| Revision as of 04:57, 2 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wiki← Previous edit |
Latest revision as of 23:13, 10 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| (28 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|NSAID anti-inflammatory medication}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 444870308 |
|
| verifiedrevid = 447986588 |
|
| IUPAC_name = 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione |
|
| IUPAC_name = 4-(3-oxobutyl)-1,2-di(phenyl)pyrazolidine-3,5-dione |
|
| image = kebuzone.png |
|
| image = Kebuzone.png |
|
|
| image_class = skin-invert-image |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = 70–100 hours |
|
| excretion = |
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 853-34-9 |
|
| CAS_number = 853-34-9 |
|
| ATC_prefix = M01 |
|
| ATC_prefix = M01 |
|
| ATC_suffix = AA06 |
|
| ATC_suffix = AA06 |
|
| PubChem = 3824 |
|
| PubChem = 3824 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
| ChemSpiderID = 3692 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB08940 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 4VD83UL6Y6 |
|
| UNII = 4VD83UL6Y6 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01567 |
|
| KEGG = D01567 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 31749 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=18 | N=2 | O=3 |
|
| C=19 | H=18 | N=2 | O=3 |
|
|
| smiles = CC(=O)CCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
|
| molecular_weight = 322.35782 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LGYTZKPVOAIUKX-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Kebuzone''' (or '''ketophenylbutazone''') is a ] (NSAID) that is used for the treatment of inflammatory conditions such as ] and ] (RA).<ref name="AustriaCodex">{{cite book|title=Austria-Codex|at=Rheumesser 3 ml-Ampullen|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2018|language=German}}</ref><ref>{{Cite web|url=https://drugs.ncats.io/drug/4VD83UL6Y6| work = NCATS Inxight: Drugs | title = KEBUZONE |language=en|access-date=2019-02-27}}</ref><ref>{{cite book | vauthors = Aronson JK | chapter = Kebuzone |title=Meyler's Side Effects of Drugs: The International Encyclopedia of Adverse Drug Reactions and Interactions |date=2016 |location=Amsterdam |isbn=978-0-444-53716-4 |page=405 |edition=Sixteenth | chapter-url=https://books.google.com/books?id=NOKoBAAAQBAJ&dq=Kebuzone&pg=RA3-PA405}}</ref> |
|
'''Kebuzone''' (or '''ketophenylbutazone''') is a ]. |
|
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
] |
|