Revision as of 07:38, 19 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,563 editsNo edit summary← Previous edit |
Latest revision as of 03:52, 14 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
(42 intermediate revisions by 22 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
|ImageFile=Setoperone.png |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 449587261 |
⚫ |
|IUPACName=6--1-piperidinyl]ethyl]-7-methyl-2,3-dihydrothiazolopyrimidin-5-one |
|
|
⚫ |
| ImageFile=Setoperone.svg |
⚫ |
|OtherNames= |
|
|
|
| ImageClass = skin-invert-image |
|
⚫ |
| ImageSize=250px |
|
⚫ |
| PIN=6-{2-ethyl}-7-methyl-2,3-dihydro-5''H''-thiazolopyrimidin-5-one |
|
⚫ |
| OtherNames= |
|
|
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| CASNo=86487-64-1 |
|
|
|
| UNII = BQ67CS3Q3E |
⚫ |
| PubChem=68604 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=86487-64-1 |
|
⚫ |
| PubChem=68604 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02686 |
|
| KEGG = D02686 |
|
| SMILES=CC1=C(C(=O)N2CCSC2=N1)CCN3CCC(CC3)C(=O)C4=CC=C(C=C4)F |
|
| SMILES=CC1=C(C(=O)N2CCSC2=N1)CCN3CCC(CC3)C(=O)C4=CC=C(C=C4)F |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 61870 |
|
|
| InChI = 1/C21H24FN3O2S/c1-14-18(20(27)25-12-13-28-21(25)23-14)8-11-24-9-6-16(7-10-24)19(26)15-2-4-17(22)5-3-15/h2-5,16H,6-13H2,1H3 |
|
|
| InChIKey = RBGAHDDQSRBDOG-UHFFFAOYAH |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H24FN3O2S/c1-14-18(20(27)25-12-13-28-21(25)23-14)8-11-24-9-6-16(7-10-24)19(26)15-2-4-17(22)5-3-15/h2-5,16H,6-13H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RBGAHDDQSRBDOG-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>21</sub>H<sub>24</sub>FN<sub>3</sub>O<sub>2</sub>S |
|
| Formula=C<sub>21</sub>H<sub>24</sub>FN<sub>3</sub>O<sub>2</sub>S |
|
| MolarMass=401.50 g/mol |
|
| MolarMass=401.50 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|
|
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
Line 34: |
Line 53: |
|
| volume = 156 |
|
| volume = 156 |
|
| pages = 1029–1034 |
|
| pages = 1029–1034 |
|
| url = http://ajp.psychiatryonline.org/cgi/content/full/156/7/1029 |
|
| url = http://ajp.psychiatryonline.org/cgi/content/full/156/7/1029 |
|
| pmid = 10401447 |
|
| pmid = 10401447 |
|
| issue = 7 |
|
| issue = 7 |
|
| date = July 1, 1999 }}</ref> |
|
| date = July 1, 1999 | doi = 10.1176/ajp.156.7.1029 |
|
|
| s2cid = 453720 |
|
|
}}</ref> |
|
or ].<ref>{{Cite journal |
|
or ].<ref>{{Cite journal |
|
| author = ], Shitij Kapur, Corey Jones, Jean DaSilva, Gregory M. Brown, Alan A. Wilson, ] and Robert B. Zipursky |
|
| author = Ralph Lewis, Shitij Kapur, Corey Jones, Jean DaSilva, Gregory M. Brown, Alan A. Wilson, ] and Robert B. Zipursky |
|
| title = Serotonin 5-HT<sub>2</sub> Receptors in Schizophrenia: A PET Study Using [<sup>18</sup>F]Setoperone in Neuroleptic-Naive Patients and Normal Subjects |
|
| title = Serotonin 5-HT<sub>2</sub> Receptors in Schizophrenia: A PET Study Using [<sup>18</sup>F]Setoperone in Neuroleptic-Naive Patients and Normal Subjects |
|
| journal = ] |
|
| journal = ] |
|
| volume = 156 |
|
| volume = 156 |
|
| pages = 72–78 |
|
| pages = 72–78 |
|
| url = http://ajp.psychiatryonline.org/cgi/content/abstract/156/1/72 |
|
|
| pmid = 9892300 |
|
| pmid = 9892300 |
|
| issue = 1 |
|
| issue = 1 |
|
| date = January 1, 1999 }}</ref> |
|
| date = January 1, 1999 | doi = 10.1176/ajp.156.1.72 |
|
|
}}</ref> |
|
|
==Synthesis== |
|
|
</ref> Patent (Intermediate 11 & Ex 1):<ref>EP0070053 idem Ludo E. J. Kennis, Josephus C. Mertens, {{US patent|4443451}} (1984 to Janssen Pharmaceutica N.V.).</ref> Radiolabelled:<ref>Maziere, B.; Crouzel, C.; Venet, M.; Stulzaft, O.; Sanz, G.; Ottaviani, M.; Sejourne, C.; Pascal, O.; Bisserbe, J.C. (1988). "Synthesis, affinity and specificity of 18F-setoperone, a potential ligand for in-vivo imaging of cortical serotonin receptors". International Journal of Radiation Applications and Instrumentation. Part B. Nuclear Medicine and Biology. 15 (4): 463–468. doi:10.1016/0883-2897(88)90018-9.</ref>]] |
|
|
|
|
|
The starting material is called 6-(2-hydroxyethyl)-7-methyl-2,3-dihydro-thiazolopyrimidin-5-one, ('''1'''). Halogenation of this with hydrobromic acid in acetic acid gives ('''2'''). Sn2 alkylation with 4-(4-fluorobenzoyl)piperidine ('''3''') under Finkelstein reaction conditions affords setoperone ('''4'''). |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Serotonergics}} |
|
{{Antipsychotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
|
] |
|
⚫ |
] |
|
] |
|
] |
|
|
|
|
|
{{pharm-stub}} |
|
{{nervous-system-drug-stub}} |