| Revision as of 14:13, 3 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:20, 18 January 2025 edit undoCitation bot (talk | contribs)Bots5,455,397 edits Added page. | Use this bot. Report bugs. | Suggested by Pancho507 | Linked from User:Pancho507/sandbox/1 | #UCB_webform_linked 385/3849 |
| (73 intermediate revisions by 43 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Disinfectant and antiseptic}} |
|
{{DISPLAYTITLE:''p''-Chlorocresol}} |
|
{{DISPLAYTITLE:''p''-Chlorocresol}} |
|
{{chembox |
|
{{Chembox |
|
|
|Verifiedfields=changed |
|
| verifiedrevid = 415867069 |
|
|
|
|Watchedfields=changed |
|
|
|verifiedrevid=416908770 |
|
|Name=''p''-Chlorocresol |
|
|Name=''p''-Chlorocresol |
|
|ImageFile=p-Chlorocresol.png |
|
|ImageFile=p-Chlorocresol.png |
|
|
|ImageClass = skin-invert-image |
|
|ImageSize=100px |
|
|ImageSize=100px |
|
|IUPACName=4-chloro-3-methylphenol |
|
|PIN=4-Chloro-3-methylphenol |
|
|OtherNames= |
|
|OtherNames=''p''-chloro-''m''-cresol; PCMC; Preventol; CMK |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo=59-50-7 |
|
| CASNo = 59-50-7 |
|
| CASNo_Ref = changed |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem=1732 |
|
|
|
| UNII = 36W53O7109 |
|
| SMILES=CC1=C(C=CC(=C1)O)Cl |
|
|
|
| PubChem = 1732 |
|
}} |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1230222 |
|
|
| ChEBI = 34395 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 21106018 |
|
|
| KEGG = C14331 |
|
|
| KEGG1 = D03468 |
|
|
| EINECS = 200-431-6 |
|
|
| RTECS = GO7100000 |
|
|
| UNNumber = 2669 |
|
|
| SMILES = Oc1ccc(Cl)c(C)c1 |
|
|
| InChI = 1/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
|
|
| InChIKey = CFKMVGJGLGKFKI-UHFFFAOYAE |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = CFKMVGJGLGKFKI-UHFFFAOYSA-N |
|
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7 | H = 7 | Cl = 1 | O = 1 |
|
| C=7 | H=7 | Cl=1 | O=1 |
|
| Appearance= |
|
| Appearance = White solid |
|
|
| Odor = Phenolic |
|
| Density= |
|
|
|
| Density = 1.37 g/cm<sup>3</sup> (20 °C) |
|
| MeltingPt= |
|
|
|
| MeltingPtC = 55.55 |
|
| BoilingPt= |
|
|
|
| BoilingPtC = 235 |
|
| Solubility= |
|
|
|
| Solubility = 3.8 g/L at 20 °C (in water) |
|
}} |
|
|
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
|
| ExternalSDS = |
|
| ExternalMSDS = |
|
|
|
| GHSPictograms = {{GHS05}}{{GHS07}}{{GHS09}} |
|
| EUClass = Harmful (Xn) |
|
|
|
| GHSSignalWord = Danger |
|
| FlashPt= |
|
|
|
| HPhrases = {{H-phrases|302|314|317|335|400|412}} |
|
| Autoignition= |
|
|
|
| PPhrases = {{P-phrases|260|261|264|270|271|272|273|280|301+312|301+330+331|302+352|303+361+353|304+340|305+351+338|310|312|321|330|333+313|363|391|403+233|405|501}} |
|
}} |
|
|
|
| FlashPtC = 118 |
|
|
| AutoignitionPt = |
|
|
}} |
|
|Section8={{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherCpds = ] (4-chloro-3,5-dimethylphenol) |
|
| OtherCompounds = ] (4-chloro-3,5-dimethylphenol) |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''''p''-Chlorocresol''', or '''4-chloro-3-methylphenol''' (ClC<sub>6</sub>H<sub>3</sub>CH<sub>3</sub>OH), also known as p-chloro-m-], is a potent disinfectant and antiseptic.<ref>{{citation|title=Handbook of Food, Drug, and Cosmetic Excipients|pages=87|author=Susan C Smolinske|year=1992}}</ref> It appears as a pinkish white crystalline solid.<ref>{{Cite web |last= |title=4-Chloro-3-methylphenol |url=https://pubchem.ncbi.nlm.nih.gov/compound/1732 |access-date=2023-08-25 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> It is also used as a preservative <ref>C. Glen Mayhall (2004), Hospital Epidemiology and Infection Control, p. 1741</ref> in cosmetics and medicinal products for both humans and animals. It is used as an active ingredient in some preparations of veterinary medicines for topical, oral and parenteral use. Normally, the concentration of p-Chlorocresol in oral and parenteral veterinary products are 0.1-0.2%. Concentrations are higher (~0.5%) in topical veterinary products. p-Chlorocresol contains microbial activity against both gram positive and gram negative bacteria and fungi. |
|
'''''p''-Chlorocresol''' is a ] ] which is used as an ] and ].<ref>{{citation|title=Handbook of Food, Drug, and Cosmetic Excipients|pages=87|author=Susan C Smolinske|year=1992}}</ref> It forms colourless, dimorphous ]s at room temperature and is only slightly soluble in water. For use as a ] such as a hand wash, it is commonly dissolved in alcohol in combination with other phenols.<ref>{{citation|title=Hospital Epidemiology and Infection Control|pages=1741|author=C. Glen Mayhall|year=2004}}</ref> It is a moderate ] for sensitive ].<ref>{{citation|title=Toxicology of Skin|pages=339|author=Howard I. Maibach|year=2001}}</ref> |
|
|
|
|
|
|
The use of p-Chlorocresol is regulated by government agencies such as the US Food and Drug administration,<ref>{{Cite web |title=CFR - Code of Federal Regulations Title 21 |url=https://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.880 |access-date=2023-08-25 |website=www.accessdata.fda.gov}}</ref> and limits are set on the amount of p-Chlorocresol that can be present in various products. |
|
|
|
|
|
Chlorocresol was first introduced as a bactericide in 1897 by {{ill|Kalle & Co.|de|Chemische Fabrik Kalle}}<ref>{{Cite book |last=Sneader |first=Walter |url=https://books.google.com/books?id=Cb6BOkj9fK4C&pg=PA362 |title=Drug Discovery: A History |date=2005-06-23 |publisher=John Wiley & Sons |isbn=978-0-471-89979-2 |pages=362 |language=en}}</ref> after scientists gradually discovered that more substituted and more ] phenols are less toxic, less irritant and more powerful.<ref>{{Cite thesis |last=de Solis |first=Nilka M. G. |title=Effect of plasmids that confer preservative-resistance on the performance of bacteria in preservative efficacy tests |date=1993 |degree=Doctoral |publisher=University College London |url=https://discovery.ucl.ac.uk/id/eprint/10109659 |page=31}}</ref> |
|
|
|
|
|
==Synthesis== |
|
|
p-Chlorocresol is synthesized from the monochlorination<ref name="fiege">Fiege, H., Voges, H. W., Hamamoto, T., Umemura, S., Iwata, T., Miki, H., ... & Paulus, W. (2000). Phenol derivatives. Ullmann's encyclopedia of industrial chemistry.</ref> of 3-methylphenol at position 4. |
|
|
|
|
|
==Metabolism== |
|
|
The biodegradation of p-Chlorocresol<ref name="Canada">{{Cite web |last= |first= |date=2021-05-21 |title=Screening assessment phenol, 4-chloro-3-methyl- (Chlorocresol) |url=https://www.canada.ca/en/environment-climate-change/services/evaluating-existing-substances/screening-assessment-phenol-4-chloro-3-methyl-chlorocresol.html |access-date=2023-08-25 |website=www.canada.ca}}</ref> is done in the liver, and then excreted primarily via the kidneys or in smaller amounts through the lungs. In facultative ''Thauera'' sp. strain DO, p-Chlorocresol was degraded aerobically either by dehalogenation followed by catechol degradation pathway, or methyl oxidation to 4-chlorobenzoate.<ref name="Biotech">{{cite journal |last1=Ha |first1=Duc Danh |last2=Nguyen |first2=Oanh Thi |title=Degradation of p-chlorocresol by facultative Thauera sp. strain DO |journal=3 Biotech |date=February 2020 |volume=10 |issue=2 |page=46 |doi=10.1007/s13205-019-2025-9|pmid=31988840 |pmc=6954914 }}</ref> The exact reaction mechanism in humans is unknown. |
|
|
|
|
|
==Reactions and mechanisms== |
|
|
===Oxidation=== |
|
|
The oxidation reaction of p-Chlorocresol by hydrogen peroxide (H<sub>2</sub>O<sub>2</sub>)<ref>{{cite journal |last1=Kronholm |first1=Juhani |last2=Huhtala |first2=Sami |last3=Haario |first3=Heikki |last4=Riekkola |first4=Marja-Liisa |title=Oxidation of 4-chloro-3-methylphenol in pressurized hot water in liquid and vapor phases |journal=Advances in Environmental Research |date=September 2002 |volume=6 |issue=3 |pages=199–206 |doi=10.1016/S1093-0191(01)00051-X}}</ref> can occur through a two-step process. In the first step, H2O2 is activated by a catalyst, such as a metal ion or an enzyme, to form a reactive oxygen species, such as a hydroxyl radical (HO•). This reactive species can then attack the aromatic ring of the 4-chloro-3-methylphenol molecule, leading to the formation of a quinone intermediate. |
|
|
|
|
|
The quinone intermediate is an important intermediate in many biological and chemical processes.<ref name="fiege"/> It can undergo further oxidation to form a variety of compounds, including hydroquinones, catechols, and benzoquinones. In the case of p-Chlorocresol, the quinone intermediate can be further oxidized to form 4-chlorocatechol, which is a catechol compound. |
|
|
|
|
|
===Esterification=== |
|
|
The esterification reaction of p-Chlorocresol with acetic anhydride to obtain 4-chloro-3-methylphenyl acetate.<ref>{{Cite journal |last1=Dofe |first1=Vidya S. |last2=Sarkate |first2=Aniket P. |last3=Kathwate |first3=Santosh H. |last4=Gill |first4=Charansingh H. |date=2017-08-01 |title=Synthesis, antimicrobial activity and anti-biofilm activity of novel tetrazole derivatives |journal=Heterocyclic Communications |language=en |volume=23 |issue=4 |pages=325–330 |doi=10.1515/hc-2017-0016 |issn=2191-0197|doi-access=free }}</ref> |
|
|
|
|
|
''Step 1: Protonation of the phenol group'' |
|
|
Acetic anhydride is a source of acetyl cation (CH<sub>3</sub>CO<sup>+</sup>). In the presence of a Lewis acid catalyst like sulfuric acid, the acetyl cation can react with the lone pair of electrons on the oxygen atom of the phenol group of p-Chlorocresol to protonate it, forming a resonance-stabilized carbocation intermediate. |
|
|
|
|
|
''Step 2: Nucleophilic attack of the carbocation intermediate by acetic anhydride'' |
|
|
The carbocation intermediate is attacked by the nucleophilic oxygen atom of an acetic anhydride molecule, which results in the formation of a new bond between the carbocation and the acetyl group. This leads to the formation of an intermediate with an acylated phenol ring. |
|
|
|
|
|
''Step 3: Deprotonation of the intermediate'' |
|
|
The intermediate formed in Step 2 is then deprotonated by water or the acid catalyst, which regenerates the catalyst and releases the 4-chloro-3-methylphenyl acetate product. |
|
|
|
|
|
===Dehalogenation=== |
|
|
Dehalogenation of p-chlorocresol to remove the chlorine atom. |
|
|
Biological dehalogenation can be used to remove halogens from organic molecules.<ref name="Biotech"/> This process involves the use of microorganisms such as bacteria or fungi that have the ability to break down and remove halogens from compounds. However, the use of biological methods for dehalogenation is still relatively new and requires further research and development. |
|
|
|
|
|
==Indications== |
|
|
p-Chlorocresol is a potent disinfectant and antiseptic agent<ref>National Center for Advancing Translational Sciences(2007). Inxight Drugs Chlorocresol. Retrieved march 1,2023 from: https://drugs.ncats.io/drug/36W53O7109#publications |
|
|
</ref> due to its antimicrobial and antifungal properties and is therefore used for wound and skin disinfection.<ref>{{Cite web |title=PCMC (Parachlorometacresol) {{!}} |url=https://atamankimya.com/sayfalaralfabe.asp?LanguageID=2&cid=3&id=2871&id2=1883 |access-date=2023-08-25 |website=atamankimya.com}}</ref> It also has preservative properties and is commonly found in topical creams and cosmetics. These properties also allow it to be used in paints and inks. |
|
|
|
|
|
==Molecular mechanism of action== |
|
|
A phenolic preservative agent, the bacteriostatic mechanism of p-Chlorocresol arises from its ability to induce cytoplasmic<ref>S P Denver, Valerie D Harding, W B Hugo, The Mechanism of Bacteriostatic Action of Chlorocresol (CC) on Staphylococcus Aureus.Journal of Pharmacy and Pharmacology vol. 27,12(1985): 93. doi:10.1111/j.2042-7158.1985.tb14165.x</ref> leakage in bacteria, disrupting membrane permeability to potassium and phosphate ions. Cytoplasmic leakage also results in dissipation of the proton motive force, causing uncoupling of respiration from ATP synthesis.<ref>{{cite journal |last1=Denyer |first1=S.P. |title=Mechanisms of action of antibacterial biocides |journal=International Biodeterioration & Biodegradation |date=October 1995 |volume=36 |issue=3–4 |pages=227–245 |doi=10.1016/0964-8305(96)00015-7|bibcode=1995IBiBi..36..227D }}</ref> |
|
|
|
|
|
==Efficacy== |
|
|
p-Chlorocresol has been shown to be effective as a bactericide in handwash at 0.2% 2/2 a.s in 60 seconds with 6 ml applied.<ref>European Chemicals Agency (2016), Proposal for Harmonised Classification and Labelling for p-chloro-m-cresol (CMK). Retrieved from: https://echa.europa.eu/documents/10162/ac5f5b9f-59fc-630c-3137-59c7304c06d0</ref> It is also effective against prions such as scrapie in hamsters.<ref name="cambridge">{{cite journal |last1=Riemer |first1=Constanze |last2=Bamme |first2=Theresa |last3=Mok |first3=Simon Wing Fai |last4=Baier |first4=Michael |title=3-Methyl-4-Chlorophenol for Prion Decontamination of Medical Devices |journal=Infection Control & Hospital Epidemiology |date=July 2006 |volume=27 |issue=7 |pages=778–780 |doi=10.1086/504450|pmid=16807860 |s2cid=35661326 }}</ref> |
|
|
|
|
|
As an ingredient in cosmetic creams and lotions, p-chlorocresol has a 75% dermal absorption value. Up to 100%<ref name="Canada"/> dermal absorption may be possible when it is dermally applied to broken skin (eg. for eczema). |
|
|
|
|
|
==Adverse effects== |
|
|
Allergic contact dermatitis resulting from hypersensitivity to p-Chlorocresol has been reported,<ref>{{cite journal |last1=Gómez de la Fuente |first1=E. |last2=Andreu-Barasoain |first2=M. |last3=Nuño-González |first3=A. |last4=López-Estebaranz |first4=J.L. |title=Allergic Contact Dermatitis Due To Chlorocresol In Topical Corticosteroids |journal=Actas Dermo-Sifiliográficas (English Edition) |date=January 2013 |volume=104 |issue=1 |pages=90–92 |doi=10.1016/j.adengl.2012.11.016|doi-access=free }}</ref> and it is classified as hazardous with the risk phrase “May cause sensitisation by skin contact’ in the HSIS (Safe Work Australia).<ref>{{Cite web |title=Safe Work Australia |url=https://hcis.safeworkaustralia.gov.au/ |access-date=2023-08-25 |website=hcis.safeworkaustralia.gov.au}} |
|
|
</ref> However, Draize tests conducted on human subjects showed no positive reactions among healthy male subjects at 5%, 10% and 20% chlorocresol via dermal route.<ref>Cosmetic Ingredient Review (CIR, 2006). Final Report on the Safety Assessment of Sodium p-Chloro-m-Cresol, p-Chloro-mCresol, Chlorothymol, Mixed Cresols, m-Cresol, o-Cresol, p-Cresol, Isopropyl Cresols, Thymol, o-Cymen-5-ol, and Carvacrol. |
|
|
International Journal of Toxicology 25(Supp 1):29-127. Accessed December 2015 at http://gov.personalcarecouncil.org/ctfastatic/online/lists/cir-pdfs/pr277.pdf</ref> |
|
|
|
|
|
There has been a documented case of recurrent unilateral facial palsy of a woman after exposure to p-chlorocresol.<ref>{{cite journal |last1=Dossing |first1=M |last2=Wulff |first2=C H |last3=Olsen |first3=P Z |title=Repeated facial palsies after chlorocresol inhalation. |journal=Journal of Neurology, Neurosurgery & Psychiatry |date=1 December 1986 |volume=49 |issue=12 |pages=1452–1454 |doi=10.1136/jnnp.49.12.1452|pmid=3806124 |s2cid=8183536 |pmc=1029136 }}</ref> The brief neurological disturbance was relieved by exposure to fresh air and was determined to be a result of pharmacological hyperreactivity. |
|
|
|
|
|
==Toxicity== |
|
|
Human exposure to p-Chlorocresol is mostly through body lotions as it is not found naturally in the environment. Above the critical effect level (21 mg/ kg/ bw/ day), p-chlorocresol exposure may result in a decrease in absolute adrenal gland weights.<ref name="Canada"/> In 2021, it was classified as a compound that may constitute a danger to human life or health by the Government of Canada as the margins of exposure of the critical effect level and the estimated levels of exposure were considered inadequate. |
|
|
|
|
|
Similar to phenol, neurolytic effects have also been reported for chlorocresol.<ref>D’Souza, Ryan S. “Neurolytic Blocks.” StatPearls - NCBI Bookshelf, 2022, www.ncbi.nlm.nih.gov/books/NBK537360/#_NBK537360_pubdet_.</ref> However, this reaction is rare and may be due to interindividual hypersensitivity. |
|
|
|
|
|
p-Chlorocresol does not significantly bioaccumulate in organisms due to low Kow and bioconcentration factors. It is not found to be genotoxic or carcinogenic<ref>http://archive.epa.gov/pesticides/reregistration/web/pdf/3046red.pd {{Bare URL inline|date=August 2024}}</ref> and has been safely used in human medicine for many years.<ref>The European Agency for the Evaluation of Medicinal Products Veterinary Medicines Evaluation Unit. “Chlorocresol(4-chloro-3-methylphenol).” Retrieved from:https://www.ema.europa.eu/en/documents/mrl-report/chlorocresol-4-chloro-3-methylphenol-summary-report-committee-veterinary-medicinal-products_en.pdf</ref> |
|
|
|
|
|
'''Effects on animals''' |
|
|
Effects on animals |
|
|
p-Chlorocresol has low to moderate acute oral toxicity in rats and mice, with a median lethal dose (LD50) of 1830 mg/kg in male Wistar rats.<ref name="indu">IMAP. “Chlorocresol and its sodium salt: Human health tier II assessment.” retrieved from: https://www.industrialchemicals.gov.au/sites/default/files/Chlorocresol%20and%20its%20sodium%20salt_Human%20health%20tier%20II%20assessment.pdf |
|
|
</ref> It has also been shown to be corrosive to the skin of New Zealand White rabbits when applied dermally, and an irritant to rabbit eyes.<ref>{{Cite web |title=RTECS Number GO7100000 |url=http://ccinfoweb2.ccohs.ca/rtecs/records/GO7100000.html |access-date=2023-08-25 |website=ccinfoweb2.ccohs.ca}}</ref> Similar reactions have been recorded in Pirbright White guinea pigs.<ref>Hazardous Substances Data Bank (HSDB). National Library of Medicine. Accessed December 2015 at |
|
|
http://toxnet.nlm.nih.gov</ref> However, p-Chlorocresol has also been used as a disinfectant to reduce the infectivity levels of hamsters infected with scrapies,<ref name="cambridge"/> showing its effectiveness as an antiseptic even in animals. |
|
|
|
|
|
A Committee for Veterinary Medicinal Products found p-Chlorocresol to be rapidly metabolized and excreted with no potential to accumulate in tissues and of low toxicity. In rats, up to 95% of the p-Chlorocresol was excreted via the urine and 0.4% in the faeces within 24 hours.<ref name="indu"/> |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ] - also used as an antiseptic and disinfectant |
|
|
* ] - Structural similarity |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Chlorocresol, p-}} |
|
{{DEFAULTSORT:Chlorocresol, p-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|