Revision as of 13:22, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 418865587 of page SAICAR for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'ChEBI', 'KEGG', 'StdInChI', 'StdInChIKey', 'CASNo'). |
Latest revision as of 21:28, 7 November 2024 edit Ow0cast (talk | contribs)Extended confirmed users, Rollbackers940 edits Restoring revision 1247361471 by 2601:2C7:C302:7F30:706B:5508:7DB9:9162: rm unrelated content (UV 0.1.6)Tags: Ultraviolet Undo |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Name = Phosphoribosylaminoimidazolesuccinocarboxamide |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 464385050 |
|
| Watchedfields = changed |
|
|
⚫ |
| ImageFile = SAICAR.png |
⚫ |
| verifiedrevid = 401045950 |
|
|
⚫ |
| ImageFile_Ref = {{Chemboximage|correct|??}} |
⚫ |
| ImageFile = SAICAR.png |
|
|
⚫ |
| ImageSize = 200px |
⚫ |
| ImageFile_Ref = {{Chemboximage|correct|??}} |
|
|
⚫ |
| SystematicName = PP(2''S''<nowiki>)-(5-Amino-1-{(2</nowiki>''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-oxolan-2-yl}-1''H''-imidazole-4-carboxamido)butanedioic acid |
⚫ |
| ImageSize = 244 |
|
|
⚫ |
| OtherNames = SAICAR; 2-oxolan-2-yl}imidazol-4-yl)formamido]butanedioic acid; ''N''-<nowiki/>{carbonyl}-<small>L</small>-aspartic acid |
|
| ImageName = Stereo structural formula of SAICAR ((2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl) |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
⚫ |
| IUPACName = SAICAR |
|
|
|
| CASNo = 3031-95-6 |
⚫ |
| SystematicName = 2-oxolan-2-yl}-1''H''-imidazol-4-yl)formamido]butanedioic acid |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| OtherNames = 2-oxolan-2-yl}imidazol-4-yl)formamido]butanedioic acid |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| UNII = K1PVR64RIF |
|
| CASNo = <!-- blanked - oldvalue: 3031-95-6 --> |
|
|
⚫ |
| PubChem = 160666 |
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
| ChemSpiderID = 141175 |
|
| CASNo_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| PubChem = 981 |
|
|
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| PubChem1 = 440498 |
|
| KEGG = C04823 |
|
⚫ |
| MeSHName = SAICAR |
|
| PubChem1_Ref = {{Pubchemcite|correct|PubChem}} |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| PubChem1_Comment = <small>(2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
| PubChem2 = 160666 |
|
| ChEBI = 18319 |
|
⚫ |
| 3DMet = B05149 |
|
| PubChem2_Ref = {{Pubchemcite|correct|PubChem}} |
|
|
|
| SMILES = O=C(O)C(C(=O)O)NC(=O)c1ncn(c1N)2O((O)2O)COP(=O)(O)O |
|
| PubChem2_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
⚫ |
| StdInChI=1S/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1 |
|
| PubChem3 = 6914598 |
|
|
| PubChem3_Ref = {{Pubchemcite|correct|PubChem}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| InChI = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1 |
|
| PubChem3_Comment = <small>(2''S'')-2-formamido, (2''R'',3''S'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
⚫ |
| InChIKey = NAQGHJTUZRHGAC-ZZZDFHIKBX |
⚫ |
| ChemSpiderID = 141175 |
|
|
⚫ |
| StdInChIKey = NAQGHJTUZRHGAC-ZZZDFHIKSA-N |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| ChemSpiderID1 = 389419 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID1_Comment = <small>(2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
| ChemSpiderID2 = 141175 |
|
|
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID2_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
| ChemSpiderID3 = 5290480 |
|
|
| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID3_Comment = <small>(2''S'')-2-formamido, (2''R'',3''S'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small> |
|
|
| KEGG = <!-- blanked - oldvalue: C04823 --> |
|
|
| MeSHName = SAICAR |
|
|
| ChEBI = <!-- blanked - oldvalue: 18319 --> |
|
⚫ |
| 3DMet = B04963 |
|
|
| SMILES = NC1=C(N=CN1C1OC(COP(O)(O)=O)C(O)C1O)C(=O)NC(CC(O)=O)C(O)=O |
|
⚫ |
| StdInChI = 1S/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| InChI = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1/f/h16,18,23,25-26H |
|
⚫ |
| InChI1 = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1 |
|
⚫ |
| StdInChIKey = NAQGHJTUZRHGAC-ZZZDFHIKSA-N |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| InChIKey = NAQGHJTUZRHGAC-ZZZDFHIKBX}} |
|
⚫ |
| Section2 = {{Chembox Properties |
|
|
| C = 13 |
|
|
| H = 19 |
|
|
| N = 4 |
|
|
| O = 12 |
|
|
| P = 1 |
|
|
| ExactMass = 454.073708604 g mol<sup>-1</sup>}} |
|
|
}} |
|
}} |
|
⚫ |
| Section2 = {{Chembox Properties |
|
|
| C=13 | H=19 | N=4 | O=12 | P=1 }} |
|
|
}} |
|
|
|
|
|
'''Phosphoribosylaminoimidazolesuccinocarboxamide''' (''SAICAR'') is an intermediate in the formation of ]s. The conversion of ATP, L-], and ] (CAIR) to 5-aminoimidazole-4-(N-succinylcarboxamide) ribonucleotide, ADP, and ] by ] (''SAICAR synthetase'') represents the eighth step of de novo ] biosynthesis.<ref>{{cite journal |title = Mechanism of Action of Escherichia coli Phosphoribosylaminoimidazolesuccinocarboxamide Synthetase |author1=Scott W. Nelson |author2=Daniel J. Binkowski |author3=Richard B. Honzatko |author4=Herbert J. Fromm |journal = Biochemistry |year = 2005 |volume = 44 |pages = 766–774 |doi = 10.1021/bi048191w |issue = 2 |pmid = 15641804|s2cid=41673787 |url=https://lib.dr.iastate.edu/cgi/viewcontent.cgi?article=1081&context=bbmb_ag_pubs }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Nucleotide metabolism intermediates}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{Organic-compound-stub}} |