| Revision as of 20:29, 20 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 01:01, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,895 edits add semisystematic name |
| (12 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 355696737 |
|
| verifiedrevid = 419853772 |
|
| Name = Sclarene |
|
| Name = Sclarene |
|
| ImageFile = Sclarene.svg |
|
| ImageFile = Sclarene.svg |
|
<!-- | ImageSize = 200px --> |
|
|
| ImageName = Sclarene |
|
| ImageName = Sclarene |
|
| IUPACName =? |
|
| IUPACName = Labda-8(20),13(16),14-triene |
|
|
| SystematicName = (4a''S'',5''S'',8a''S'')-1,1,4a-Trimethyl-6-methylidene-5-(3-methylidenepent-4-en-1-yl)decahydronaphthalene |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 511-02-4 |
|
|
| SMILES = |
|
| CASNo = 511-02-4 |
|
|
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
|
| UNII = 95E3AV9Y7E |
|
|
| ChEBI = 64281 |
|
|
| ChemSpiderID = 9498211 |
|
|
| PubChem = 11323257 |
|
|
| StdInChI=1S/C20H32/c1-7-15(2)9-11-17-16(3)10-12-18-19(4,5)13-8-14-20(17,18)6/h7,17-18H,1-3,8-14H2,4-6H3/t17-,18-,20+/m0/s1 |
|
|
| StdInChIKey = KYLKKZSVPLUGCC-CMKODMSKSA-N |
|
|
| SMILES = C12CCCC(1CCC(=C)2CCC(=C)C=C)(C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>20</sub>H<sub>32</sub> |
|
| C=20|H=32 |
|
| MolarMass = 272.47 g/mol |
|
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
| Line 18: |
Line 28: |
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Sclarene''' is a ] present in the foliage of '']''. |
|
|
|
|
|
|
⚫ |
'''Sclarene''' is a ] present in the foliage of '']''.<ref> {{dead link|date=June 2012}}</ref> |
| ⚫ |
] |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|