| Revision as of 11:44, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 477025157 of page Isomaltose for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'ChEBI', 'StdInChI', 'StdInChIKey'). |
Latest revision as of 15:22, 17 June 2023 edit 2405:4803:ff65:8460:4058:8ffa:b3a5:86f9 (talk)No edit summaryTag: Visual edit |
| Line 1: |
Line 1: |
|
|
{{for multi|a disaccharide polyol derived from sucrose|isomalt|a disaccharide derived from sucrose|isomaltulose}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 461780479 |
|
| verifiedrevid = 477168646 |
|
⚫ |
| ImageFile = Isomaltose structure.svg |
|
| Watchefields = changed |
|
|
|
| ImageSize = |
| ⚫ |
| ImageFile = Isomaltose structure.svg |
|
|
| ImageSize = 200px |
|
| SystematicName = |
|
⚫ |
| OtherNames = ''O''-α-<small>D</small>-glucopyranosyl-α-α-<small>D</small>-glucopyranoside |
| ⚫ |
| PIName = Isomaltose |
|
|
| SystematicName = 6-''O''-α-<small>D</small>-Glucopyranosyl-<small>D</small>-glucopyranose |
|
| IUPACName = 6-''O''-α-<small>D</small>-Glucopyranosyl-<small>D</small>-glucopyranose |
|
⚫ |
| Section1 = {{Chembox Identifiers |
| ⚫ |
| OtherNames=''O''-α-<small>D</small>-glucopyranosyl-α-α-<small>D</small>-glucopyranoside |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| ChemSpiderID = 388333 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
⚫ |
| InChI = 1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
| ⚫ |
| ChemSpiderID = 4573711 |
|
|
⚫ |
| InChIKey = DLRVVLDZNNYCBX-RTPHMHGBBU |
| ⚫ |
| InChI = 1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| InChIKey = DLRVVLDZNNYCBX-RTPHMHGBBU |
|
|
⚫ |
| StdInChI = 1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| StdInChI = 1S/C12H22O11/c13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8+,9+,10-,11+,12-/m0/s1 |
|
|
⚫ |
| StdInChIKey = DLRVVLDZNNYCBX-RTPHMHGBSA-N |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
| StdInChIKey = AYRXSINWFIIFAE-YJOKQAJESA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 499-40-1 |
|
| CASNo = 499-40-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 439193 |
|
|
| MeSHName = Isomaltose |
|
| UNII = 67I334IX2M |
|
⚫ |
| PubChem = 439193 |
| ⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| MeSHName = Isomaltose |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 28189 |
|
| ChEBI = 28189 |
|
| SMILES = O(C1OC(O)(O)(O)1O)2O((O)(O)2O)CO |
|
| SMILES = O(C1OC(O)(O)(O)1O)2O((O)(O)2O)CO |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=12|H=22|O=11 |
|
| C=12 | H=22 | O=11 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Isomaltose''' is a ] similar to ], but with a α-(1-6)-linkage instead of the α-(1-4)-linkage. Both of the sugars are ]s of ], which is a ] sugar. Isomaltose is a ]. Isomaltose is produced when high maltose syrup is treated with the enzyme transglucosidase (TG) and is one of the major components in the mixture ]. |
|
|
|
|
|
It is a product of the ] of ]. <ref>{{Cite journal|doi =10.1111/j.1365-2621.1966.tb01905.x|title =The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose|year =1966|last1 =Sugisawa|first1 =Hirqshi|last2 =Edo|first2 =Hiroshi|journal =Journal of Food Science|volume =31|issue =4|pages =561}}</ref> |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscatinline}} |
|
|
|
|
|
{{Carbohydrates}} |
|
|
|
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |