| Revision as of 06:47, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Pyrogallols using HotCat← Previous edit |
Latest revision as of 01:17, 5 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (39 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| Name = Myricitrin |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Myricitrin.svg |
|
|
|
| verifiedrevid = 401011564 |
| ⚫ |
| ImageSize = 250px |
|
|
| ImageName = Myricitrin structure |
|
| Name = Myricitrin |
|
⚫ |
| ImageFile = Myricitrin.svg |
| ⚫ |
| IUPACName = 5,7-dihydroxy-3-oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|
|
⚫ |
| ImageSize = 250px |
| ⚫ |
| OtherNames= Myricitroside<br>Myricitrine<br>Myricetrin<br>Myricetol 3-rhamnoside<br>Myricetin 3-O-rhamnoside<br>Myricetin 3-rhamnoside |
|
|
⚫ |
| ImageName = Myricitrin structure |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| IUPACName = 3′,4′,5,5′,7-Pentahydroxy-3-(α-<small>L</small>-rhamnopyranosyloxy)flavone |
| ⚫ |
| CASNo = 17912-87-7 |
|
|
⚫ |
| SystematicName = 5,7-Dihydroxy-3-{oxy}-2-(3,4,5-trihydroxyphenyl)-4''H''-1-benzopyran-4-one |
| ⚫ |
| PubChem = 5281673 |
|
|
⚫ |
| OtherNames= Myricitroside<br>Myricitrine<br>Myricetrin<br>Myricetol 3-rhamnoside<br>Myricetin 3-O-rhamnoside<br>Myricetin 3-rhamnoside |
| ⚫ |
| SMILES = CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)O)O)O |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 17912-87-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5Z0ZO61WPJ |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C10108 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444992 |
|
⚫ |
| PubChem = 5281673 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 70082 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 454576 |
|
⚫ |
| SMILES = CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)O)O)O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>12</sub> |
|
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>12</sub> |
|
| MolarMass = 464.37 g/mol |
|
| MolarMass = 464.37 g/mol |
|
|
| Density = 1.882 g/mL |
|
| ExactMass = 464.095476 |
|
|
| Density = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Myricitrin''' is a plant compound, the 3-O-α-L-rhamnopyranoside of ].<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/5352000#section=Synonyms|title=Myricetin 3-rhamnoside}}</ref> |
|
'''Myricitrin''' is a chemical compound. It can be isolated from the root bark of '']'' (Bayberry, a small tree native to North America) and in '']''<ref></ref>. |
|
|
|
|
|
|
|
== Occurrences == |
|
Myricitrin is the 3-O-] of ]. |
|
|
|
It can be isolated from the root bark of '']'' (Bayberry, a small tree native to North America), in '']'', in '']''<ref>{{Cite journal|pmid=12842147|year=2003|last1=Elegami|first1=AA|last2=Bates|first2=C|last3=Gray|first3=AI|last4=MacKay|first4=SP|last5=Skellern|first5=GG|last6=Waigh|first6=RD|title=Two very unusual macrocyclic flavonoids from the water lily Nymphaea lotus|volume=63|issue=6|pages=727–31|journal=Phytochemistry|doi=10.1016/S0031-9422(03)00238-3}}</ref> and '']'', in '']''<ref>{{Cite journal|doi=10.1590/S0102-695X2006000300009|title=Determination of myricetin derivatives in Chrysobalanus icaco L. (Chrysobalanaceae)|year=2006|last1=Barbosa|first1=Wagner Luiz R.|last2=Peres|first2=Amiraldo|last3=Gallori|first3=Sandra|last4=Vincieri|first4=Franco F.|journal=Revista Brasileira de Farmacognosia|volume=16|issue=3|pages=333|doi-access=free}}</ref> and in '']''.<ref>LC Method for Analysis of Three Flavonols in Rat Plasma and Urine after Oral Administration of Polygonum aviculare Extract. Fuquan Xu, Huashi Guan, Guoqiang Li and Hongbing Liu, Chromatographia, June 2009, Volume 69, Issue 11-12, pages 1251-1258, {{doi|10.1365/s10337-009-1088-x}}</ref> |
|
|
|
|
|
Myricitrin is used by several beetle species in their communication system<ref></ref>. These include '']'', '']'', '']'', '']'', '']'', '']''. |
|
Myricitrin is used by several beetle species in their communication system.<ref></ref> These include '']'', '']'', '']'', '']'', '']'', '']''. |
|
|
|
|
|
|
|
|
==References== |
|
== Health effect == |
|
|
Myricitrin is a ] and ] inhibitor and exhibits antipsychotic-like and anxiolytic-like effects in animal models of psychosis and anxiety respectively.<ref>{{Cite journal|pmid=21689712|date=August 2011|last1=Pereira|first1=M|last2=Siba|first2=IP|last3=Chioca|first3=LR|last4=Correia|first4=D|last5=Vital|first5=MA|last6=Pizzolatti|first6=MG|last7=Santos|first7=AR|last8=Andreatini|first8=R|title=Myricitrin, a nitric oxide and protein kinase C inhibitor, exerts antipsychotic-like effects in animal models|volume=35|issue=7|pages=1636–44|doi=10.1016/j.pnpbp.2011.06.002|journal=Progress in Neuro-Psychopharmacology & Biological Psychiatry|doi-access=free}}</ref> |
|
|
|
|
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|