
⚫ |
The normal therapeutic dose is 40–80 mg of the cyclamate salt, with a maximum of five doses in a 24-hour period.<ref name=R1/> In addition to its central antitussive effects, it is also an ], exhibiting both ] and ] actions.<ref name=R1/> |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
{{Cough and cold preparations}} |
|
{{Cough and cold preparations}} |
|
|
|
|
{{Hallucinogens}} |
|
|
] |
|
] |
⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
{{respiratory-system-drug-stub}} |
|
{{hallucinogen-stub}} |
|