Revision as of 15:42, 10 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 20:21, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,895 edits move systematic name |
(38 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{context|date=January 2009}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 401628400 |
|
|
|
| Watchedfields = changed |
⚫ |
| ImageFile=Theaflavin-3-gallate.png |
|
|
⚫ |
| verifiedrevid = 434805272 |
⚫ |
| ImageSize= |
|
|
⚫ |
| ImageFile=Theaflavin 3-gallate.svg |
|
| IUPACName= <small>benzoannulen-1-yl]chroman-3-yl] 3,4,5-trihydroxybenzoate</small> |
|
|
⚫ |
| ImageSize= |
⚫ |
| OtherNames = Theaflavin-3'-monogallate<br>TFMG<br>TF-2 |
|
|
|
| SystematicName = (2''R'',3''R'')-5,7-Dihydroxy-2-{3,4,6-trihydroxy-5-oxo-8--5''H''-benzoannulen-2-yl}-3,4-dihydro-2''H''-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = Theaflavin-3-monogallate; Theaflavin monogallate A; Theaflavin 2A; TFMG |
|
| InChI = 1/C36H28O16/c37-15-6-20(39)17-10-25(44)34(50-26(17)8-15)13-1-12-2-19(30(45)33(48)29(12)32(47)24(43)3-13)35-28(11-18-21(40)7-16(38)9-27(18)51-35)52-36(49)14-4-22(41)31(46)23(42)5-14/h1-9,25,28,34-35,37-42,44-46,48H,10-11H2,(H,43,47)/t25-,28-,34-,35-/m1/s1 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| InChIKey = AATSUYYYTHJRJO-RZYARBFNBG |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo=30462-34-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = S6469PF6TK |
|
|
| ChEMBL = 3039319 |
|
⚫ |
| PubChem=169167 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID=147959 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C36H28O16/c37-15-6-20(39)17-10-25(44)34(50-26(17)8-15)13-1-12-2-19(30(45)33(48)29(12)32(47)24(43)3-13)35-28(11-18-21(40)7-16(38)9-27(18)51-35)52-36(49)14-4-22(41)31(46)23(42)5-14/h1-9,25,28,34-35,37-42,44-46,48H,10-11H2,(H,43,47)/t25-,28-,34-,35-/m1/s1 |
|
| StdInChI = InChI=1S/C36H28O16/c37-14-5-20(39)18-10-26(45)35(51-27(18)7-14)17-9-25(44)33(48)30-16(17)1-12(2-24(43)32(30)47)34-29(11-19-21(40)6-15(38)8-28(19)50-34)52-36(49)13-3-22(41)31(46)23(42)4-13/h1-9,26,29,34-35,37-42,44-46,48H,10-11H2,(H,43,47)/t26-,29-,34-,35-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = AATSUYYYTHJRJO-RZYARBFNSA-N |
|
| StdInChIKey = KMJPKUVSXFVQGZ-WQLSNUALSA-N |
|
|
| SMILES = c1c(cc(=O)c(c2c1c(cc(c2O)O)3(Cc4c(cc(cc4O3)O)O)O)O)5(Cc6c(cc(cc6O5)O)O)OC(=O)c7cc(c(c(c7)O)O)O |
⚫ |
| CASNo=28543-07-9 |
|
⚫ |
| PubChem=467321 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID=17216344 |
|
|
| SMILES = Oc1cc(cc(O)c1O)C(=O)O2Cc7c(O)cc(O)cc7O2c4cc3\C=C(/C=C(/O)C(=O)c3c(O)c4O)5Oc6cc(O)cc(O)c6C5O |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>36</sub>H<sub>28</sub>O<sub>16</sub> |
|
| C=36 | H =28 | O=16 |
|
|
| Appearance= |
|
| MolarMass = 716.59 g/mol |
|
|
|
| Density= |
|
| ExactMass = 716.137735 |
|
|
| Appearance= |
|
| MeltingPt= |
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Theaflavin-3-gallate''' is a ] ]. It can be found in ]<ref></ref>. |
|
|
|
'''Theaflavin-3-gallate''' is a ] ]. It can be found in abundance in ] and is produced during fermentation.<ref>X. Hu, Z. Ping, M. Gan et al., “Theaflavin-3,3′-digallate represses osteoclastogenesis and prevents wear debris-induced osteolysis via suppression of ERK pathway,” ''Acta Biomaterialia'' 48 (2017): 479–488.</ref><ref>Shan Z, Nisar M, Li M, Zhang C, Wan C. Theaflavin Chemistry and Its Health Benefits Oxidative Medicine and Cellular Longevity. 2021 Jan;2021. PMCID: PMC8601833.</ref><ref>{{cite journal | title = Theaflavins from Black Tea, Especially Theaflavin-3-gallate, Reduce the Incorporation of Cholesterol into Mixed Micelles | author = Mario A. Vermeer, Theo P. J. Mulder and Henri O. F. Molhuizen | journal = J. Agric. Food Chem. | date = 2008 | volume = 56 | issue = 24 | pages = 12031–12036 | doi = 10.1021/jf8022035 | pmid=19049290}}</ref> It has been studied as a cancer-fighting chemical when combined with cisplatin against ovarian cancer cells.<ref>Shan Z, Nisar M, Li M, Zhang C, Wan C. Theaflavin Chemistry and Its Health Benefits Oxidative Medicine and Cellular Longevity. 2021 Jan;2021. PMCID: PMC8601833.</ref><ref>Y. Gao, J. Yin, Y. Tu, and Y. Chen, “Theaflavin-3, 3′-digallate suppresses human ovarian carcinoma OVCAR-3 cells by regulating the checkpoint kinase 2 and p27 kip1 pathways,” ''Molecules'' 24 (4): 673, 2019</ref> <ref>H. Pan, E. Kim, G. Rankin, Y. Rojanasakul, Y. Tu, and Y. Chen, “Theaflavin-3, 3′-Digallate enhances the inhibitory effect of cisplatin by regulating the copper transporter 1 and glutathione in human ovarian cancer cells,” ''International Journal of Molecular Sciences'' 19 (1): 117, 2018.</ref> Consuming large amounts of black tea has been reported to reduce the effects of aging in female populations.<ref>Shan Z, Nisar M, Li M, Zhang C, Wan C., "Theaflavin Chemistry and Its Health Benefits", ''Oxidative Medicine and Cellular Longevity'' 2021 Jan; 2021. PMCID: PMC8601833.</ref><ref>Y. Oka, S. Iwai, H. Amano et al., “Tea polyphenols inhibit rat osteoclast formation and differentiation,” ''Journal of Pharmacological Sciences'' 118 (1): 55–64, 2012.</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
Line 45: |
Line 50: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{polyphenol-stub}} |
|
{{Aromatic-stub}} |