| Revision as of 13:49, 10 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 13:55, 9 January 2023 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers214,339 editsm Cleaned up using AutoEd |
| (9 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| Name=TAN-1057 C <small>(top)</small> and TAN-1057 D <small>(bottom)</small> |
|
|
|
| verifiedrevid = 470482224 |
|
|
| Name={{nowrap|TAN-1057 C}} and {{nowrap|TAN-1057 D}} |
|
| ImageFile1 = TAN-1057C.png |
|
| ImageFile1 = TAN-1057C.png |
|
| ImageSize1 = 200px |
|
| ImageSize1 = |
|
|
| ImageAlt1 = TAN-1057 C |
|
|
| ImageCaption1 = TAN-1057 C |
|
| ImageFile2 = TAN-1057D.png |
|
| ImageFile2 = TAN-1057D.png |
|
|
| ImageAlt2 = TAN-1057 D |
|
| ImageSize2 = 200px |
|
|
|
| ImageCaption2 = TAN-1057 D |
|
| IUPACName = |
|
|
| OtherNames = |
|
| IUPACName = |
|
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7851330 |
|
| ChemSpiderID = 7851330 |
|
| InChI = 1/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
| InChI = 1/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
| InChIKey = PNFFUPQADHHLMN-DTWKUNHWBI |
|
| InChIKey = PNFFUPQADHHLMN-DTWKUNHWBI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
| StdInChI = 1S/C13H25N9O3/c1-22-9(6-19-20-7-18-13(16)25)11(24)21-8(5-10(22)23)3-2-4-17-12(14)15/h7-9,19H,2-6H2,1H3,(H,21,24)(H4,14,15,17)(H3,16,18,20,25)/t8-,9+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PNFFUPQADHHLMN-DTWKUNHWSA-N |
|
| StdInChIKey = PNFFUPQADHHLMN-DTWKUNHWSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| CASNo = 128126-46-5 |
|
|
| CASOther = (TAN-1057 C)<br>128126-47-6 (TAN-1057 D) |
|
| CASNo = 128126-46-5 |
|
|
| CASNo_Comment = (TAN-1057 C) |
|
|
| CASNo2_Ref = {{cascite|changed|??}} |
|
⚫ |
| CASNo2 = 128126-47-6 |
|
|
| CASNo2_Comment = (TAN-1057 D) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7TWX2V5P6Q |
|
| PubChem = 9576889 |
|
| PubChem = 9576889 |
|
| SMILES = O=C1N(C)(C(=O)N(C1)CCC/N=C(\N)N)CNN\C=N\C(=O)N |
|
| SMILES = O=C1N(C)(C(=O)N(C1)CCC/N=C(\N)N)CNN\C=N\C(=O)N |
| Line 20: |
Line 34: |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=13| H=25| N=9| O=3 |
|
| C=13| H=25| N=9| O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''TAN-1057 C''' and '''TAN-1057 D''' are organic compounds found in the ''] sp.'' PK-74 bacterium. TAN-1057 C and D are closely related structurally as ]s. Also related are ] and TAN-1057 B, isolated from the same bacteria. The four compounds have been shown to be an effective ]s against ]-resistant strains of '']'' which act through the inhibition of ] biosynthesis.<ref name=Katayama>{{cite journal | author=Katayama, N ''et al.'' | title=TAN-1057 A-D, new antibiotics with potent antibacterial activity against methicillin-resistant Staphylococcus aureus. Taxonomy, fermentation and biological activity | journal=J. Antibiot. | year=1993 | pages=606–613 | volume=46 | issue=4 | pmid=8501003}}</ref> |
|
'''TAN-1057 C''' and '''TAN-1057 D''' are organic compounds found in the ''] sp.'' PK-74 bacterium. TAN-1057 C and D are closely related structurally as ]s. Also related are ] and TAN-1057 B, isolated from the same bacteria. The four compounds have been shown to be an effective ]s against ]-resistant strains of '']'' which act through the inhibition of ] biosynthesis.<ref name=Katayama>{{cite journal | author=Katayama, N| title=TAN-1057 A-D, new antibiotics with potent antibacterial activity against methicillin-resistant Staphylococcus aureus. Taxonomy, fermentation and biological activity | journal=J. Antibiot. | year=1993 | pages=606–613 | volume=46 | issue=4 | pmid=8501003 | doi=10.7164/antibiotics.46.606|display-authors=etal| doi-access=free }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 40: |
Line 54: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|