Revision as of 17:00, 3 August 2011 editYikrazuul (talk | contribs)Rollbackers1,991 edits svg← Previous edit |
Latest revision as of 17:17, 15 March 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,638 edits unnecessary and inappropriate product promotion |
(34 intermediate revisions by 18 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 355085919 |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile=L-Monomethylarginine.svg |
|
|
⚫ |
| verifiedrevid = 442870188 |
|
|ImageSize=200px |
|
|
⚫ |
| ImageFile = L-Monomethylarginine.svg |
|
|IUPACName=(2''S'')-2-Amino-5-pentanoic acid |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|OtherNames=Targinina; Targininum; Targinine; omega-''N''-Methylarginine; <small>L</small>-Monomethylarginine; ''N''-Methyl-<small>L</small>-arginine; ''N''-Monomethyl-<small>L</small>-arginine; NG-monomethyl-<small>L</small>-arginine |
|
|
|
| ImageCaption = (''S'')-Methylarginine |
|
|
| ImageName = Stereo, skeletal formula of methylarginine (S) |
|
|
| OtherNames = 2-Amino-5-pentanoic acid; ''N''-Monomethylarginine; ''omega''-''N''-Methylarginine; Tilarginine; Targinine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo = 17035-90-4 |
|
| Abbreviations = L-NMMA |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| CASNo=17035-90-4 |
|
|
|
| CASNo_Comment = <small>(''S'')</small> |
⚫ |
| PubChem=132862 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| SMILES=CN=C(N)NCCC(C(=O)O)N |
|
|
|
| UNII = 27JT06E6GR |
⚫ |
}} |
|
|
⚫ |
| PubChem = 4366 |
|
|
| PubChem1 = 2733510 |
|
|
| PubChem1_Comment = <small>(''R'')</small> |
|
|
| PubChem2 = 132862 |
|
|
| PubChem2_Comment = <small>(''S'')</small> |
|
|
| ChemSpiderID = 4213 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID1 = 2015298 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID1_Comment = <small>(''R'')</small> |
|
|
| ChemSpiderID2 = 117259 |
|
|
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID2_Comment = <small>(''S'')</small> |
|
|
| KEGG = C03884 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| MeSHName = omega-N-Methylarginine |
|
|
| ChEBI = 28229 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 312870 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL1 = 109350 |
|
|
| ChEMBL1_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL2 = 256147 |
|
|
| ChEMBL2_Ref = {{ebicite|changed|EBI}} |
|
|
| Beilstein = 2262067 <small>(''R'')</small> |
|
|
| SMILES = CNC(=N)NCCCC(N)C(O)=O |
|
|
| StdInChI = 1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11) |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NTNWOCRCBQPEKQ-UHFFFAOYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=7 | H=16 | N=4 | O=2 |
|
| Formula=C<sub>7</sub>H<sub>16</sub>N<sub>4</sub>O<sub>2</sub> |
|
|
|
| LogP = −0.63 |
|
| MolarMass=188.23 g/mol |
|
|
|
| pKa = 2.512 |
|
| Appearance= |
|
|
|
| pKb = 11.488 |
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
⚫ |
}} |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Related |
|
|
| OtherFunction_label = alkanoic acids |
|
|
| OtherFunction = {{unbulleted list|]|]}} |
|
|
| OtherCompounds = {{unbulleted list|]|]}} |
|
⚫ |
}} |
|
⚫ |
}} |
|
|
|
|
⚫ |
'''''N''-Methylarginine''' is an ] of ].<ref>{{cite journal |author1=Toutouzas, K. |author2=Riga, M. |author3=Stefanadi, E. |author4=Stefanadis, C. | title = Asymmetric dimethylarginine (ADMA) and other endogenous nitric oxide synthase (NOS) inhibitors as an important cause of vascular insulin resistance | journal = Hormone and Metabolic Research | year = 2008 | volume = 40 | issue = 9 | pages = 655–659 | doi = 10.1055/s-0028-1083814 | pmid = 18792879|s2cid=260167230 }}</ref><ref name="pmid7517676">{{cite journal |vauthors=Stefanovic-Racic M, Meyers K, Meschter C, Coffey JW, Hoffman RA, Evans CH | title=N-monomethyl arginine, an inhibitor of nitric oxide synthase, suppresses the development of adjuvant arthritis in rats | journal = ] | volume=37 | issue=7 | year=1994 | pages=1062–1069 | pmid=7517676| doi=10.1002/art.1780370712 | doi-access= }}</ref> Chemically, it is a ] derivative of the ] ]. It is used as a biochemical tool in the study of physiological role of ]. |
|
|
|
|
|
|
The inhibiting effect of ''N''-methylarginine on ] is lower in ] patients than in normal subjects, indicating ].<ref name="pmid11509489">{{cite journal |vauthors=Taddei S, Virdis A, Ghiadoni L, Salvetti G, Bernini G, Magagna A, Salvetti A | title=Age-related reduction of NO availability and oxidative stress in human | journal= ] | volume=38 | issue=2 | year=2012 | pages=274–279 | pmid=11509489 | quote=Up to the age of 60 years, despite the evident decline in endothelium-dependent vasodilation, vitamin C did not modify the response to acetylcholine. In contrast, in the oldest individuals (age >60 years) characterized by a profound alteration in NO availability, vitamin C not only enhanced the response to the endothelial agonist but also restored the inhibiting effect of L-NMMA on vasodilation to acetylcholine.| doi=10.1161/01.hyp.38.2.274 | doi-access=free | citeseerx=10.1.1.576.255 }}</ref> The inhibiting effect of ''N''-methylarginine on vasodilation declines progressively with age, but has been restored with ] in the oldest subjects.<ref name="pmid11509489" /> |
⚫ |
'''''N''-Methylarginine''' is an ] of ].<ref>{{cite journal | author = Toutouzas, K.; Riga, M.; Stefanadi, E.; Stefanadis, C. | title = Asymmetric dimethylarginine (ADMA) and other endogenous nitric oxide synthase (NOS) inhibitors as an important cause of vascular insulin resistance | journal = Hormone and Metabolic Research | year = 2008 | volume = 40 | issue = 9 | pages = 655–659 | doi = 10.1055/s-0028-1083814 | pmid = 18792879}}</ref> Chemically, it is a ] derivative of the ] ]. It is used as a biochemical tool in the study of physiological role of ]. |
|
|
|
|
|
|
== See also == |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
Line 35: |
Line 68: |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |