| Revision as of 22:09, 3 January 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,177 editsm Journal cites:, added 1 DOIs, using AWB (7524)← Previous edit |
Latest revision as of 18:09, 17 January 2025 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,886 editsm Added UNII ID |
| (22 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 405764469 |
|
| IUPAC_name = 4-amino-''N''--benzenesulfonamide |
|
| IUPAC_name = 4-amino-''N''--benzenesulfonamide |
|
| image = Ro04-6790_structure.png |
|
|
|
| image = Ro 04-6790.svg |
| ⚫ |
| CAS_number = 202466-68-0 |
|
|
|
|
| ⚫ |
| ATC_prefix = none |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_suffix = |
|
|
|
| tradename = |
| ⚫ |
| PubChem = 5312145 |
|
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 202466-68-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = CU78RAR5ZH |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 5312145 |
|
|
| ChemSpiderID = 4471575 |
|
| IUPHAR_ligand = 274 |
|
| IUPHAR_ligand = 274 |
|
|
| ChEMBL = 433461 |
|
| C = 12 | H = 16 | N = 6 | O = 2 | S = 1 |
|
|
|
|
|
| molecular_weight = 308.359 g/mol |
|
|
|
<!--Chemical data--> |
| ⚫ |
| smiles = Nc2ccc(cc2)S(=O)(=O)Nc1cc(NC)nc(NC)n1 |
|
|
| bioavailability = |
|
| C=12 | H=16 | N=6 | O=2 | S=1 |
|
⚫ |
| smiles = Nc2ccc(cc2)S(=O)(=O)Nc1cc(NC)nc(NC)n1 |
| ⚫ |
| metabolism = |
|
|
|
| StdInChI = 1S/C12H16N6O2S/c1-14-10-7-11(17-12(15-2)16-10)18-21(19,20)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H3,14,15,16,17,18) |
| ⚫ |
| elimination_half-life = |
|
|
|
| StdInChIKey = JELFWSXQTXRMAJ-UHFFFAOYSA-N |
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Ro04-6790''' is a ], developed by ], which has applications in ]. It acts as a ] and ] ] ] for the ] ] receptor subtype, with little or no ] at other ]s. In common with other drugs of this class,<ref>Fone KC. An update on the role of the 5-hydroxytryptamine6 receptor in cognitive function. ''Neuropharmacology''. 2008 Nov;55(6):1015-22. {{DOI|10.1016/j.neuropharm.2008.06.061}} PMID 18655798</ref> Ro04-6790 has ] effects in animals,<ref>King MV, Spicer CH, Sleight AJ, Marsden CA, Fone KC. Impact of regional 5-HT depletion on the cognitive enhancing effects of a typical 5-ht(6) receptor antagonist, Ro 04-6790, in the Novel Object Discrimination task. ''Psychopharmacology (Berlin)''. 2008 Oct 7. PMID 18839151</ref> and reduces the ] produced by ]-impairing drugs such as ]<ref>Pitsikas N, Zisopoulou S, Pappas I, Sakellaridis N. The selective 5-HT(6) receptor antagonist Ro 04-6790 attenuates psychotomimetic effects of the NMDA receptor antagonist MK-801. ''Behavioural Brain Research''. 2008 Apr 9;188(2):304-9. PMID 18164078</ref> and ].<ref>Woolley ML, Marsden CA, Sleight AJ, Fone KC. Reversal of a cholinergic-induced deficit in a rodent model of recognition memory by the selective 5-HT6 receptor antagonist, Ro 04-6790. ''Psychopharmacology (Berlin)''. 2003 Dec;170(4):358-67. PMID 13680084</ref> |
|
'''Ro 04-6790''' is a ], developed by ], which has applications in ]. It acts as a ] and ] ] ] for the ] ] receptor subtype, with little or no ] at other ]s. In common with other drugs of this class,<ref>{{cite journal | vauthors = Fone KC | title = An update on the role of the 5-hydroxytryptamine6 receptor in cognitive function | journal = Neuropharmacology | volume = 55 | issue = 6 | pages = 1015–22 | date = November 2008 | pmid = 18655798 | doi = 10.1016/j.neuropharm.2008.06.061 | s2cid = 35522597 }}</ref> Ro 04-6790 has ] effects in animals,<ref>{{cite journal | vauthors = King MV, Spicer CH, Sleight AJ, Marsden CA, Fone KC | title = Impact of regional 5-HT depletion on the cognitive enhancing effects of a typical 5-ht(6) receptor antagonist, Ro 04-6790, in the Novel Object Discrimination task | journal = Psychopharmacology | volume = 202 | issue = 1–3 | pages = 111–23 | date = January 2009 | pmid = 18839151 | doi = 10.1007/s00213-008-1334-1 | s2cid = 10826081 }}</ref> and reduces the ] produced by ]-impairing drugs such as ]<ref>{{cite journal | vauthors = Pitsikas N, Zisopoulou S, Pappas I, Sakellaridis N | title = The selective 5-HT(6) receptor antagonist Ro 04-6790 attenuates psychotomimetic effects of the NMDA receptor antagonist MK-801 | journal = Behavioural Brain Research | volume = 188 | issue = 2 | pages = 304–9 | date = April 2008 | pmid = 18164078 | doi = 10.1016/j.bbr.2007.11.010 | s2cid = 40183481 }}</ref> and ].<ref>{{cite journal | vauthors = Woolley ML, Marsden CA, Sleight AJ, Fone KC | title = Reversal of a cholinergic-induced deficit in a rodent model of recognition memory by the selective 5-HT6 receptor antagonist, Ro 04-6790 | journal = Psychopharmacology | volume = 170 | issue = 4 | pages = 358–67 | date = December 2003 | pmid = 13680084 | doi = 10.1007/s00213-003-1552-5 | s2cid = 25193679 | url = http://doc.rero.ch/record/317786/files/213_2003_Article_1552.pdf }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist|30em}} |
|
|
|
|
|
{{Nootropics}} |
|
|
{{Antidementia}} |
|
{{Antidementia}} |
|
{{Serotonergics}} |
|
{{Serotonergics}} |
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |