| Revision as of 08:28, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 21:52, 3 October 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,150 editsNo edit summary |
| (16 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444020473 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=NIM811.png |
|
|
⚫ |
| verifiedrevid = 444021522 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=NIM811.svg |
| ⚫ |
|IUPACName= |
|
|
⚫ |
| ImageSize=200px |
|
|OtherNames= |
|
|
⚫ |
| IUPACName= |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| OtherNames=''N''-Methyl-4-isoleucine cyclosporin |
| ⚫ |
| CASNo=143205-42-9 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=6473876 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=143205-42-9 |
|
⚫ |
| PubChem=6473876 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 96262S4I14 |
|
| UNII = 96262S4I14 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1688529 |
|
| SMILES=CC1C(=O)N(CC(=O)N((C(=O)N(C(=O)N((C(=O)N(C(=O)N(C(=O)N((C(=O)N((C(=O)N((C(=O)N((C(=O)N1)((C)C\C=C\C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)(C)CC)C)C |
|
| SMILES=CC1C(=O)N(CC(=O)N((C(=O)N(C(=O)N((C(=O)N(C(=O)N(C(=O)N((C(=O)N((C(=O)N((C(=O)N((C(=O)N1)((C)C\C=C\C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)(C)CC)C)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>62</sub>H<sub>111</sub>N<sub>11</sub>O<sub>12</sub> |
|
| C = 62 | H = 111 | N = 11 | O = 12 |
|
|
| Appearance= |
|
| MolarMass=1202.61 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''NIM811''' is a ] inhibitor. Also known as N-methyl-4-isoleucine cyclosporin, it is a four-substituted cyclosporine that does not bind to cyclophilin A and therefore lacks immunosuppressive activity. Rather, NIM811 binds and inhibits cyclophilin. |
|
'''NIM811''' is a ] inhibitor. Also known as '''''N''-methyl-4-isoleucine cyclosporin''', it is a substituted cyclosporine ] that binds to cyclophilin; however, this binary complex cannot bind to calcineurin, and therefore lacks ]. |
|
|
|
|
|
|
NIM811 is a form of treatment for patients with the ] (HCV). Studies indicate a strong relationship between a treatment's cyclophilin binding affinity and suppression of HCV activity.<ref>{{Cite journal|last=Ma|first=Sue|last2=Boerner|first2=Joanna E.|last3=TiongYip|first3=ChoiLai|last4=Weidmann|first4=Beat|last5=Ryder|first5=Neil S.|last6=Cooreman|first6=Michael P.|last7=Lin|first7=Kai|date=2006–2009|title=NIM811, a Cyclophilin Inhibitor, Exhibits Potent In Vitro Activity against Hepatitis C Virus Alone or in Combination with Alpha Interferon|journal=Antimicrobial Agents and Chemotherapy|volume=50|issue=9|pages=2976–2982|doi=10.1128/AAC.00310-06|issn=0066-4804|pmc=1563518|pmid=16940091}}</ref> NIM811 is also being studied as a potential treatment to genetic muscular diseases such as ] (UCMD) and ] (BM) disease, diseases altering the genes for collagen VI production.<ref>{{Cite journal|last=Bernardi|first=Paolo|last2=Argenton|first2=Francesco|last3=Bonaldo|first3=Paolo|last4=Braghetta|first4=Paola|last5=Sabatelli|first5=Patrizia|last6=Maraldi|first6=Nadir Mario|last7=Merlini|first7=Luciano|last8=Blaauw|first8=Bert|last9=Tagliavini|first9=Francesca|date=2014-10-15|title=NIM811, a cyclophilin inhibitor without immunosuppressive activity, is beneficial in collagen VI congenital muscular dystrophy models|journal=Human Molecular Genetics|language=en|volume=23|issue=20|pages=5353–5363|doi=10.1093/hmg/ddu254|pmid=24852368|issn=0964-6906|doi-access=free}}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{biochem-stub}} |
|