| Revision as of 18:16, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 456950054 of page Sulfinpyrazone for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 23:16, 10 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 470473641 |
|
| Verifiedfields = changed |
|
| ⚫ |
| verifiedrevid = 409964778 |
|
|
| IUPAC_name = 1,2-diphenyl-4-pyrazolidine-3,5-dione |
|
| IUPAC_name = 1,2-diphenyl-4-pyrazolidine-3,5-dione |
|
| image = Sulfinpyrazone.svg |
|
| image = Sulfinpyrazone.svg |
|
|
| image_class = skin-invert-image |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Apo-sulfinpyrazone |
|
| tradename = Anturan, Anturane, Apo-sulfinpyrazone |
|
| Drugs.com = {{drugs.com|monograph|sulfinpyrazone}} |
|
| Drugs.com = {{drugs.com|monograph|sulfinpyrazone}} |
|
| MedlinePlus = a682339 |
|
| MedlinePlus = a682339 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = oral intravenous |
|
| routes_of_administration = ] intravenous |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 98–99% |
|
| protein_bound = 98–99% |
|
| metabolism = hepatic |
|
| metabolism = liver |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = renal |
|
| excretion = kidney |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 5826 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 57-96-5 |
|
| CAS_number = 57-96-5 |
|
| ATC_prefix = M04 |
|
| ATC_prefix = M04 |
|
| ATC_suffix = AB02 |
|
| ATC_suffix = AB02 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 5342 |
|
| PubChem = 5342 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 42: |
Line 39: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00449 |
|
| KEGG = D00449 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 9342 |
|
| ChEBI = 9342 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 832 |
|
| ChEMBL = 832 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=20 | N=2 | O=3 | S=1 |
|
| C=23 | H=20 | N=2 | O=3 | S=1 |
|
| molecular_weight = 404.48 g/mol |
|
|
| smiles = O=C2N(c1ccccc1)N(C(=O)C2CCS(=O)c3ccccc3)c4ccccc4 |
|
| smiles = O=C2N(c1ccccc1)N(C(=O)C2CCS(=O)c3ccccc3)c4ccccc4 |
|
| InChI = 1/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,21H,16-17H2 |
|
|
| InChIKey = MBGGBVCUIVRRBF-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,21H,16-17H2 |
|
| StdInChI = 1S/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,21H,16-17H2 |
| Line 58: |
Line 51: |
|
| StdInChIKey = MBGGBVCUIVRRBF-UHFFFAOYSA-N |
|
| StdInChIKey = MBGGBVCUIVRRBF-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Sulfinpyrazone''' is a ] ] used to treat ]. It also sometimes is used to reduce ] aggregation by inhibiting ] of platelets which reduces the release of ] and ]. |
|
|
|
|
|
Like other uricosurics, sulfinpyrazone works by competitively inhibiting ] reabsorption in the ] of the ]. |
|
|
|
|
|
__TOC__ |
|
|
==Contraindications== |
|
|
Sulfinpyrazone must not be used in persons with ] or a history of uric acid kidney stones.<ref name="pmid16740561">{{cite journal | vauthors = Underwood M | title = Diagnosis and management of gout | journal = BMJ | volume = 332 | issue = 7553 | pages = 1315–9 | date = June 2006 | pmid = 16740561 | pmc = 1473078 | doi = 10.1136/bmj.332.7553.1315 }}</ref> |
|
|
|
|
|
== Research == |
|
|
Trial have found that, '''Sulfinpyrazone''' taken in specific daily dose immediately following a patient having suffered from a ] seem to drastically reduce the incidence of sudden death by as much as 43% and cardiac mortality by 32% in the 24 months following their '''heart attack'''. <ref>{{Cite journal|date=1980-01-31|title=Sulfinpyrazone in the Prevention of Sudden Death after Myocardial Infarction|url=https://doi.org/10.1056/NEJM198001313020502|journal=New England Journal of Medicine|volume=302|issue=5|pages=250–256|doi=10.1056/NEJM198001313020502|issn=0028-4793|pmid=6985706 |author1=Anturane Reinfarction Trial Research Group }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Antigout preparations}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |