Revision as of 11:44, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 459436990 of page Pentostatin for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 13:24, 17 June 2024 edit 2.101.54.127 (talk) →Synthesis |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 459435990 |
|
| verifiedrevid = 464198455 |
|
| IUPAC_name = (8''R'')-3-(2-deoxy-β-<small>D</small>-''erythro''-pentofuranosyl)-3,6,7,8-tetrahydroimidazodiazepin-8-ol |
|
| IUPAC_name = (R)-3-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-3,6,7,8-tetrahydroimidazodiazepin-8-ol |
|
| image = Pentostatin skeletal.svg |
|
| image = Pentostatin structure.svg |
|
| width = 200 |
|
| width = 200 |
|
|
| image2 = Pentostatin ball-and-stick.png |
|
|
|
|
|
| width2 = 200 |
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Nipent |
|
| tradename = Nipent |
|
| Drugs.com = {{drugs.com|monograph|pentostatin}} |
|
| Drugs.com = {{drugs.com|monograph|pentostatin}} |
|
| MedlinePlus = a692004 |
|
| MedlinePlus = a692004 |
|
| pregnancy_category = |
|
| pregnancy_US = D |
|
|
| legal_CA = Rx-only |
|
|
| legal_UK = POM |
|
| legal_US = Rx-only |
|
| legal_US = Rx-only |
|
| routes_of_administration = ] |
|
| routes_of_administration = ] |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = n/a |
|
| bioavailability = n/a |
Line 20: |
Line 22: |
|
| metabolism = ], minor |
|
| metabolism = ], minor |
|
| elimination_half-life = 2.6 to 16 hours, mean 5.7 hours |
|
| elimination_half-life = 2.6 to 16 hours, mean 5.7 hours |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 4805 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 53910-25-1 |
|
| CAS_number = 53910-25-1 |
Line 28: |
Line 29: |
|
| ATC_suffix = XX08 |
|
| ATC_suffix = XX08 |
|
| PubChem = 439693 |
|
| PubChem = 439693 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00552 |
|
| DrugBank = DB00552 |
|
|
| ChEBI = 27834 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 388759 |
|
| ChemSpiderID = 388759 |
Line 38: |
Line 40: |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1580 |
|
| ChEMBL = 1580 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=16 | N=4 | O=4 |
|
| C=11 | H=16 | N=4 | O=4 |
|
| molecular_weight = 268.269 g/mol |
|
|
| smiles = n1c3c(n(c1)2O((O)C2)CO)N\C=N/C3O |
|
| smiles = n1c3c(n(c1)2O((O)C2)CO)N\C=N/C3O |
|
| InChI = 1/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9+/m0/s1 |
|
|
| InChIKey = FPVKHBSQESCIEP-JQCXWYLXBA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9+/m0/s1 |
|
| StdInChI = 1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9+/m0/s1 |
Line 50: |
Line 48: |
|
| StdInChIKey = FPVKHBSQESCIEP-JQCXWYLXSA-N |
|
| StdInChIKey = FPVKHBSQESCIEP-JQCXWYLXSA-N |
|
}} |
|
}} |
|
|
'''Pentostatin''' (or '''deoxycoformycin''', trade name '''Nipent''', manufactured by SuperGen) is an anticancer ] drug.<ref name="pmid17008537">{{cite journal |vauthors=Kay NE, Geyer SM, Call TG, etal |title=Combination chemoimmunotherapy with pentostatin, cyclophosphamide, and rituximab shows significant clinical activity with low accompanying toxicity in previously untreated B chronic lymphocytic leukemia |journal=Blood |volume=109 |issue=2 |pages=405–11 |date=January 2007 |pmid=17008537 |pmc=1785105 |doi=10.1182/blood-2006-07-033274 |url=}}</ref> |
|
|
|
|
|
==Mechanism== |
|
|
It is classified as a ], which is a type of ]. |
|
|
|
|
|
It mimics the ] ] and thus inhibits the enzyme ], interfering with the cell's ability to process DNA.<ref name="pmid18721115">{{cite journal |vauthors=Sauter C, Lamanna N, Weiss MA |title=Pentostatin in chronic lymphocytic leukemia |journal=Expert Opin Drug Metab Toxicol |volume=4 |issue=9 |pages=1217–22 |date=September 2008 |pmid=18721115 |doi=10.1517/17425255.4.9.1217 }}</ref> |
|
|
|
|
|
] cells generally divide more often than healthy cells; DNA is highly involved in cell division (]) and drugs which target DNA-related processes are therefore more toxic to cancer cells than healthy cells. |
|
|
|
|
|
==Uses== |
|
|
Pentostatin is used to treat ].<ref name="pmid18798068">{{cite journal |vauthors=Cannon T, Mobarek D, Wegge J, Tabbara IA |title=Hairy cell leukemia: current concepts |journal=Cancer Invest. |volume=26 |issue=8 |pages=860–5 |date=October 2008 |pmid=18798068 |doi=10.1080/07357900801965034 }}</ref> It is given by ] infusion once every two weeks for three to six months. |
|
|
|
|
|
Additionally, pentostatin has been used to treat steroid-refractory acute and chronic ].<ref name="PMID15837980">{{cite journal |vauthors=Bolaños-Meade J, Jacobsohn DA, Margolis J, Ogden A, Wientjes MG, Byrd JC, Lucas DM, Anders V, Phelps M, Grever MR, Vogelsang GB |title=Pentostatin in steroid-refractory acute graft-versus-host disease |journal=J Clin Oncol |volume=23 |issue=12 |pages=2661–8 |date=April 2005 |pmid=15837980 |doi=10.1200/JCO.2005.06.130|doi-access=free }}</ref> |
|
|
|
|
|
Pentostatin is also used in ] (CLL) patients who have relapsed. |
|
|
==Synthesis== |
|
|
This is the original synthetic pathway although improvements were made. |
|
|
Original synthesis:<ref>Baker, D. C., Putt, S. R. (September 1979). "A total synthesis of pentostatin, the potent inhibitor of adenosine deaminase". Journal of the American Chemical Society. 101 (20): 6127–6128. doi:10.1021/ja00514a048.</ref><ref>Showalter, H.D.Hollis; Putt, Sterling R (1981). "Studies related to the total synthesis of pentostatin: An efficient, regiospecific glycosylation of 6,7-dihydroimidazodiazepin-8(3H)-one and related homologs.". Tetrahedron Letters. 22 (33): 3155–3158. doi:10.1016/S0040-4039(01)81851-7.</ref><ref>Chan, Eunice; Putt, Sterling R.; Showalter, H. D. Hollis; Baker, David C. (1982). "Total synthesis of (8R)-3-(2-deoxy-.beta.-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazodiazepin-8-ol (pentostatin), the potent inhibitor of adenosine deaminase". The Journal of Organic Chemistry. 47 (18): 3457–3464. doi:10.1021/jo00139a015.</ref><ref>Baker, David C.; Putt, Sterling R.; Showalter, H. D. Hollis (1983). "Studies related to the total synthesis of pentostatin. Approaches to the synthesis of (8R)-3,6,7,8-tetrahydroimidazo-diazepin-8-ol andN-3 alkyl congeners". Journal of Heterocyclic Chemistry. 20 (3): 629–634. doi:10.1002/jhet.5570200324.</ref><ref>Tunac, J. B.; Underhill, M. (1985). "2'-Chloropentostatin: Discovery, fermentation and biological activity.". The Journal of Antibiotics. 38 (10): 1344–1349. doi:10.7164/antibiotics.38.1344.</ref> Patents:<ref>Kusakabe Hitoshi & Kodama Kenjirou (+4), JPS52128292 (1977-10-27 to Yamasa Shoyu Kk); CA, 88,73015</ref><ref>GB2005661 idem David C. Baker & Sterling R. Putt, US4117229 (1978 to Warner Lambert Co LLC).</ref><ref>David C. Baker & Sterling R. Putt, US4195176 (1980 to Warner Lambert Co LLC).</ref><ref>Pasit Phiasivongsa, Sanjeev Redkar, WO2005027838 (2005 to Supergen, Inc.).</ref><ref>Oleksandr Zabudkin, Christian Schickaneder, Iaroslav Matviienko, Volodymyr Sypchenko, WO2017005784 (2017 to Synbias Pharma Ag).</ref>]] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |