Revision as of 13:14, 8 August 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits unnecessary product placement← Previous edit |
Latest revision as of 19:14, 12 November 2024 edit undoHoldenVoelger (talk | contribs)2 editsNo edit summary |
(155 intermediate revisions by 68 users not shown) |
Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 417474450 |
|
| verifiedrevid = 443675632 |
|
| ImageFileL1 = Novec-1230-2D-skeletal.png |
|
| ImageFileL1 = Novec-1230-2D-skeletal.png |
|
⚫ |
| ImageFileR1 = Novec-1230-3D-balls.png |
|
| ImageSizeL1 = 150 |
|
|
|
| PIN = 1,1,1,2,2,4,5,5,5-Nonafluoro-4-(trifluoromethyl)pentan-3-one |
⚫ |
| ImageFileR1 = Novec-1230-3D-balls.png |
|
|
⚫ |
| OtherNames = FK-5-1-12 (] name),<br>C6K,<br>perfluoro(2-methyl-3-pentanone),<br>heptafluoroisopropyl pentafluoroethyl ketone,<br>waterless water,<br>dry water |
|
| ImageSizeR1 = 150 |
|
|
| IUPACName = |
|
⚫ |
| OtherNames = perfluoro(2-methyl-3-pentanone), heptafluoroisopropyl pentafluoroethyl ketone, |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = FK |
⚫ |
| CASNo = 756-13-8 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem = 2782408 |
|
|
⚫ |
| CASNo = 756-13-8 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 2782408 |
⚫ |
| ChemSpiderID = 2062563 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| SMILES = FC(F)(F)C(F)(C(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
|
|
⚫ |
| ChemSpiderID = 2062563 |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| SMILES = FC(F)(F)C(F)(C(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
⚫ |
| StdInChI=1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C6F12O/c7-2(4(10,11)12,5(13,14)15)1(19)3(8,9)6(16,17)18 |
⚫ |
| StdInChIKey = RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
⚫ |
}} |
|
|
⚫ |
| StdInChIKey = RMLFHPWPTXWZNJ-UHFFFAOYSA-N |
|
⚫ |
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=6|F=12|O=1 |
|
| C=6|F=12|O=1 |
|
| Appearance = |
|
| Appearance = Clear, colorless |
|
|
| Odor = Near odorless |
|
| Density = 1.723 g/cm<sup>3</sup> |
|
| Density = 1,610{{nbsp}}kg/m<sup>3</sup> |
|
| MeltingPtC = −108 |
|
|
| BoilingPtC = 49 |
|
| MeltingPtC = −108 |
|
| Solubility = }} |
|
| BoilingPtC = 49 |
|
|
| Solubility = |
|
|
| Viscosity = 0.64{{nbsp}}cP |
|
|
| VaporPressure = 40.4{{nbsp}}kPa @ 25 °C |
|
|
| ThermalConductivity = 0.059 W/m-K |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Perfluoro(2-methyl-3-pentanone)''' is a ] ] with the structural formula CF<sub>3</sub>CF<sub>2</sub>C(=O)CF(CF<sub>3</sub>)<sub>2</sub>, a fully-fluorinated analog of ]. It is used as an electronics coolant liquid and fire protection fluid sold commercially by ] under brand names such as '''Novec 1230''', '''Novec 649''', and '''FK-5-1-12'''. It is also known as “waterless water” or “dry water”. |
|
'''Novec 1230''', C<sub>6</sub>F<sub>12</sub>O, (] Novec 1230) fluid is an environmentally friendly ] replacement for use as a ] agent. Novec 1230 is manufactured by ]. It is generally used in situations where water from a ] would damage expensive equipment or where water-based fire protection is impractical, such as ]s, ]s, ]s and ]s. 3M Novec 1230 fluid does not deplete ] (] 0). |
|
|
|
|
|
|
|
==Applications== |
|
Novec 1230 fluid is a high molecular weight material, compared with the first generation halocarbon clean agents. The product has a heat of vaporization of 88.1 kJ/kga and low vapor pressure. Although it is a liquid at room temperature it gasifies immediately after being discharged in a total flooding system. |
|
|
|
3M produces perfluoro(2-methyl-3-pentanone) under different brand names of '''Novec 1230''' and '''Novec 649'''. These two products have different purity grades (>99% and >99.9%, respectively)<ref name="CERN-1">{{cite web |url= https://twiki.cern.ch/twiki/pub/LHCb/C6K/Novec_Memo_1.2.pdf |title= 3M Novec 649 as a replacement of C6F14 in liquid cooling systems |website= |publisher= CERN |access-date= April 8, 2021}}</ref> intended for different industrial applications. |
|
|
|
|
|
|
===Novec 1230 and FK-5-1-12=== |
|
The product is ideal for use in total flooding applications, localized flooding systems, directional spray type applications and may be used in portable extinguishers for specialized applications. But in addition to the conventional methods of super-pressurization using nitrogen, Novec 1230 fluid also lends itself for use in pump applications because it is a liquid. |
|
|
|
Novec 1230 is used as ] agent in scenarios where water-based fire suppression (for example, from a ]) would be impractical or where it could damage expensive equipment or property, such as ]s, ]s, ]s, ]s and ]s. It functions by rapidly removing heat to extinguish a fire before it starts; also, its density enables it to displace air and thereby deprive the fire of oxygen. Novec 1230 can be used in both total/partial/localized flooding systems, and directional spray-type applications; it is also used in portable extinguishers for specialized applications. The Patent for Novec 1230 as fire extinguishant ended on July 19, 2020.<ref>{{cite web |url= https://patents.google.com/patent/EP1261398B1/en?q=Novec1230&assignee=3M |title= Use of fluorinated ketones in fire extinguishing compositions |website= Google Patents |publisher= 3M Innovative Properties Co |access-date= April 8, 2021}}</ref> Since the expiry of the patent, multiple companies have brought equivalent products to market under the chemical name FK-5-1-12. |
|
|
|
|
|
|
Recently, it has found active use in ] form<ref>{{Cite journal|last1=Alexandra|first1=Sertsova|last2=Sergei|first2=Krasilnikov|last3=Lee|first3=Sang-Sup|last4=Kim|first4=Jong-Sang|date=2019-10-31|title=The Effect of Epoxy Resin on the Properties of Encapsulated Fire Extinguishing Agent|journal=Fire Science and Engineering|language=English|volume=33|issue=5|pages=19–27|doi=10.7731/KIFSE.2019.33.5.019|issn=1738-7167|doi-access=free}}</ref><ref>{{Cite web|title=WO2020189900A1|url=https://worldwide.espacenet.com/patent/search/family/071141873/publication/WO2020189900A1?q=WO2020189900A1|access-date=2021-08-28|website=worldwide.espacenet.com}}</ref> in the manufacture of fire-extinguishing composite materials.<ref>{{Citation|title=Пожаротушащий композиционный материал на основе микрокапсулированного Novec 1230|url=https://www.youtube.com/watch?v=GUtWKFjMSNM| archive-url=https://ghostarchive.org/varchive/GUtWKFjMSNM?url=https://www.youtube.com/watch?v=GUtWKFjMSNM| archive-date=2021-10-23|language=en|access-date=2021-08-28}}{{cbignore}}</ref> ] is using this product to extinguish fires in the early stages of modular high-capacity storage systems (ESS) based on ] for ] and ]. In August 2019, Samsung SDI officially announced<ref>{{Cite web|last=Su-hyun|first=Song|date=2019-10-24|title=Samsung SDI demonstrates fire-safe ESS|url=http://www.koreaherald.com/view.php?ud=20191024000784|access-date=2021-08-28|website=The Korea Herald|language=en}}</ref> its investment of $ 169 million into fire-extinguishing composite materials based on microencapsulated Novec 1230. The firm later reported that UL9540A testing for this product was passed. |
|
Novec 1230 fluid is based on a proprietary chemistry from 3M called C6-fluoroketone; it is also known as dodecafluoro-2-methylpentane-3-one; its ASHRAE nomenclature is FK 5-1-12 — the way it is designated in NFPA 2001 and ISO 14520 clean agent standards. |
|
|
|
|
|
|
|
===Novec 649=== |
|
Chemically, it is a ] ] with the systematic name 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)-3-pentanone and the structural formula CF<sub>3</sub>CF<sub>2</sub>C(=O)CF(CF<sub>3</sub>)<sub>2</sub>, a fully fluorinated analog of ]. |
|
|
|
Novec 649 is a low-temperature heat-transfer fluid. It has been used as a ] in a proof of concept data center cooling system by ] and ].<ref>{{cite web |url= http://www.itworld.com/hardware/413707/intel-and-sgi-test-full-immersion-cooling-servers |title= Intel and SGI test full-immersion cooling for servers |website= ITworld |publisher= |access-date= April 8, 2021 |archive-url= https://archive.today/20140410121852/http://www.itworld.com/hardware/413707/intel-and-sgi-test-full-immersion-cooling-servers |archive-date=2014-04-10 |url-status=dead}}</ref> Due to its relatively low {{convert|49|°C|°F|1}} boiling point, it is used as a heat transfer fluid in two-phase immersion cooling systems. Within these systems ] is utilized to remove excess heat generated from immersed technology. The heat is then removed from the vaporous Novec 649 using a condensing loop typically running cold water. Novec 649 is also being considered to be used for cooling silicon photomultiplier (SiPM) sensors to {{convert|-40|°C|°F}} in single-phase configuration as part of ] ].<ref name="CERN-3">{{cite web |url=https://agenda.infn.it/event/17801/contributions/99220/attachments/67167/82428/LHCbSiPMWorkshop.pdf |title= Silicon Photomultipliers in the Scintillating Fibre Tracker at the LHCb experiment |website= |publisher= CERN |access-date= April 10, 2021}}</ref> |
|
|
|
|
|
|
Traditional ] (PFC) based compounds used for cooling, such as ], display high ]s (GWPs), typically 5,000 to 10,000 times that of CO<sub>2</sub>.<ref name="CERN-1" /> Novec 649 was chosen as a good drop-in replacement due to it having similar thermo-physical properties to Fluorinert FC-72 (], C6F14) while exhibiting a very low global warming potential of 1.<ref name="CERN-1" /><ref name="CERN-2">{{cite web |url=https://indico.cern.ch/event/444246/attachments/1151300/1652860/FI_presentation_8.09.2015.pdf |title= 3M Novec fluids as alternative to perfluorocarbons for detector cooling at CERN |website= |publisher= CERN |access-date= April 8, 2021}}</ref> |
⚫ |
==See also== |
|
⚫ |
*] |
|
|
|
|
|
|
==External links== |
|
==Environmental safety== |
|
|
Novec 649/1230 does not deplete ] (] 0) and has a ] of 1 (over 100 years), equivalent to that of ].<ref>{{cite web |url= https://multimedia.3m.com/mws/media/311627O/3mtm-novectm-1230-fire-protection-fluid-environmental-prop.pdf |title= Environmental properties of Novec 1230 Fluid |website= |publisher= 3M |access-date= April 8, 2021}}</ref> The Globally Harmonized System of Classification and Labeling of Chemicals (GHS) classifies this chemical as H412 - Harmful to aquatic life with long lasting effects.<ref>{{cite web |url= https://pubchem.ncbi.nlm.nih.gov/compound/Perfluoro_2-methyl-3-pentanone#section=Hazards-Identification |title= COMPOUND SUMMARY 3-Pentanone, 1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)- |website= PubChem |publisher= |access-date= April 8, 2021}}</ref> ] in sunlight, ] and ] may be a significant sink of Novec 649/1230 in the environment.<ref>{{cite web |url= https://tspace.library.utoronto.ca/bitstream/1807/35854/3/Jackson_Derek_A_201306_PhD_thesis.pdf |title= Hydrolysis and Atmospheric Oxidation Reactions of Perfluorinated Carboxylic Acid Precursors |website= |publisher= University of Toronto |access-date= April 8, 2021}}</ref> It has very short estimated atmospheric lifetime of around 4 to 15 days.<ref>{{cite web |url=https://multimedia.3m.com/mws/media/311627O/3mtm-novectm-1230-fire-protection-fluid-environmental-prop.pdf |title= Technical Brief, Environmental properties of Novec 1230 Fluid |website= |publisher= 3M |access-date= April 8, 2021}}</ref> |
|
|
|
|
|
|
Novec 649/1230 is classified as a ] substance. In December 2022, 3M announced that it would cease production of all PFAS products by 2025, including Novec 649/1230.<ref>{{cite web | url=https://news.3m.com/2022-12-20-3M-to-Exit-PFAS-Manufacturing-by-the-End-of-2025 | title=3M to Exit PFAS Manufacturing by the End of 2025 }}</ref> It degrades to ] (TFA) via photolytic degradation in sunlight. |
⚫ |
* |
|
|
* |
|
⚫ |
* |
|
|
* |
|
|
*, ''Science Daily'', August 1, 2008 |
|
|
* |
|
|
|
|
|
|
⚫ |
== See also == |
|
|
|
|
⚫ |
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
== References == |
|
|
<references /> |
|
|
|
|
|
== External links == |
|
|
|
|
|
* |
|
|
* |
|
⚫ |
* |
|
|
* |
|
⚫ |
* |
|
|
* |
|
|
* |
|
|
* |
|
|
|
|
|
{{3M|state=expanded}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|