| Revision as of 19:50, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr |
Latest revision as of 17:09, 8 November 2023 edit OAbot (talk | contribs)Bots442,978 editsm Open access bot: doi updated in citation with #oabot. |
| Line 1: |
Line 1: |
|
|
{{Short description|Designer drug of the cathinone class}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 424949322 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one |
|
|
⚫ |
| verifiedrevid = 451555065 |
|
| image = Eutylone_structure.png |
|
|
⚫ |
| IUPAC_name = 1-(1,3-benzodioxol-5-yl)-2-(propylamino)butan-1-one |
|
|
|
|
|
| image = Propylbutylone.svg |
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
|
| legal_BR = F2 |
|
|
| legal_CA = Schedule I |
|
|
| legal_DE = Anlage II |
|
|
| legal_UK = Class B |
|
|
| legal_US = Schedule I |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
| Line 15: |
Line 22: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = |
|
| CAS_number = 802855-66-9 |
|
|
|
|
|
| index_label = |
|
|
|
|
|
| index2_label = HCl |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 802286-81-3 |
|
|
|
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = 46BQ874756 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = 122129922 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
|
| UNII = 46BQ874756 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 480488897 |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=13 | H=17 | N=1 | O=3 |
|
| C=14 | H=19 | N=1 | O=3 |
|
|
| smiles = CCCNC(CC)C(=O)C1=CC2=C(C=C1)OCO2 |
|
| molecular_weight = 235.278 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| smiles = c2c1OCOc1ccc2C(=O)C(CC)NCC |
|
|
|
| StdInChI = 1S/C14H19NO3/c1-3-7-15-11(4-2)14(16)10-5-6-12-13(8-10)18-9-17-12/h5-6,8,11,15H,3-4,7,9H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NRIHOTHAMAUSRO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Putylone''' (also known as '''β-keto-1,3-benzodioxolyl-''N''-propyldioxybutanamine''', '''bk-PBDB''', and '''''N''-propylbutylone''') is a ] and ] compound detected in 2023,<ref>{{Cite journal | vauthors = Dixon DI, Millea MF, Wilcock AT, Costello A, Ellison JR, Lord S, O'Brian KA, Mewis RE, Sutcliffe OB |date= September 2023 |title=Synthesis, characterisation and quantification of the new psychoactive substance 1-(1,3-benzodioxol-5-yl)-2-(propylamino)butan-1-one (bk-PBDB, putylone) |journal=Forensic Chemistry |volume=35 |pages=100523 |doi=10.1016/j.forc.2023.100523 |s2cid= 260833005 |issn=2468-1709|doi-access=free }}</ref> around the time of a ban on the related compound ]. |
|
'''β-Keto-Ethylbenzodioxolylbutanamine''' ('''Eutylone''', '''bk-EBDB''') is a ] compound developed in the 1960s,<ref>Substituted phenyl-α-amino ketones. British Patent {{Cite patent|GB|1085135}} (1969).</ref> which has been reported as a novel ].<!-- another obscure cathinone that has shown up, probably one of the last before they are all banned! -->{{Citation needed|date=March 2010}} |
|
|
|
|
|
|
== Legal status == |
|
|
|
|
|
The specific legal status of putylone has not yet been addressed by any agency or government. |
|
|
|
|
|
Putylone is likely considered illegal in jurisdictions where similar analogues or psychoactive substances bans are in place, such as in the US, UK, and Ireland. |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
|
|
* ] |
|
* ] |
|
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Entactogens|state=expanded}} |
|
|
|
|
{{Stimulants}} |
|
{{Stimulants}} |
|
{{Adrenergics}} |
|
|
{{Serotonergics}} |
|
|
{{Phenethylamines}} |
|
{{Phenethylamines}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |