| Revision as of 11:40, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 456515092 of page Pentagastrin for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 11:36, 19 December 2023 edit JWBE (talk | contribs)Extended confirmed users10,129 edits added Category:Tert-Butyl esters using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 411404973 |
|
| verifiedrevid = 464198043 |
|
| IUPAC_name = ''N''-(isobutoxycarbonyl)-β-alanyl-<small>L</small>-tryptophyl-<small>L</small>-methionyl-<small>L</small>-α-aspartyl-<small>L</small>-phenylalaninamide |
|
| IUPAC_name = ''N''-(tert-butoxycarbonyl)-β-alanyl-<small>L</small>-tryptophyl-<small>L</small>-methionyl-<small>L</small>-α-aspartyl-<small>L</small>-phenylalaninamide<ref>{{cite book|last1=Martindale|title=The extra pharmacopoeia|date=1993|publisher=Pharmaceutical Press|location=London|isbn=978-0853693000|edition=30th}}</ref> |
|
| image = Pentagastrin.png |
|
| image = Pentagastrin.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CONS|pentagastrin}} |
|
| Drugs.com = {{drugs.com|CONS|pentagastrin}} |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 10 minutes or less |
|
| elimination_half-life = 10 minutes or less |
|
|
|
|
| Line 24: |
Line 24: |
|
| ATC_prefix = V04 |
|
| ATC_prefix = V04 |
|
| ATC_suffix = CG04 |
|
| ATC_suffix = CG04 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 9853654 |
|
| PubChem = 9853654 |
|
| IUPHAR_ligand = 870 |
|
| IUPHAR_ligand = 870 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00183 |
|
| DrugBank = DB00183 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8029364 |
|
| ChemSpiderID = 8029364 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = EF0NX91490 |
|
| UNII = EF0NX91490 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 39: |
Line 39: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=37 | H=49 | N=7 | O=9 | S=1 |
|
| C=37 | H=49 | N=7 | O=9 | S=1 |
|
⚫ |
| smiles = O=C(N)(NC(=O)(NC(=O)(NC(=O)(NC(=O)CCNC(=O)OC(C)(C)C)Cc2c1ccccc1c2)CCSC)CC(=O)O)Cc3ccccc3 |
|
| molecular_weight = 767.893 g/mol |
|
| ⚫ |
| smiles = O=C(N)(NC(=O)(NC(=O)(NC(=O)(NC(=O)CCNC(=O)OC(C)(C)C)Cc2c1ccccc1nc2)CCSC)CC(=O)O)Cc3ccccc3 |
|
|
| InChI = 1/C37H49N7O9S/c1-37(2,3)53-36(52)39-16-14-30(45)41-28(19-23-21-40-25-13-9-8-12-24(23)25)34(50)42-26(15-17-54-4)33(49)44-29(20-31(46)47)35(51)43-27(32(38)48)18-22-10-6-5-7-11-22/h5-13,21,26-29,40H,14-20H2,1-4H3,(H2,38,48)(H,39,52)(H,41,45)(H,42,50)(H,43,51)(H,44,49)(H,46,47)/t26-,27-,28-,29-/m0/s1 |
|
|
| InChIKey = NEYNJQRKHLUJRU-DZUOILHNBP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C37H49N7O9S/c1-37(2,3)53-36(52)39-16-14-30(45)41-28(19-23-21-40-25-13-9-8-12-24(23)25)34(50)42-26(15-17-54-4)33(49)44-29(20-31(46)47)35(51)43-27(32(38)48)18-22-10-6-5-7-11-22/h5-13,21,26-29,40H,14-20H2,1-4H3,(H2,38,48)(H,39,52)(H,41,45)(H,42,50)(H,43,51)(H,44,49)(H,46,47)/t26-,27-,28-,29-/m0/s1 |
|
| StdInChI = 1S/C37H49N7O9S/c1-37(2,3)53-36(52)39-16-14-30(45)41-28(19-23-21-40-25-13-9-8-12-24(23)25)34(50)42-26(15-17-54-4)33(49)44-29(20-31(46)47)35(51)43-27(32(38)48)18-22-10-6-5-7-11-22/h5-13,21,26-29,40H,14-20H2,1-4H3,(H2,38,48)(H,39,52)(H,41,45)(H,42,50)(H,43,51)(H,44,49)(H,46,47)/t26-,27-,28-,29-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NEYNJQRKHLUJRU-DZUOILHNSA-N |
|
| StdInChIKey = NEYNJQRKHLUJRU-DZUOILHNSA-N |
|
| synonyms = <small>(3''S'')-3-{carbamoyl}-3-amino}propanamido)propanamido]-4-(methylsulfanyl)butanamido]propanoic acid</small> |
|
|
}} |
|
}} |
|
|
|
|
|
'''Pentagastrin''' (trade name '''Peptavlon''') is a synthetic ] that has effects like ] when given ]ly.<ref>{{cite journal | vauthors = Braganza JM, Herman K, Hine P, Kay G | title = The effect of pentagastrin (I.C.I. 50, 123) on peptic secretion in man | journal = The Journal of Physiology | volume = 289 | pages = 9–16 | date = April 1979 | pmid = 379305 | pmc = 1281354 | doi = 10.1113/jphysiol.1979.sp012721 }}</ref> It stimulates the ] of ], ], and ], and has been used as a ] aid as the ]. |
|
|
|
|
|
Pentagastrin binds to the ]-B receptor, which is expressed widely in the brain. Activation of these receptors activates the ] second messenger system. When given ] it may cause ] attacks.<ref>{{cite journal | vauthors = van Megen HJ, Westenberg HG, den Boer JA, Haigh JR, Traub M | title = Pentagastrin induced panic attacks: enhanced sensitivity in panic disorder patients | journal = Psychopharmacology | volume = 114 | issue = 3 | pages = 449–55 | date = April 1994 | pmid = 7855203 | doi = 10.1007/bf02249335 | s2cid = 1565309 }}</ref> |
|
|
|
|
|
Pentagastrin's ] chemical name is "N-((1,1-dimethylethoxy)carbonyl)-beta-alanyl-L-tryptophyl-L-methionyl-L-alpha-aspartyl-L-phenylalaninamide". |
|
|
|
|
|
==Pentagastrin stimulation test== |
|
|
Pentagastrin is also used as a stimulation test to elevate of several hormones, such as ]. It provokes flushing and is useful in evaluating patients who describe flushing, but have normal or only marginally elevated biochemical markers for ].{{cn|date=April 2022}} |
|
|
|
|
|
It has been used to stimulate ectopic gastric mucosa for the detection of ] by ].{{cn|date=April 2022}} |
|
|
|
|
|
===Calcitonin test=== |
|
|
The '''pentagastrin-stimulated calcitonin test''' is a diagnostic test for ] (MTC). MTC is a malignancy of the ]-secreting cells of the ], and thus MTC is commonly associated with an elevated calcitonin level, but an elevated level may not always be obvious. The pentagastrin-stimulated calcitonin test is useful in cases of suspected MTC that are not associated with elevated calcitonin. In these patients, injecting pentagastrin will cause calcitonin levels to rise significantly above the normal or basal range.<ref>{{cite journal | vauthors = Barbot N, Calmettes C, Schuffenecker I, Saint-André JP, Franc B, Rohmer V, Jallet P, Bigorgne JC | display-authors = 6 | title = Pentagastrin stimulation test and early diagnosis of medullary thyroid carcinoma using an immunoradiometric assay of calcitonin: comparison with genetic screening in hereditary medullary thyroid carcinoma | journal = The Journal of Clinical Endocrinology and Metabolism | volume = 78 | issue = 1 | pages = 114–20 | date = January 1994 | pmid = 7904611 | doi = 10.1210/jcem.78.1.7904611 }}</ref> After a total ] for ], the pentagastrin-stimulated ] release can be used to detect residual ]. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Diagnostic agents}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |