| Revision as of 14:29, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 449586628 of page Propallylonal for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 07:41, 7 December 2023 edit Buidhe (talk | contribs)Autopatrolled, Extended confirmed users, Page movers, File movers, Mass message senders, New page reviewers, Pending changes reviewers, Template editors136,129 editsm Removing from Category:GABAA receptor positive allosteric modulators in subcat using Cat-a-lot |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 447739121 |
|
| verifiedrevid = 464215920 |
|
| IUPAC_name = 5-(2-bromoprop-2-en-1-yl)-5-isopropylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
|
| IUPAC_name = 5-(2-bromoprop-2-en-1-yl)-5-isopropylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
|
| image = Propallylonal.svg |
|
| image = Propallylonal.svg |
| Line 12: |
Line 13: |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = Schedule IV |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 545-93-7 --> |
|
| CAS_number = 545-93-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 1ER3Z9GUQH |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 37: |
Line 41: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=13 | Br=1 | N=2 | O=3 |
|
| C=10 | H=13 | Br=1 | N=2 | O=3 |
|
| molecular_weight = 289.126 g/mol |
|
|
| smiles = O=C1NC(=O)NC(=O)C1(C(C)C)CC(\Br)=C |
|
| smiles = O=C1NC(=O)NC(=O)C1(C(C)C)CC(\Br)=C |
|
| InChI = 1/C10H13BrN2O3/c1-5(2)10(4-6(3)11)7(14)12-9(16)13-8(10)15/h5H,3-4H2,1-2H3,(H2,12,13,14,15,16) |
|
|
| InChIKey = KTGWBBOJAGDSHN-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H13BrN2O3/c1-5(2)10(4-6(3)11)7(14)12-9(16)13-8(10)15/h5H,3-4H2,1-2H3,(H2,12,13,14,15,16) |
|
| StdInChI = 1S/C10H13BrN2O3/c1-5(2)10(4-6(3)11)7(14)12-9(16)13-8(10)15/h5H,3-4H2,1-2H3,(H2,12,13,14,15,16) |
| Line 47: |
Line 48: |
|
| synonyms = 5-isopropyl-5-(β-bromoallyl)barbituric acid |
|
| synonyms = 5-isopropyl-5-(β-bromoallyl)barbituric acid |
|
}} |
|
}} |
|
|
|
|
|
'''Propallylonal''' (trade names '''Nostal''', '''Quietal''', '''Ibomal''') is a ] derivative invented in the 1920s.<ref>{{cite patent | country = US | number = 1622129 }}</ref> It has ], ] and ] properties,<ref name="pmid14794532">{{cite journal | vauthors = Holck HG, Riedesel CC, Robidoux FA | title = Studies on tolerance and cross-tolerance to Nostal (propallylonal; isopropyl-beta-bromallyl barbituric acid | journal = Journal of the American Pharmaceutical Association | volume = 39 | issue = 11 | pages = 630–7 | date = November 1950 | pmid = 14794532 | doi = 10.1002/jps.3030391109 }}</ref> and is still rarely prescribed as a sleeping medication in some Eastern-European countries. |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Sedatives}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
{{sedative-stub}} |