| Revision as of 13:27, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456999224 of page Marbofloxacin for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 12:36, 5 August 2024 edit JWBE (talk | contribs)Extended confirmed users10,129 edits added Category:4-Methylpiperazin-1-yl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 408582794 |
|
| verifiedrevid = 462100206 |
|
| IUPAC_name = 9-fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyridol(3,2,1-ij)(4,2,1)benzoxadiazin-6 carboxylic acid |
|
| IUPAC_name = 9-fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyridol(3,2,1-ij)(4,2,1)benzoxadiazin-6 carboxylic acid |
|
| image = Marbofloxacin.PNG |
|
| image = Marbofloxacin Structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = XeniQuin bolus & Injection (Opsonin Agrovet BD) |
|
| Drugs.com = {{drugs.com|international|marbofloxacin}} |
|
| Drugs.com = {{drugs.com|international|marbofloxacin}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
⚫ |
| routes_of_administration = ] |
|
⚫ |
| ATCvet = yes |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = MA93 |
|
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = Rx-only |
|
| legal_status = veterinary prescription only |
|
| legal_status = |
| ⚫ |
| routes_of_administration = oral |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 24: |
Line 27: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 115550-35-1 --> |
|
| CAS_number = 115550-35-1 |
| ⚫ |
| ATCvet = yes |
|
| ⚫ |
| ATC_prefix = J01 |
|
| ⚫ |
| ATC_suffix = MA93 |
|
|
| PubChem = |
|
| PubChem = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 37: |
Line 37: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 54663 |
|
| ChemSpiderID = 54663 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8X09WU898T |
|
| UNII = 8X09WU898T |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| Line 45: |
Line 45: |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=17 | H=19 | F=1 | N=4 | O=4 |
|
| C=17 | H=19 | F=1 | N=4 | O=4 |
|
| molecular_weight = 362.356 |
|
|
| smiles = Fc4cc1c2N(/C=C(\C1=O)C(=O)O)N(COc2c4N3CCN(C)CC3)C |
|
| smiles = Fc4cc1c2N(/C=C(\C1=O)C(=O)O)N(COc2c4N3CCN(C)CC3)C |
|
| InChI = 1/C17H19FN4O4/c1-19-3-5-21(6-4-19)14-12(18)7-10-13-16(14)26-9-20(2)22(13)8-11(15(10)23)17(24)25/h7-8H,3-6,9H2,1-2H3,(H,24,25) |
|
|
| InChIKey = BPFYOAJNDMUVBL-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H19FN4O4/c1-19-3-5-21(6-4-19)14-12(18)7-10-13-16(14)26-9-20(2)22(13)8-11(15(10)23)17(24)25/h7-8H,3-6,9H2,1-2H3,(H,24,25) |
|
| StdInChI = 1S/C17H19FN4O4/c1-19-3-5-21(6-4-19)14-12(18)7-10-13-16(14)26-9-20(2)22(13)8-11(15(10)23)17(24)25/h7-8H,3-6,9H2,1-2H3,(H,24,25) |
| Line 54: |
Line 51: |
|
| StdInChIKey = BPFYOAJNDMUVBL-UHFFFAOYSA-N |
|
| StdInChIKey = BPFYOAJNDMUVBL-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Marbofloxacin''' is a carboxylic acid derivative third generation ] ]. It is used in ] under the brand names '''Marbocyl''', '''Forcyl, Marbo vet''' and '''Zeniquin'''. A formulation of marbofloxacin combined with ] and ] is available under the name Aurizon (] 115550-35-1). |
|
|
|
|
|
==Mechanism of action== |
|
|
Its mechanism of action is not thoroughly understood, but it is believed to be similar to the other ] by impairing the bacterial ] which results in rapid ] activity.<ref>Boothe, D.M. (2001) Antimicrobial drugs. In Small Animal ClinicalPharmacology and Therapeutics, pp. 150–173. W. B. Saunders Co., Philadelphia, PA.</ref> The other proposed mechanisms include that it acts against nondividing bacteria and does not require ] and ], which block ] and ] respectively.<ref>Hunter RP, Koch DE, Coke RL, Carpenter JW, Isaza R. Identification and comparison of marbofloxacin metabolites from the plasma of ball pythons (Python regius) and blue and gold macaws (Ara ararauna). J Vet Pharmacol Ther. 2007 Jun;30(3):257-62.</ref>{{Clarify|date=December 2023}} |
|
|
|
|
|
==Activity== |
|
|
Marbofloxacin is a synthetic, broad spectrum ] agent. The bactericidal activity of marbofloxacin is concentration dependent, with susceptible bacteria cell death occurring within 20–30 minutes of exposure. Like other fluoroquinolones, marbofloxacin has demonstrated a significant ] for both ] and ] bacteria and is active in both stationary and growth phases of bacterial replication.<ref name=":0">Plumb DC (ed). Plumb's Veterinary Handbook, 7th ed. Ames, IA: Wiley-Blackwell Publishing, 2011.</ref> |
|
|
|
|
|
It has good activity against many ] ] and ], is effective against: |
|
|
{{columns-list|colwidth=15em| |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] (including penicillinase-producing and methicillin-resistant strains) |
|
|
*] |
|
|
*] |
|
|
}} |
|
|
|
|
|
==Application== |
|
|
Marbofloxacin can be used both orally and topically. It is particularly used for ]s of the ], ] and ]s in dogs and cats, as well as with ] infections. For dogs, a dose ranges from 2.75 - 5.5 mg/kg once a day. The duration of treatment is usually at least five days, longer if there is a concurrent fungal or yeast infection.<ref name="pmid16238809">{{cite journal |vauthors=Rougier S, Borell D, Pheulpin S, Woehrlé F, Boisramé B |title=A comparative study of two antimicrobial/anti-inflammatory formulations in the treatment of canine otitis externa |journal=Veterinary Dermatology|volume=16 |issue=5 |pages=299–307 |date=October 2005 |pmid=16238809 |doi=10.1111/j.1365-3164.2005.00465.x |url=http://www3.interscience.wiley.com/resolve/openurl?genre=article&sid=nlm:pubmed&issn=0959-4493&date=2005&volume=16&issue=5&spage=299|archive-url=https://archive.today/20130105101727/http://www3.interscience.wiley.com/resolve/openurl?genre=article&sid=nlm:pubmed&issn=0959-4493&date=2005&volume=16&issue=5&spage=299|url-status=dead|archive-date=2013-01-05}}</ref> Maximum duration of treatment is 30 days.<ref name=":0" /> |
|
|
|
|
|
==Contraindications and side effects== |
|
|
Marbofloxacin should usually be avoided in young animals because of potential cartilage abnormalities. In rare occasion, it can cause ] (CNS) stimulation and should be used with caution in patients with seizure disorders.<ref name=":0" /> Under certain conditions it can cause discomfort such as ], treatable with ]. Other adverse effects are usually limited to ] (GI) distress (vomiting, anorexia, soft stools, diarrhoea) and decreased activity.<ref name=":0" /> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{QuinoloneAntiBiotics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |