Revision as of 11:57, 25 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.← Previous edit |
Latest revision as of 08:17, 17 May 2024 edit undoGreenLipstickLesbian (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers16,720 edits removing close paraphrasing from https://www.eurekaselect.com/article/95541Tag: Visual edit |
(34 intermediate revisions by 26 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400106502 |
|
| verifiedrevid = 415851554 |
|
| Name = Morin |
|
|
| ImageFile = Morin.svg |
|
| Name = Morin |
|
|
| ImageFile = Morin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 200px |
|
|
| ImageAlt = Skeletal formula of morin |
|
| ImageName = Morin structure |
|
|
|
| ImageFile1 = Morin-3D-balls.png |
|
| IUPACName = 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|
|
|
| ImageAlt1 = Ball-and-stick model of the morin molecule |
⚫ |
| OtherNames= Aurantica<br>Al-Morin<br>Morin hydrate<br>Calico Yellow<br>''Toxylon pomiferum''<br>Bois d'arc<br>Osage orange extract |
|
|
|
| IUPACName = 2′,3,4′,5,7-Pentahydroxyflavone |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| SystematicName = 2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4''H''-1-benzopyran-4-one |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| OtherNames = Aurantica<br>Al-Morin<br>Morin hydrate<br>Calico Yellow<br>''Toxylon pomiferum''<br>Bois d'arc<br>Osage orange extract |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444989 |
|
| ChemSpiderID = 4444989 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C10105 |
|
| KEGG = C10105 |
|
| InChI = 1/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
|
| InChI = 1/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
|
| InChIKey = YXOLAZRVSSWPPT-UHFFFAOYAH |
|
| InChIKey = YXOLAZRVSSWPPT-UHFFFAOYAH |
|
|
| ChEBI = 75092 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 28626 |
|
| ChEMBL = 28626 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
Line 19: |
Line 26: |
|
| StdInChIKey = YXOLAZRVSSWPPT-UHFFFAOYSA-N |
|
| StdInChIKey = YXOLAZRVSSWPPT-UHFFFAOYSA-N |
|
| CASNo = 654055-01-3 |
|
| CASNo = 654055-01-3 |
|
| PubChem = 5281670 |
|
| PubChem = 5281670 |
|
| IUPHAR_ligand = 411 |
|
| IUPHAR_ligand = 411 |
|
| SMILES = O=C1c3c(O/C(=C1/O)c2ccc(O)cc2O)cc(O)cc3O |
|
| SMILES = O=C1c3c(O/C(=C1/O)c2ccc(O)cc2O)cc(O)cc3O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>7</sub> |
|
|
|
| H=10 |
|
| MolarMass = 302.2357 g/mol |
|
|
|
| O=7 |
|
| ExactMass = 302.042653 |
|
|
| Density = |
|
| Density = 1.799 g/mL |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Morin''' is a chemical compound. It is a yellow color substance that can be isolated from '']'' (Osage orange), '']'' (old fustic) and from leaves of '']'' (common guava)<ref name="Psidium"></ref>. |
|
'''Morin''' is a yellow chemical compound that can be isolated from '']'' (Osage orange), '']'' (old fustic), and from leaves of '']'' (common guava).<ref name="Psidium">{{cite journal | doi = 10.1016/j.fitote.2007.03.015 | title = Bacteriostatic effect of flavonoids isolated from leaves of Psidium guajava on fish pathogens | journal = Fitoterapia | volume = 78 | issue = 6 | pages = 434–436 | year = 2007 | last1 = Rattanachaikunsopon | first1 = Pongsak | last2 = Phumkhachorn | first2 = Parichat | pmid = 17553634 }}</ref> In a preclinical '']'' study, morin was found to be a weak inhibitor of ] with an ] of 2.33 μM.<ref>{{cite journal | doi = 10.2174/092986706776361012 | title = Inhibition of Fatty Acid Synthase by Polyphenols | journal = Current Medicinal Chemistry | volume = 13 | issue = 8 | pages = 967–977 | year = 2006 | last1 = Tian | first1 = Wei-Xi | pmid = 16611078 }}</ref> Morin was also found to inhibit ] formation by ] (or amylin) and disaggregate amyloid fibers.<ref name="Noor2012">{{cite journal | doi = 10.1002/pro.2023| pmc = 3375438| title = Morin hydrate inhibits amyloid formation by islet amyloid polypeptide and disaggregates amyloid fibers| journal = Protein Science| volume = 21| issue = 3| pages = 373–382| year = 2012| last1 = Noor| first1 = Harris| last2 = Cao| first2 = Ping| last3 = Raleigh| first3 = Daniel P.| pmid = 22238175}}</ref> |
|
|
|
|
|
Morin can be used to test for the presence of ] or ] in a solution, since it forms characteristically ] ]es with them. |
|
Morin can be used to test for the presence of ] or ] in a solution, since it forms characteristically ] ]es with them under UV light. |
|
|
|
|
|
==]s== |
|
== Glycosides == |
|
* Morin-3-O-]<ref name="Psidium"></ref> |
|
* Morin-3-O-]<ref name="Psidium" /> |
|
* Morin-3-O-]<ref name="Psidium"/> |
|
* Morin-3-O-]<ref name="Psidium"/> |
|
|
|
|
|
==References== |
|
== References == |
|
<references/> |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
⚫ |
{{Polyphenol-stub}} |
|
|
|
|
|
|
⚫ |
{{phenol-stub}} |
|
] |
|
|
] |
|
|
] |
|