| Revision as of 18:44, 7 September 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Sakuranin is the -O-glucoside of sakuranetin.← Previous edit |
Latest revision as of 00:40, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (19 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 405878312 |
|
| verifiedrevid = 448979508 |
|
| Name = Sakuranin |
|
| Name = Sakuranin |
|
| ImageFile = Sakuranin.svg |
|
| ImageFile = Sakuranin structure.svg |
|
| ImageSize = 300px |
|
| ImageSize = 200px |
|
| ImageName = Sakuranin |
|
| ImageName = Sakuranin |
|
| IUPACName = <nowiki>(2R)-2-(4-hydroxyphenyl)-7-methoxy-5-[(2S,3R,4S,5S,6R)-3,4, |
|
| IUPACName = (2''S'')-5-(β-<small>D</small>-Glucopyranosyloxy)-4′-hydroxy-7-methoxyflavan-4-one |
|
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one</nowiki> |
|
| SystematicName = (2''S'')-2-(4-Hydroxyphenyl)-7-methoxy-5-{oxy}-2,3-dihydro-4''H''-1-benzopyran-4-one |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 529-39-5 |
|
|
| EINECS = |
|
| CASNo = 529-39-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
|
|
| PubChem = 73607 |
|
| UNII = 59YX7QWM4S |
|
|
| EINECS = |
|
⚫ |
| SMILES = COC1=CC(=C2C(=O)C(OC2=C1)C3=CC=C(C=C3)O)O4((((O4)CO)O)O)O |
|
|
| PubChem = 73607 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 66275 |
|
|
| InChI = 1/C22H24O10/c1-29-12-6-15-18(13(25)8-14(30-15)10-2-4-11(24)5-3-10)16(7-12)31-22-21(28)20(27)19(26)17(9-23)32-22/h2-7,14,17,19-24,26-28H,8-9H2,1H3/t14-,17+,19+,20-,21+,22+/m0/s1 |
|
|
| InChIKey = NEPMMBQHELYZIW-YMTXFHFDBM |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C22H24O10/c1-29-12-6-15-18(13(25)8-14(30-15)10-2-4-11(24)5-3-10)16(7-12)31-22-21(28)20(27)19(26)17(9-23)32-22/h2-7,14,17,19-24,26-28H,8-9H2,1H3/t14-,17+,19+,20-,21+,22+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NEPMMBQHELYZIW-YMTXFHFDSA-N |
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=22|H=24|O=10 |
|
| Formula = C<sub>22</sub>H<sub>24</sub>O<sub>10</sub> |
|
|
⚫ |
| MeltingPt = |
|
| MolarMass = 448.41 g/mol |
|
|
⚫ |
| Solvent = |
|
| ExactMass = 448.136947 u |
|
|
⚫ |
| SolubleOther = |
| ⚫ |
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| Solvent = |
|
| ⚫ |
| SolubleOther = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Sakuranin''' is a ], a type of flavonoid. It is the -O-glucoside of ]. It can be found in ''] sp.''<ref>Flavonoids of Various Prunus Species. IV. The Flavonoids in the Wood of Prunus donarium var. spontanea. Masao Hasegawa and Teruo Shirato, J. Am. Chem. Soc., 1955, 77 (13), pages 3557–3558, {{doi|10.1021/ja01618a039}}</ref> |
|
'''Sakuranin''' is a ], a type of flavonoid. It is the ''O''-] of ]. It can be found in ''] sp.''<ref>Flavonoids of Various Prunus Species. IV. The Flavonoids in the Wood of Prunus donarium var. spontanea. Masao Hasegawa and Teruo Shirato, J. Am. Chem. Soc., 1955, 77 (13), pages 3557–3558, {{doi|10.1021/ja01618a039}}</ref> |
|
|
|
|
|
<!-- ==Glycosides== |
|
<!-- ==Glycosides== |
| Line 33: |
Line 44: |
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscat-inline}} |
|
|
|
|
|
{{Flavanone}} |
|
{{Flavanone}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{phenol-stub}} |